Eleutheroside C
PubChem CID: 9859136
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | ELEUTHEROSIDE C, 15486-24-5, (2S,3R,4S,5R,6R)-2-ETHOXY-6-(HYDROXYMETHYL)OXANE-3,4,5-TRIOL, ELEUTHEROSIDEC, Ethyl a-D-galactoside, ethyl a-d-galactopyranoside, 1-Ethyl-beta-D-galactoside, SCHEMBL2446115, DTXSID50879263, CHEBI:228960, HY-N3802, ?-D-GALACTOPYRANOSIDE, ETHYL, AKOS032948775, DA-63309, FE158668, MS-23142, CS-0024249, G13203, Ethyl -D-galactoside, Ethyl -D-galactopyranoside |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 99.4 |
| Hydrogen Bond Donor Count | 4.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | C1CCCCC1 |
| Deep Smiles | CCO[C@H]O[C@H]CO))[C@@H][C@@H][C@H]6O))O))O |
| Heavy Atom Count | 14.0 |
| Classyfire Class | Organooxygen compounds |
| Scaffold Graph Node Level | C1CCOCC1 |
| Classyfire Subclass | Carbohydrates and carbohydrate conjugates |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 175.0 |
| Database Name | imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 5.0 |
| Iupac Name | (2S,3R,4S,5R,6R)-2-ethoxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| Nih Violation | False |
| Veber Rule | True |
| Classyfire Superclass | Organic oxygen compounds |
| Xlogp | -1.8 |
| Is Pains | False |
| Gsk 4 400 Rule | True |
| Molecular Formula | C8H16O6 |
| Scaffold Graph Node Bond Level | C1CCOCC1 |
| Inchi Key | WYUFTYLVLQZQNH-HNEXDWKRSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 3.0 |
| Synonyms | ethyl alpha-d-galactopyranoside, ethyl α-d-galactopyranoside, ethyl-a-d-galactopyranoside, ethyl-alpha-d-galacto-pyranoside, ethyl-alpha-d-galactopyranoside, ethyl-alpha-d-galactoside |
| Esol Class | Highly soluble |
| Functional Groups | CO, CO[C@H](C)OC |
| Compound Name | Eleutheroside C |
| Exact Mass | 208.095 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 208.095 |
| Hydrogen Bond Acceptor Count | 6.0 |
| Molecular Weight | 208.21 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 5.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C8H16O6/c1-2-13-8-7(12)6(11)5(10)4(3-9)14-8/h4-12H,2-3H2,1H3/t4-,5+,6+,7-,8+/m1/s1 |
| Smiles | CCO[C@@H]1[C@@H]([C@H]([C@H]([C@H](O1)CO)O)O)O |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
- 1. Outgoing r'ship
FOUND_INto/from Chamaecrista Absus (Plant) Rel Props:Reference:ISBN:9788172363178 - 2. Outgoing r'ship
FOUND_INto/from Clitoria Ternatea (Plant) Rel Props:Reference:ISBN:9788185042053 - 3. Outgoing r'ship
FOUND_INto/from Trigonella Balansae (Plant) Rel Props:Reference:ISBN:9780387706375