9-cis-Retinol
PubChem CID: 9947823
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 9-cis-Retinol, Zuretinol, 22737-97-9, 9-cis retinol, Retinol, 9-cis-, 9-cis-Vitamin A Alcohol, 9Z-retinol, UNII-035JKP3HXH, (9cis)-retinol, 035JKP3HXH, ZURETINOL [WHO-DD], CHEBI:78272, (2E,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-ol, (2E,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraen-1-ol, 9-cisRetinol, SCHEMBL254333, CHEMBL4802238, FPIPGXGPPPQFEQ-MKOSUFFBSA-N, DTXSID201317690, LMPR01090009, AKOS027326795, FR27717, 9-cis-Retinol, 9-cis-Vitamin A alcohol, CS-0643662, Q27147725 |
|---|---|
| Topological Polar Surface Area | 20.2 |
| Hydrogen Bond Donor Count | 1.0 |
| Inchi Key | FPIPGXGPPPQFEQ-MKOSUFFBSA-N |
| Rotatable Bond Count | 5.0 |
| State | Solid |
| Substituent Name | Retinoid skeleton, Diterpenoid, Fatty alcohol, Fatty acyl, Hydrocarbon derivative, Primary alcohol, Organooxygen compound, Alcohol, Aliphatic homomonocyclic compound |
| Synonyms | (11-cis,13-cis)-Retinol acetate, (13cis)-retinol, (2Z,4e,6e,8e)-3,7-Dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraen-1-ol, 11-cis-13-cis-Retinol acetate, 11-cis-13-cis-Retinyl acetate, 11,13-Di-cis-vitamin A acetate, 13-cis-retinol, Neovitamin A, RETINOL, (2e,4e,6e,8e)-3,7-Dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraen-1-ol, (all-e)-3,7-Dimethyl-9-(2,6,6-trimethyl-1-cyclohexen-1-yl)-2,4,6,8-nonatetraen-1-ol, Afaxin, Agiolan, Agoncal, all-trans-Retinol, all-trans-Retinyl alcohol, all-trans-Vitamin A, all-trans-Vitamin A alcohol, all-trans-Vitamin A1, Alphalin, Alphasterol, Antixerophthalmic vitamin, Avibon, Avitol, Axerol, Axerophthol, b-Retinol, beta-Retinol, Biosterol, Epiteliol, Gadol, Ophthalamin, Prepalin, Retrovitamin a, Sehkraft a, trans-Retinol, trans-Vitamin A alcohol, Vitamin A, Vitamin A alcohol, Vitamin a1 |
| Heavy Atom Count | 21.0 |
| Pathway Kegg Map Id | map00830 |
| Compound Name | 9-cis-Retinol |
| Kingdom | Organic compounds |
| Description | Constituent of cod liver oil 13-cis Retinol is a retinoid inapplicable to the visual processes, and therefore it could be an important catabolic metabolite and its biosynthesis could be part of a process involved in regulating 11-cis-retinol concentrations within the retinal pigment epithelium of 11-cis-retinol dehydrogenase. 13-cis Retinol accumulates as a consequence of reduced 11-cis-retinol oxidation capacity. Reduced 11-cis-retinol oxidation occurs in 11-cis-Retinol dehydrogenase deficiency. Mutations in the 11-cis-retinol dehydrogenase gene in humans have been associated with fundus albipunctatus (delayed dark adaptation and punctata are typical symptoms of this human hereditary ocular disease). (PMID: 10825191). (13Z)-Retinol is found in fats and oils and fishes. |
| Exact Mass | 286.23 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 286.23 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 496.0 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 286.5 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Enzyme Uniprot Id | O75907, O95237, Q96PD7, Q9NYR8, Q8TC12, Q8IZV5, Q58HT5, Q6E213, O75911 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | (2E,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-ol |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 4.0 |
| Class | Prenol lipids |
| Inchi | InChI=1S/C20H30O/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5/h6,8-9,11-13,21H,7,10,14-15H2,1-5H3/b9-6+,12-11+,16-8-,17-13+ |
| Smiles | CC1=C(C(CCC1)(C)C)/C=C/C(=C\C=C\C(=C\CO)\C)/C |
| Xlogp | 5.7 |
| Superclass | Lipids and lipid-like molecules |
| Defined Bond Stereocenter Count | 4.0 |
| Subclass | Retinoids |
| Molecular Formula | C20H30O |
- 1. Outgoing r'ship
FOUND_INto/from Avena Sativa (Plant) Rel Props:Source_db:fooddb_chem_all - 2. Outgoing r'ship
FOUND_INto/from Cichorium Intybus (Plant) Rel Props:Source_db:fooddb_chem_all - 3. Outgoing r'ship
FOUND_INto/from Glycine Max (Plant) Rel Props:Source_db:fooddb_chem_all - 4. Outgoing r'ship
FOUND_INto/from Hippophae Rhamnoides (Plant) Rel Props:Source_db:fooddb_chem_all - 5. Outgoing r'ship
FOUND_INto/from Papaver Somniferum (Plant) Rel Props:Source_db:fooddb_chem_all - 6. Outgoing r'ship
FOUND_INto/from Petroselinum Crispum (Plant) Rel Props:Source_db:fooddb_chem_all