Phenanthrene
PubChem CID: 995
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | PHENANTHRENE, 85-01-8, Phenanthren, Phenanthracene, Phenanthrin, Ravatite, Phenantrin, Phenanthrene, pure, CCRIS 1233, HSDB 2166, EINECS 201-581-5, UNII-448J8E5BST, NSC 26256, NSC-26256, 448J8E5BST, DTXSID6024254, CHEBI:28851, AI3-00790, (3)HELICENE, MFCD00001168, CHEMBL46730, DTXCID904254, NSC26256, Phenanthrene 10 microg/mL in Cyclohexane, Phenanthrene 200 microg/mL in Isooctane, Phenanthrene 10 microg/mL in Acetonitrile, Phenanthrene 100 microg/mL in Acetonitrile, PHENANTHRENE (IARC), PHENANTHRENE [IARC], Phenanthren [German], CAS-85-01-8, PEY, 9-Phenanthrene, phenanthrene-ring, Phenanthrene, 98%, Coal tar pitch volatiles: phenanthrene, Phenanthrene (Standard), Phenanthrene Zone Refined, PHENANTHRENE [MI], 9,10-Dehydrophenanthrene, bmse000560, PHENANTHRENE [HSDB], MLS002454437, WLN: L B666J, HY-B1727R, HMS2268O22, HY-B1727, MAC77068, Tox21_201638, Tox21_300573, BDBM50159266, STL453632, AKOS008967330, Phenanthrene (purified by sublimation), Phenanthrene, zone-refined, >=99.5%, NCGC00091177-01, NCGC00091177-02, NCGC00091177-03, NCGC00091177-04, NCGC00254398-01, NCGC00259187-01, Phenanthrene, sublimed grade, >=99.5%, AC-11346, AS-12847, SMR000112025, DB-043112, CS-0013733, NS00009484, P0079, P0331, P1310, P2877, EN300-18073, Phenanthrene Zone Refined (number of passes:30), A841054, Q422037, Z57139327, Phenanthrene, certified reference material, TraceCERT(R), Phenanthrene, purum, for fluorescence, >=97.0% (HPLC), Phenanthrene, analytical standard, for environmental analysis, InChI=1/C14H10/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13/h1-10, 201-581-5 |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 0.0 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CCC2C(C1)CCC1CCCCC12 |
| Np Classifier Class | Phenanthrenes |
| Deep Smiles | cccccc6)cccccc6cc%10 |
| Heavy Atom Count | 14.0 |
| Classyfire Class | Phenanthrenes and derivatives |
| Scaffold Graph Node Level | C1CCC2C(C1)CCC1CCCCC12 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 174.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | P11509, P20852, Q99714, Q9NUW8, P16473, P00352, O75164, Q96RI1, P83916, Q12809, P19793, Q16236, P10145, n.a., P05412 |
| Iupac Name | phenanthrene |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Veber Rule | True |
| Classyfire Superclass | Benzenoids |
| Target Id | NPT240, NPT149, NPT50, NPT210, NPT94 |
| Xlogp | 4.5 |
| Is Pains | False |
| Gsk 4 400 Rule | True |
| Molecular Formula | C14H10 |
| Scaffold Graph Node Bond Level | c1ccc2c(c1)ccc1ccccc12 |
| Prediction Swissadme | 0.0 |
| Inchi Key | YNPNZTXNASCQKK-UHFFFAOYSA-N |
| Silicos It Class | Moderately soluble |
| Fcsp3 | 0.0 |
| Logs | -5.966 |
| Rotatable Bond Count | 0.0 |
| Logd | 3.995 |
| Synonyms | phenanthrene, phenanthrenea ( = i) |
| Esol Class | Moderately soluble |
| Compound Name | Phenanthrene |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 178.078 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 178.078 |
| Hydrogen Bond Acceptor Count | 0.0 |
| Molecular Weight | 178.23 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | -4.4948508 |
| Inchi | InChI=1S/C14H10/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13/h1-10H |
| Smiles | C1=CC=C2C(=C1)C=CC3=CC=CC=C32 |
| Nring | 3.0 |
| Np Classifier Biosynthetic Pathway | Shikimates and Phenylpropanoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Phenanthrenoids |
- 1. Outgoing r'ship
FOUND_INto/from Actaea Cimicifuga (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 2. Outgoing r'ship
FOUND_INto/from Actaea Dahurica (Plant) Rel Props:Source_db:cmaup_ingredients - 3. Outgoing r'ship
FOUND_INto/from Actaea Simplex (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 4. Outgoing r'ship
FOUND_INto/from Arnebia Euchroma (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 5. Outgoing r'ship
FOUND_INto/from Arnebia Guttata (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 6. Outgoing r'ship
FOUND_INto/from Bletilla Striata (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 7. Outgoing r'ship
FOUND_INto/from Bursera Graveolens (Plant) Rel Props:Source_db:npass_chem_all - 8. Outgoing r'ship
FOUND_INto/from Crinum Latifolium (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2003.9712111 - 9. Outgoing r'ship
FOUND_INto/from Dioscorea Bulbifera (Plant) Rel Props:Reference:ISBN:9788172360481 - 10. Outgoing r'ship
FOUND_INto/from Equisetum Palustre (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2008.9700020 - 11. Outgoing r'ship
FOUND_INto/from Hyptis Suaveolens (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2014.935019 - 12. Outgoing r'ship
FOUND_INto/from Lithospermum Erythrorhizon (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 13. Outgoing r'ship
FOUND_INto/from Morus Serrata (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 14. Outgoing r'ship
FOUND_INto/from Peganum Harmala (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 15. Outgoing r'ship
FOUND_INto/from Pterocarpus Macrocarpus (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2016.1278183 - 16. Outgoing r'ship
FOUND_INto/from Pterolobium Hexapetalum (Plant) Rel Props:Reference:ISBN:9788185042138 - 17. Outgoing r'ship
FOUND_INto/from Salvia Coccinea (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.2730060408 - 18. Outgoing r'ship
FOUND_INto/from Salvia Nemorosa (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.3389 - 19. Outgoing r'ship
FOUND_INto/from Salvia Officinalis (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.3389 - 20. Outgoing r'ship
FOUND_INto/from Salvia Pratensis (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.3389 - 21. Outgoing r'ship
FOUND_INto/from Salvia Sclarea (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.3389 - 22. Outgoing r'ship
FOUND_INto/from Trichosanthes Rosthornii (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 23. Outgoing r'ship
FOUND_INto/from Trifolium Repens (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2010.9700417 - 24. Outgoing r'ship
FOUND_INto/from Zanthoxylum Armatum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all