Eupalitin 3-galactoside
PubChem CID: 9805669
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Betuletrin, Eupalitin 3-galactoside, CHEMBL518337, SCHEMBL5706563, AKOS040735015, Eupalitin 3-Obeta-D-galactopyranoside, analytical standard |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 185.0 |
| Hydrogen Bond Donor Count | 6.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | CC1C2CCCCC2CC(C2CCCCC2)C1CC1CCCCC1 |
| Np Classifier Class | Flavonols |
| Deep Smiles | OC[C@H]O[C@@H]Occoccc6=O))cO)ccc6)OC)))OC)))))))cccccc6))O))))))))[C@@H][C@H][C@H]6O))O))O |
| Heavy Atom Count | 35.0 |
| Classyfire Class | Flavonoids |
| Scaffold Graph Node Level | OC1C2CCCCC2OC(C2CCCCC2)C1OC1CCCCO1 |
| Classyfire Subclass | Flavonoid glycosides |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 780.0 |
| Database Name | imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 5.0 |
| Iupac Name | 5-hydroxy-2-(4-hydroxyphenyl)-6,7-dimethoxy-3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
| Nih Violation | False |
| Veber Rule | False |
| Classyfire Superclass | Phenylpropanoids and polyketides |
| Xlogp | 1.0 |
| Is Pains | False |
| Gsk 4 400 Rule | False |
| Molecular Formula | C23H24O12 |
| Scaffold Graph Node Bond Level | O=c1c(OC2CCCCO2)c(-c2ccccc2)oc2ccccc12 |
| Inchi Key | FFRYQAOUWMJQCX-LTGKLFRMSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 6.0 |
| Synonyms | betuletrin, eupalitin-3-o-beta-d-galactopyranoside |
| Esol Class | Soluble |
| Functional Groups | CO, c=O, cO, cOC, cO[C@@H](C)OC, coc |
| Compound Name | Eupalitin 3-galactoside |
| Exact Mass | 492.127 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 492.127 |
| Hydrogen Bond Acceptor Count | 12.0 |
| Molecular Weight | 492.4 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 5.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | False |
| Inchi | InChI=1S/C23H24O12/c1-31-12-7-11-14(16(27)21(12)32-2)17(28)22(20(33-11)9-3-5-10(25)6-4-9)35-23-19(30)18(29)15(26)13(8-24)34-23/h3-7,13,15,18-19,23-27,29-30H,8H2,1-2H3/t13-,15+,18+,19-,23+/m1/s1 |
| Smiles | COC1=C(C(=C2C(=C1)OC(=C(C2=O)O[C@H]3[C@@H]([C@H]([C@H]([C@H](O3)CO)O)O)O)C4=CC=C(C=C4)O)O)OC |
| Np Classifier Biosynthetic Pathway | Shikimates and Phenylpropanoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Np Classifier Superclass | Flavonoids |
- 1. Outgoing r'ship
FOUND_INto/from Acroptilon Repens (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Ageratina Adenophora (Plant) Rel Props:Reference:ISBN:9788185042145 - 3. Outgoing r'ship
FOUND_INto/from Berberis Repens (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Boerhaavia Verticillata (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Boerhavia Diffusa (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Boerhavia Repens (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Cissus Repens (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Corydalis Repens (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Dentella Repens (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Duranta Repens (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Elettaria Repens (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Elymus Repens (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Geophila Repens (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Goodyera Repens (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Ixeris Repens (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Limnophila Repens (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Oxalis Repens (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Panicum Repens (Plant) Rel Props:Reference: - 19. Outgoing r'ship
FOUND_INto/from Rhaponticum Repens (Plant) Rel Props:Reference: - 20. Outgoing r'ship
FOUND_INto/from Rungia Repens (Plant) Rel Props:Reference: - 21. Outgoing r'ship
FOUND_INto/from Serenoa Repens (Plant) Rel Props:Reference: - 22. Outgoing r'ship
FOUND_INto/from Trifolium Repens (Plant) Rel Props:Reference: - 23. Outgoing r'ship
FOUND_INto/from Vitis Repens (Plant) Rel Props:Reference: