Decan-5-ol
PubChem CID: 99868
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 5-Decanol, Decan-5-ol, 5205-34-5, Amylbutylcarbinol, 5-Decyl Alcohol, Butylpentylcarbinol, AI3-19950, EINECS 225-999-2, GUU86H79T8, DTXSID201318612, NSC 244888, NSC-244888, 5-hydroxydecane, Decan5ol, MFCD00039626, NSC244888, UNII-GUU86H79T8, SCHEMBL378684, DTXCID40854781, CHEBI:195603, AKOS009158086, SB83884, DB-052067, CS-0327095, D1381, NS00044702, T70997, 225-999-2 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 20.2 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Np Classifier Class | Fatty alcohols |
| Deep Smiles | CCCCCCCCCC))))O |
| Heavy Atom Count | 11.0 |
| Classyfire Class | Fatty acyls |
| Classyfire Subclass | Fatty alcohols |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 71.3 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | decan-5-ol |
| Nih Violation | True |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 3.8 |
| Is Pains | False |
| Gsk 4 400 Rule | True |
| Molecular Formula | C10H22O |
| Inchi Key | SZMNDOUFZGODBR-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 7.0 |
| Synonyms | 5-decanol |
| Esol Class | Soluble |
| Functional Groups | CO |
| Compound Name | Decan-5-ol |
| Exact Mass | 158.167 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 158.167 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 158.28 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C10H22O/c1-3-5-7-9-10(11)8-6-4-2/h10-11H,3-9H2,1-2H3 |
| Smiles | CCCCCC(CCCC)O |
| Np Classifier Biosynthetic Pathway | Fatty acids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Fatty acyls |
- 1. Outgoing r'ship
FOUND_INto/from Coriandrum Sativum (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2008.10643676