Persenone A
PubChem CID: 9929676
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Persenone A, 5CLD5N1FYL, Persenone A, (+/-)-, UNII-5CLD5N1FYL, 215117-03-6, 5,12,15-Heneicosatrien-4-one, 1-(acetyloxy)-2-hydroxy-, (5E,12Z,15Z)-, (5E,12Z,15Z)-2-hydroxy-4-oxohenicosa-5,12,15-trien-1-yl acetate, [(5E,12Z,15Z)-2-hydroxy-4-oxohenicosa-5,12,15-trienyl] acetate, 5,6-Didehydropersin, (+/-)-persenone a, SCHEMBL12097022, CHEBI:66735, LMFA05000690, Q27135357 |
|---|---|
| Topological Polar Surface Area | 63.6 |
| Hydrogen Bond Donor Count | 1.0 |
| Heavy Atom Count | 27.0 |
| Description | Constituent of the fruit of avocado (Persea americana). Persenone A is found in fruits. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 463.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | [(5E,12Z,15Z)-2-hydroxy-4-oxohenicosa-5,12,15-trienyl] acetate |
| Nih Violation | False |
| Prediction Hob | 0.0 |
| Class | Fatty Acyls |
| Xlogp | 5.8 |
| Superclass | Lipids and lipid-like molecules |
| Is Pains | False |
| Subclass | Fatty alcohols |
| Molecular Formula | C23H38O4 |
| Prediction Swissadme | 0.0 |
| Inchi Key | YLWJMUPPJKELEC-GQQAEKEGSA-N |
| Fcsp3 | 0.6521739130434783 |
| Rotatable Bond Count | 18.0 |
| Synonyms | 5,6-Didehydropersin, Persenone A |
| Compound Name | Persenone A |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 378.277 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 378.277 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 378.5 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 3.0 |
| Molecular Framework | Aliphatic acyclic compounds |
| Esol | -4.671928600000001 |
| Inchi | InChI=1S/C23H38O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22(25)19-23(26)20-27-21(2)24/h7-8,10-11,17-18,23,26H,3-6,9,12-16,19-20H2,1-2H3/b8-7-,11-10-,18-17+ |
| Smiles | CCCCC/C=C\C/C=C\CCCCC/C=C/C(=O)CC(COC(=O)C)O |
| Defined Bond Stereocenter Count | 3.0 |
| Taxonomy Direct Parent | Long-chain fatty alcohols |
- 1. Outgoing r'ship
FOUND_INto/from Persea Americana (Plant) Rel Props:Source_db:cmaup_ingredients