Farnesyl acetate, (2Z,6Z)-
PubChem CID: 1551479
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | (2Z,6Z)-Farnesyl acetate, all-cis-Farnesyl acetate, 6KSQ7YD7EB, Farnesyl acetate, (2Z,6Z)-, UNII-6KSQ7YD7EB, 24163-97-1, FEMA No. 4213, (2Z,6Z)-, [(2Z,6Z)-3,7,11-trimethyldodeca-2,6,10-trienyl] acetate, 2,6,10-Dodecatrien-1-ol, 3,7,11-trimethyl-, acetate, (Z,Z)-, 2,6,10-Dodecatrien-1-ol, 3,7,11-trimethyl-, 1-acetate, (2Z,6Z)-, Farnesyl acetate, ((2Z,6Z)-3,7,11-trimethyldodeca-2,6,10-trienyl) acetate, SCHEMBL806928, Trans,trans-farnesyl acetate,95%, LMFA07010254, Q27265064, (2Z,6Z)-3,7,11-Trimethyl-2,6,10-dodecatrienyl acetate #, Acetic acid, [(Z,Z)-3,7,11-trimethyl-2,6,10-dodecatrien-1-yl] ester |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 26.3 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Np Classifier Class | Farnesane sesquiterpenoids |
| Deep Smiles | C/C=C/CC/C=CCOC=O)C)))))/C)))))/CCC=CC)C |
| Heavy Atom Count | 19.0 |
| Classyfire Class | Prenol lipids |
| Classyfire Subclass | Sesquiterpenoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 355.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | [(2Z,6Z)-3,7,11-trimethyldodeca-2,6,10-trienyl] acetate |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 5.3 |
| Is Pains | False |
| Gsk 4 400 Rule | False |
| Molecular Formula | C17H28O2 |
| Prediction Swissadme | 0.0 |
| Inchi Key | ZGIGZINMAOQWLX-CYRKZOTCSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.5882352941176471 |
| Logs | -3.026 |
| Rotatable Bond Count | 9.0 |
| Logd | 2.481 |
| Synonyms | farnesy lacetate, farnesyl acetate, farnesyl acetate, farnesyl acetate*, farnesyl acetate● |
| Esol Class | Moderately soluble |
| Functional Groups | C/C=C(C)C, CC=C(C)C, COC(C)=O |
| Compound Name | Farnesyl acetate, (2Z,6Z)- |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 264.209 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 264.209 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 264.4 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 2.0 |
| Lipinski Rule Of 5 | True |
| Esol | -4.6023358 |
| Inchi | InChI=1S/C17H28O2/c1-14(2)8-6-9-15(3)10-7-11-16(4)12-13-19-17(5)18/h8,10,12H,6-7,9,11,13H2,1-5H3/b15-10-,16-12- |
| Smiles | CC(=CCC/C(=C\CC/C(=C\COC(=O)C)/C)/C)C |
| Nring | 3.0 |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 2.0 |
| Egan Rule | True |
| Np Classifier Superclass | Sesquiterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Ageratum Conyzoides (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2005.9698888 - 2. Outgoing r'ship
FOUND_INto/from Cananga Odorata (Plant) Rel Props:Reference:ISBN:9788185042138 - 3. Outgoing r'ship
FOUND_INto/from Citrus Aurantium (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2011.9700446 - 4. Outgoing r'ship
FOUND_INto/from Citrus Maxima (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 5. Outgoing r'ship
FOUND_INto/from Cordia Sebestena (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2014.884758 - 6. Outgoing r'ship
FOUND_INto/from Corymbia Calophylla (Plant) Rel Props:Reference:https://doi.org/10.1002/(sici)1099-1026(199611)11:6<339::aid-ffj595>3.0.co;2-x - 7. Outgoing r'ship
FOUND_INto/from Cymbopogon Martini (Plant) Rel Props:Reference:https://doi.org/10.1002/(sici)1099-1026(199805/06)13:3<167::aid-ffj719>3.0.co;2-b - 8. Outgoing r'ship
FOUND_INto/from Desmos Chinensis (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2012.10662610 - 9. Outgoing r'ship
FOUND_INto/from Eucalyptus Baueriana (Plant) Rel Props:Reference:https://doi.org/10.1002/(sici)1099-1026(199701)12:1<19::aid-ffj597>3.0.co;2-f - 10. Outgoing r'ship
FOUND_INto/from Eucalyptus Crebra (Plant) Rel Props:Reference:https://doi.org/10.1002/(sici)1099-1026(199701)12:1<19::aid-ffj597>3.0.co;2-f - 11. Outgoing r'ship
FOUND_INto/from Eucalyptus Melliodora (Plant) Rel Props:Reference:https://doi.org/10.1002/(sici)1099-1026(199701)12:1<19::aid-ffj597>3.0.co;2-f - 12. Outgoing r'ship
FOUND_INto/from Eucalyptus Moluccana (Plant) Rel Props:Reference:https://doi.org/10.1002/(sici)1099-1026(199701)12:1<19::aid-ffj597>3.0.co;2-f - 13. Outgoing r'ship
FOUND_INto/from Eucalyptus Sideroxylon (Plant) Rel Props:Reference:https://doi.org/10.1002/(sici)1099-1026(199701)12:1<19::aid-ffj597>3.0.co;2-f - 14. Outgoing r'ship
FOUND_INto/from Eucalyptus Staigeriana (Plant) Rel Props:Reference:https://doi.org/10.1002/(sici)1099-1026(199701)12:1<19::aid-ffj597>3.0.co;2-f - 15. Outgoing r'ship
FOUND_INto/from Lavandula Angustifolia (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2017.1363000 - 16. Outgoing r'ship
FOUND_INto/from Liquidambar Orientalis (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.1050 - 17. Outgoing r'ship
FOUND_INto/from Luvunga Scandens (Plant) Rel Props:Reference:ISBN:9770972795006 - 18. Outgoing r'ship
FOUND_INto/from Plumeria Rubra (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.2730060407 - 19. Outgoing r'ship
FOUND_INto/from Psidium Guajava (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2018.1431152 - 20. Outgoing r'ship
FOUND_INto/from Pulicaria Undulata (Plant) Rel Props:Reference:ISBN:9788172362461 - 21. Outgoing r'ship
FOUND_INto/from Rhaponticum Repens (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2012.10662597 - 22. Outgoing r'ship
FOUND_INto/from Rosmarinus Officinalis (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2000.9699572 - 23. Outgoing r'ship
FOUND_INto/from Telosma Cordata (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.2730080410 - 24. Outgoing r'ship
FOUND_INto/from Teucrium Polium (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.1998.9700855