Methyl hydrazine-1-carbohydrazono thioate hydroiodide
PubChem CID: 9582190
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 37839-01-3, Methyl hydrazine-1-carbohydrazonothioate hydroiodide, Methyl hydrazine-1-carbohydrazono thioate hydroiodide, Aliphatics, MFCD00219464, SCHEMBL23405279, CS-0212780, F87644 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 102.0 |
| Hydrogen Bond Donor Count | 4.0 |
| Pfizer 3 75 Rule | True |
| Deep Smiles | CS/C=NN))/NN.I |
| Heavy Atom Count | 8.0 |
| Classyfire Class | Organonitrogen compounds |
| Classyfire Subclass | Hydrazines and derivatives |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 70.1 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | methyl N,N'-diaminocarbamimidothioate, hydroiodide |
| Nih Violation | False |
| Veber Rule | True |
| Classyfire Superclass | Organic nitrogen compounds |
| Is Pains | False |
| Gsk 4 400 Rule | True |
| Molecular Formula | C2H9IN4S |
| Inchi Key | XLRAKUURQVHNPJ-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 2.0 |
| Synonyms | aliphatics |
| Esol Class | Very soluble |
| Functional Groups | CS/C(=NN)NN, I |
| Compound Name | Methyl hydrazine-1-carbohydrazono thioate hydroiodide |
| Exact Mass | 247.959 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 247.959 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 248.09 |
| Gi Absorption | True |
| Covalent Unit Count | 2.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 1.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C2H8N4S.HI/c1-7-2(5-3)6-4, /h3-4H2,1H3,(H,5,6), 1H |
| Smiles | CS/C(=N\N)/NN.I |
| Np Classifier Biosynthetic Pathway | Alkaloids |
| Defined Bond Stereocenter Count | 1.0 |
| Egan Rule | True |
- 1. Outgoing r'ship
FOUND_INto/from Hypericum Japonicum (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2012.728082