Pinellic acid
PubChem CID: 9858729
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Pinellic acid, 97134-11-7, 9,12,13-TriHOME, 9S,12S,13S-trihydroxy-10E-octadecenoic acid, Dihydrofulgidic acid, (E,9S,12S,13S)-9,12,13-trihydroxyoctadec-10-enoic acid, 9(S),12(S),13(S)-Trihydroxy-10(E)-octadecenoic acid, CHEBI:34506, 9(S),12(S),13(S)-TriHOME, 9S,12S,13S-trihydroxy-10E-octadecenoate, (10E)-(9S,12S,13S)-9,12,13-Trihydroxyoctadec-10-enoic acid, 9(S),12(S),13(S)-Trihydroxy-10(E)-octadecenoate, (10E)-(9S,12S,13S)-9,12,13-Trihydroxyoctadec-10-enoate, (9S,10E,12S,13S)-9,12,13-trihydroxyoctadec-10-enoic acid, 9,12,13-Trihydroxyoctadec-10-enoic acid, SCHEMBL3989371, CHEMBL4436085, MDIUMSLCYIJBQC-MVFSOIOZSA-N, DTXSID001317644, LMFA02000014, AKOS040755725, DA-60617, PD131487, Q27116118, (9s,12s,13s)-e-9,12,13-trihydroxy-10-octadecaenoic acid |
|---|---|
| Topological Polar Surface Area | 98.0 |
| Hydrogen Bond Donor Count | 4.0 |
| Heavy Atom Count | 23.0 |
| Description | 9,12,13-TriHOME is a trihydroxyoctadecenoic acid metabolite of linoleic acid, one of the major fatty acids found in lipids. Vascular tissue converts various polyunsaturated fatty acids to monohydroxy and trihydroxy metabolites derived from hydroperoxides which may be involved in regulating prostaglandin synthesis. The absolute amounts of 9,12,13-TriHOME varies considerably from one species to another. There are several possible mechanisms for the formation of esterified oxygenated polyunsaturated fatty acids: oxygenated and then incorporated into lipids, not well incorporated into either vascular endothelial or smooth muscle cells, or could accumulated in lipids either due to autoxidation in vivo or to the action of an enzyme similar to Iipoxygenase. (PMID: 3997883, 6414520) [HMDB] |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 317.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 3.0 |
| Iupac Name | (E,9S,12S,13S)-9,12,13-trihydroxyoctadec-10-enoic acid |
| Nih Violation | True |
| Prediction Hob | 0.0 |
| Class | Fatty Acyls |
| Xlogp | 3.1 |
| Superclass | Lipids and lipid-like molecules |
| Is Pains | False |
| Subclass | Fatty acids and conjugates |
| Molecular Formula | C18H34O5 |
| Prediction Swissadme | 0.0 |
| Inchi Key | MDIUMSLCYIJBQC-MVFSOIOZSA-N |
| Fcsp3 | 0.8333333333333334 |
| Logs | -3.589 |
| Rotatable Bond Count | 15.0 |
| State | Solid |
| Logd | 2.118 |
| Synonyms | (10E)-(9S,12S,13S)-9,12,13-Trihydroxyoctadec-10-enoate, (10E)-(9S,12S,13S)-9,12,13-Trihydroxyoctadec-10-enoic acid, 9(S),12(S),13(S)-Trihydroxy-10(E)-octadecenoate, 9(S),12(S),13(S)-Trihydroxy-10(E)-octadecenoic acid, 9S,12S,13S-trihydroxy-10E-octadecenoate, 9S,12S,13S-trihydroxy-10E-octadecenoic acid, 9(S),12(S),13(S)-Trihydroxy-10(e)-octadecenoic acid, 9S,12S,13S-Trihydroxy-10E-octadecenoic acid, 9(S),12(S),13(S)-Trihydroxy-10(e)-octadecenoate, 9S,12S,13S-Trihydroxy-10E-octadecenoate, Pinellic acid |
| Substituent Name | Long-chain fatty acid, Hydroxy fatty acid, Unsaturated fatty acid, Secondary alcohol, Polyol, 1,2-diol, Monocarboxylic acid or derivatives, Carboxylic acid, Carboxylic acid derivative, Hydrocarbon derivative, Organooxygen compound, Carbonyl group, Alcohol, Aliphatic acyclic compound |
| Compound Name | Pinellic acid |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 330.241 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 330.241 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 330.5 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 3.0 |
| Total Bond Stereocenter Count | 1.0 |
| Molecular Framework | Aliphatic acyclic compounds |
| Esol | -2.8833829999999994 |
| Inchi | InChI=1S/C18H34O5/c1-2-3-7-11-16(20)17(21)14-13-15(19)10-8-5-4-6-9-12-18(22)23/h13-17,19-21H,2-12H2,1H3,(H,22,23)/b14-13+/t15-,16-,17-/m0/s1 |
| Smiles | CCCCC[C@@H]([C@H](/C=C/[C@H](CCCCCCCC(=O)O)O)O)O |
| Nring | 0.0 |
| Defined Bond Stereocenter Count | 1.0 |
| Taxonomy Direct Parent | Long-chain fatty acids |
- 1. Outgoing r'ship
FOUND_INto/from Chaenomeles Sinensis (Plant) Rel Props:Source_db:cmaup_ingredients - 2. Outgoing r'ship
FOUND_INto/from Chaenomeles Speciosa (Plant) Rel Props:Source_db:cmaup_ingredients - 3. Outgoing r'ship
FOUND_INto/from Panax Quinquefolius (Plant) Rel Props:Source_db:cmaup_ingredients - 4. Outgoing r'ship
FOUND_INto/from Perilla Frutescens (Plant) Rel Props:Source_db:cmaup_ingredients - 5. Outgoing r'ship
FOUND_INto/from Pinellia Ternata (Plant) Rel Props:Source_db:cmaup_ingredients