Nicotianamine
PubChem CID: 9882882
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Nicotianamine, 34441-14-0, (S,S,S)-nicotianamine, 2OGX6YHQ1F, UNII-2OGX6YHQ1F, 1-Azetidinebutanoic acid, alpha-((3-amino-3-carboxypropyl)amino)-2-car boxy-, (2S-(1(alphaR*(R*)),2R*))-, CHEMBL3581907, (2S)-1-[(3S)-3-[[(3S)-3-amino-3-carboxypropyl]amino]-3-carboxypropyl]azetidine-2-carboxylic acid, (2S)-1-[(3S)-3-{[(3S)-3-amino-3-carboxypropyl]amino}-3-carboxypropyl]azetidine-2-carboxylic acid, 1-Azetidinebutanoic acid, alpha-((3-amino-3-carboxypropyl)amino)-2-carboxy-, (2S-(1(alphaR*(R*)),2R*))-, SCHEMBL542007, DTXSID8037677, CHEBI:17721, BDBM50090921, AKOS030242342, FN26195, HY-121858, C05324, G91506, Q11324211, 044DBB66-112B-48B2-8A19-380C1C452CB2, (alphaS,2S)-alpha-[[(3S)-3-Amino-3-carboxypropyl]amino]-2-carboxy-1-azetidinebutanoic Acid, [2S-[1[alphaR*(R*)],2R*]]-alpha-[(3-Amino-3-carboxypropyl)amino]-2-carboxy- 1-azetidinebutanoic Acid |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 153.0 |
| Hydrogen Bond Donor Count | 5.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | C1CCC1 |
| Np Classifier Class | Aminoacids |
| Deep Smiles | N[C@H]C=O)O))CCN[C@H]C=O)O))CCNCC[C@H]4C=O)O |
| Heavy Atom Count | 21.0 |
| Classyfire Class | Carboxylic acids and derivatives |
| Description | Nicotianamine is a member of the class of compounds known as L-alpha-amino acids. L-alpha-amino acids are alpha amino acids which have the L-configuration of the alpha-carbon atom. Nicotianamine is soluble (in water) and a moderately acidic compound (based on its pKa). Nicotianamine can be found in a number of food items such as common beet, oat, sweet cherry, and italian sweet red pepper, which makes nicotianamine a potential biomarker for the consumption of these food products. Nicotianamine is a metal-chelating molecule ubiquitous in higher plants. Biochemically, it is synthesized by the enzyme nicotianamine synthase, which uses three molecules of S-adenosylmethionine . |
| Scaffold Graph Node Level | C1CNC1 |
| Classyfire Subclass | Amino acids, peptides, and analogues |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 402.0 |
| Database Name | fooddb_chem_all;imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 3.0 |
| Iupac Name | (2S)-1-[(3S)-3-[[(3S)-3-amino-3-carboxypropyl]amino]-3-carboxypropyl]azetidine-2-carboxylic acid |
| Veber Rule | True |
| Classyfire Superclass | Organic acids and derivatives |
| Xlogp | -8.2 |
| Gsk 4 400 Rule | True |
| Molecular Formula | C12H21N3O6 |
| Scaffold Graph Node Bond Level | C1CNC1 |
| Inchi Key | KRGPXXHMOXVMMM-CIUDSAMLSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 10.0 |
| Synonyms | (s,s,s)-nicotianamine, Nicotianamine, nicotianamine |
| Esol Class | Highly soluble |
| Functional Groups | CC(=O)O, CN, CN(C)C, CNC |
| Compound Name | Nicotianamine |
| Exact Mass | 303.143 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 303.143 |
| Hydrogen Bond Acceptor Count | 9.0 |
| Molecular Weight | 303.31 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 3.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C12H21N3O6/c13-7(10(16)17)1-4-14-8(11(18)19)2-5-15-6-3-9(15)12(20)21/h7-9,14H,1-6,13H2,(H,16,17)(H,18,19)(H,20,21)/t7-,8-,9-/m0/s1 |
| Smiles | C1CN([C@@H]1C(=O)O)CC[C@@H](C(=O)O)NCC[C@@H](C(=O)O)N |
| Np Classifier Biosynthetic Pathway | Amino acids and Peptides |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Np Classifier Superclass | Small peptides |
- 1. Outgoing r'ship
FOUND_INto/from Avena Sativa (Plant) Rel Props:Source_db:fooddb_chem_all - 2. Outgoing r'ship
FOUND_INto/from Glycine Max (Plant) Rel Props:Source_db:fooddb_chem_all - 3. Outgoing r'ship
FOUND_INto/from Lycopersicon Esculentum (Plant) Rel Props:Source_db:fooddb_chem_all - 4. Outgoing r'ship
FOUND_INto/from Oryza Sativa (Plant) Rel Props:Source_db:fooddb_chem_all - 5. Outgoing r'ship
FOUND_INto/from Osmanthus Fragrans (Plant) Rel Props:Reference:ISBN:9788185042114 - 6. Outgoing r'ship
FOUND_INto/from Zea Mays (Plant) Rel Props:Source_db:fooddb_chem_all