2,2,6-Trimethyl-6-(4-methylphenyl)oxane
PubChem CID: 5316214
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | SCHEMBL15770556 |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 9.2 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CCC(C2CCCCC2)CC1 |
| Np Classifier Class | Bisabolane sesquiterpenoids |
| Deep Smiles | Ccccccc6))CC)CCCCO6)C)C |
| Heavy Atom Count | 16.0 |
| Classyfire Class | Benzene and substituted derivatives |
| Scaffold Graph Node Level | C1CCC(C2CCCCO2)CC1 |
| Classyfire Subclass | Toluenes |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 238.0 |
| Database Name | imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2,2,6-trimethyl-6-(4-methylphenyl)oxane |
| Nih Violation | False |
| Veber Rule | True |
| Classyfire Superclass | Benzenoids |
| Xlogp | 3.6 |
| Is Pains | False |
| Gsk 4 400 Rule | False |
| Molecular Formula | C15H22O |
| Scaffold Graph Node Bond Level | c1ccc(C2CCCCO2)cc1 |
| Inchi Key | NKSUFXDOOSPKIX-UHFFFAOYSA-N |
| Silicos It Class | Moderately soluble |
| Rotatable Bond Count | 1.0 |
| Synonyms | curcumene ether |
| Esol Class | Soluble |
| Functional Groups | COC |
| Compound Name | 2,2,6-Trimethyl-6-(4-methylphenyl)oxane |
| Exact Mass | 218.167 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 218.167 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 218.33 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C15H22O/c1-12-6-8-13(9-7-12)15(4)11-5-10-14(2,3)16-15/h6-9H,5,10-11H2,1-4H3 |
| Smiles | CC1=CC=C(C=C1)C2(CCCC(O2)(C)C)C |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Sesquiterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Alisma Orientalis (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Bunias Orientalis (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Canna Orientalis (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Celtis Orientalis (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Clematis Orientalis (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Consolida Orientalis (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Davallia Orientalis (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Digitalis Orientalis (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Elaeagnus Orientalis (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Erythrina Orientalis (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Hyacinthus Orientalis (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Liquidambar Orientalis (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Matteuccia Orientalis (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Nauclea Orientalis (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Perriera Orientalis (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Persicaria Orientalis (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Platanus Orientalis (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Platycladus Orientalis (Plant) Rel Props:Reference:ISBN:9788185042084 - 19. Outgoing r'ship
FOUND_INto/from Scutellaria Orientalis (Plant) Rel Props:Reference: - 20. Outgoing r'ship
FOUND_INto/from Sida Orientalis (Plant) Rel Props:Reference: - 21. Outgoing r'ship
FOUND_INto/from Sigesbeckia Orientalis (Plant) Rel Props:Reference: - 22. Outgoing r'ship
FOUND_INto/from Stipa Orientalis (Plant) Rel Props:Reference: - 23. Outgoing r'ship
FOUND_INto/from Thuja Compacta (Plant) Rel Props:Reference: - 24. Outgoing r'ship
FOUND_INto/from Thuja Dolabrata (Plant) Rel Props:Reference: - 25. Outgoing r'ship
FOUND_INto/from Thuja Koraiensis (Plant) Rel Props:Reference: - 26. Outgoing r'ship
FOUND_INto/from Thuja Occidentalis (Plant) Rel Props:Reference: - 27. Outgoing r'ship
FOUND_INto/from Thuja Orientalis (Plant) Rel Props:Source_db:npass_chem_all - 28. Outgoing r'ship
FOUND_INto/from Thuja Plicata (Plant) Rel Props:Reference: - 29. Outgoing r'ship
FOUND_INto/from Thuja Standishii (Plant) Rel Props:Reference: - 30. Outgoing r'ship
FOUND_INto/from Tragopogon Orientalis (Plant) Rel Props:Reference: - 31. Outgoing r'ship
FOUND_INto/from Trema Orientalis (Plant) Rel Props:Reference: - 32. Outgoing r'ship
FOUND_INto/from Typha Orientalis (Plant) Rel Props:Reference: - 33. Outgoing r'ship
FOUND_INto/from Uncaria Orientalis (Plant) Rel Props:Reference: - 34. Outgoing r'ship
FOUND_INto/from Vismia Orientalis (Plant) Rel Props:Reference: - 35. Outgoing r'ship
FOUND_INto/from Woodwardia Orientalis (Plant) Rel Props:Reference: - 36. Outgoing r'ship
FOUND_INto/from Wulfenia Orientalis (Plant) Rel Props:Reference: - 37. Outgoing r'ship
FOUND_INto/from Zosima Orientalis (Plant) Rel Props:Reference: