Epigallocatechin 3-O-(3-O-methyl)gallate
PubChem CID: 9804842
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 83104-87-4, (-)-EGCG-3''-O-Me, Epigallocatechin 3-O-(3-O-methyl)gallate, (-)-Epigallocatechin-3-(3''-O-methyl) gallate, Egcg3''me, O97U9TPY8V, Epigallocatechin 3-O-(3-O-methylgallate), CHEMBL562716, (-)-Epigallocatechin 3-O-(3-O-methylgallate), (-)-Epigallocatechin-3-O-(3'-O-methyl)-gallate, [(2R,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4-dihydroxy-5-methoxybenzoate, (-)-Epigallocatechin 3-(3-methyl-gallate), Benzoic acid, 3,4-dihydroxy-5-methoxy-, (2R,3R)-3,4-dihydro-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-2H-1-benzopyran-3-yl ester, Benzoic acid, 3,4-dihydroxy-5-methoxy-, 3,4-dihydro-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-2H-1-benzopyran-3-yl ester, (2R-cis)-, UNII-O97U9TPY8V, Epigallocatechin 3-O-(3-O-Methyl)-Gallate, SCHEMBL14143057, CHEBI:169839, DTXSID501273994, HY-N2228, BDBM50296234, LMPK12020121, MSK157339, AKOS040760379, Epigallocatechin 3-(3-methyl-gallate), FE74491, FS-7488, 3-O-(3-O-Methylgalloyl)epigallocatechin, DA-68944, Epigallocatechin 3-(3-O-methyl-gallate), CS-0019551, (-)-epigallocatechin-3-(3''''-O-methyl)gallate, Q27285508, (-)-Epigallocatechin-3-(3''-O-methyl) gallateEgcg3''me, (-)-Epigallocatechin-3-(3''-O-methyl) gallate, (2R,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-1-benzopyran-3-yl 3,4-dihydroxy-5-methoxybenzoate, (2R,3R)-5,7-Dihydroxy-2-(3,4,5-trihydroxyphenyl)chroman-3-yl 3,4-dihydroxy-5-methoxybenzoate |
|---|---|
| Topological Polar Surface Area | 186.0 |
| Hydrogen Bond Donor Count | 7.0 |
| Heavy Atom Count | 34.0 |
| Description | Isolated from green tea (Thea sinensis) and oolong tea (Camellia sinensis). Epigallocatechin 3-(3-methylgallate) is found in tea. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 694.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 2.0 |
| Uniprot Id | P50281, P09237, P08253 |
| Iupac Name | [(2R,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4-dihydroxy-5-methoxybenzoate |
| Nih Violation | True |
| Prediction Hob | 0.0 |
| Class | Flavonoids |
| Target Id | NPT4015, NPT4016, NPT568 |
| Xlogp | 2.6 |
| Superclass | Phenylpropanoids and polyketides |
| Is Pains | True |
| Subclass | Flavans |
| Molecular Formula | C23H20O11 |
| Prediction Swissadme | 0.0 |
| Inchi Key | WVRDOLPMKOCJRJ-DENIHFKCSA-N |
| Fcsp3 | 0.1739130434782608 |
| Logs | -3.951 |
| Rotatable Bond Count | 5.0 |
| Logd | 1.053 |
| Synonyms | (-)-Epigallocatechin 3-(3-methyl-gallate), 3-O-(3-O-Methylgalloyl)epigallocatechin, Epigallocatechin 3-(3-methyl-gallate), Epigallocatechin 3-(3-methylgallate), Epigallocatechin 3-(3-O-methyl-gallate), Epigallocatechin 3-O-(3-O-methylgallate), (-)-Epigallocatechin 3-(3-methyl-gallic acid), Epigallocatechin-3-O-(3''-O-methyl)-gallate, Epigallocatechin 3-O-(3-O-methylgallic acid), EGCG3''me, Epigallocatechin 3-(3-methylgallic acid) |
| Compound Name | Epigallocatechin 3-O-(3-O-methyl)gallate |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 472.101 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 472.101 |
| Hydrogen Bond Acceptor Count | 11.0 |
| Molecular Weight | 472.4 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 2.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Esol | -4.443457105882354 |
| Inchi | InChI=1S/C23H20O11/c1-32-18-5-10(4-16(28)21(18)30)23(31)34-19-8-12-13(25)6-11(24)7-17(12)33-22(19)9-2-14(26)20(29)15(27)3-9/h2-7,19,22,24-30H,8H2,1H3/t19-,22-/m1/s1 |
| Smiles | COC1=CC(=CC(=C1O)O)C(=O)O[C@@H]2CC3=C(C=C(C=C3O[C@@H]2C4=CC(=C(C(=C4)O)O)O)O)O |
| Nring | 4.0 |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | Catechin gallates |
- 1. Outgoing r'ship
FOUND_INto/from Adina Sessilifolia (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 2. Outgoing r'ship
FOUND_INto/from Angelica Lucida (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 3. Outgoing r'ship
FOUND_INto/from Artemisia Klotzchiana (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 4. Outgoing r'ship
FOUND_INto/from Camellia Sinensis (Plant) Rel Props:Source_db:cmaup_ingredients;fooddb_chem_all;npass_chem_all - 5. Outgoing r'ship
FOUND_INto/from Castanea Vesca (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 6. Outgoing r'ship
FOUND_INto/from Cotula Cinerea (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 7. Outgoing r'ship
FOUND_INto/from Daphniphyllum Paxianum (Plant) Rel Props:Source_db:npass_chem_all - 8. Outgoing r'ship
FOUND_INto/from Hymenoxys Insignis (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 9. Outgoing r'ship
FOUND_INto/from Lespedeza Bicolor (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 10. Outgoing r'ship
FOUND_INto/from Limonium Sinense (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 11. Outgoing r'ship
FOUND_INto/from Mimusops Caffra (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 12. Outgoing r'ship
FOUND_INto/from Nerine Bowdenii (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 13. Outgoing r'ship
FOUND_INto/from Sesbania Bispinosa (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 14. Outgoing r'ship
FOUND_INto/from Solidago Serotina (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 15. Outgoing r'ship
FOUND_INto/from Sorbaria Sorbifolia (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 16. Outgoing r'ship
FOUND_INto/from Strophanthus Kombe (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 17. Outgoing r'ship
FOUND_INto/from Veronica Arvensis (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all