7-Hydroxy-3,3',4',5,6,8-hexamethoxyflavone
PubChem CID: 9844898
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 7-Hydroxy-3,3',4',5,6,8-hexamethoxyflavone, 7-Hydroxy-3,5,6,8,3',4'-hexamethoxyflavone, 2-(3,4-Dimethoxyphenyl)-7-hydroxy-3,5,6,8-tetramethoxy-4H-1-benzopyran-4-one, 2-(3,4-dimethoxyphenyl)-7-hydroxy-3,5,6,8-tetramethoxychromen-4-one, SCHEMBL1764666, CHEBI:191566, DTXSID401141986, LMPK12113354, 185678-89-1 |
|---|---|
| Topological Polar Surface Area | 102.0 |
| Hydrogen Bond Donor Count | 1.0 |
| Inchi Key | LIHVLVGTXLTMAQ-UHFFFAOYSA-N |
| Rotatable Bond Count | 7.0 |
| Synonyms | 2-(3,4-Dimethoxyphenyl)-7-hydroxy-3,5,6,8-tetramethoxy-4H-1-benzopyran-4-one, 7-Hydroxy-3,3',4',5,6,8-hexamethoxyflavone, 7-Hydroxy-3,5,6,8,3',4'-hexamethoxyflavone |
| Heavy Atom Count | 30.0 |
| Compound Name | 7-Hydroxy-3,3',4',5,6,8-hexamethoxyflavone |
| Description | Constituent of the peel of tangerine (Citrus species). 7-Hydroxy-3,3',4',5,6,8-hexamethoxyflavone is found in sweet orange and citrus. |
| Exact Mass | 418.126 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 418.126 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 636.0 |
| Hydrogen Bond Acceptor Count | 9.0 |
| Molecular Weight | 418.4 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-(3,4-dimethoxyphenyl)-7-hydroxy-3,5,6,8-tetramethoxychromen-4-one |
| Total Atom Stereocenter Count | 0.0 |
| Nih Violation | False |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C21H22O9/c1-24-11-8-7-10(9-12(11)25-2)16-19(27-4)14(22)13-17(26-3)20(28-5)15(23)21(29-6)18(13)30-16/h7-9,23H,1-6H3 |
| Smiles | COC1=C(C=C(C=C1)C2=C(C(=O)C3=C(O2)C(=C(C(=C3OC)OC)O)OC)OC)OC |
| Xlogp | 2.9 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C21H22O9 |
- 1. Outgoing r'ship
FOUND_INto/from Citrus Sinensis (Plant) Rel Props:Source_db:fooddb_chem_all