Pentahomoserine
PubChem CID: 95562
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 2-Amino-5-hydroxypentanoic acid, 533-88-0, Pentahomoserine, 5-Hydroxynorvaline, 2-Amino-5-hydroxyvaleric acid, HYDROXYVALINE, Norvaline, 5-hydroxy-, L-2-Amino-5-hydroxypentanoic acid, .delta.-Hydroxynorvaline, PKG8I0M67E, NSC20896, Hava-5 cpd, NSC-20896, .alpha.-Amino-.delta.-hydroxyvalerate, L-.alpha.-Amino-.delta.-hydroxyvaleric acid, alpha-Amino-delta-hydroxyvaleric acid, 5-hydroxy-D-norvaline, delta-Hydroxynorvaline, 5-Hydroxy-DL-norvaline, Norvaline, 5-hydroxy-, L-, 5-Hydroxy-2-aminovalerate, 5-OH-2-NH2-Valerate, UNII-PKG8I0M67E, 2-amino-5-hydroxy-pentanoic acid, MFCD00078391, NSC 20896, .ALPHA.-AMINO-.DELTA.-HYDROXYVALERIC ACID, PENTAHOMOSERINE [MI], SCHEMBL59755, 2-Amino-5-hydroxypentanoicacid, CHEBI:165867, DTXSID901315938, PENTAHOMOSERINE, (+/-)-, NSC206265, PENTAHOMOSERINE DL-FORM [MI], AKOS015892690, .alpha.-Amino-.delta.-hydroxyvaleric cid, SY269711, DB-292823, EN300-84934, DL-.DELTA.-HYDROXY-.ALPHA.-AMINOVALERIC ACID, Q27286597 |
|---|---|
| Topological Polar Surface Area | 83.6 |
| Hydrogen Bond Donor Count | 3.0 |
| Heavy Atom Count | 9.0 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 94.2 |
| Database Name | cmaup_ingredients;hmdb_chem_all;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-amino-5-hydroxypentanoic acid |
| Prediction Hob | 1.0 |
| Class | Carboxylic acids and derivatives |
| Xlogp | -4.2 |
| Superclass | Organic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Molecular Formula | C5H11NO3 |
| Prediction Swissadme | 0.0 |
| Inchi Key | CZWARROQQFCFJB-UHFFFAOYSA-N |
| Fcsp3 | 0.8 |
| Rotatable Bond Count | 4.0 |
| State | Solid |
| Synonyms | L-2-Amino-5-hydroxypentanoate, 2-Amino-5-hydroxypentanoate, 2-Amino-5-hydroxyvaleric acid, 2-Amino-5-hydroxyvaleric acid, (L)-isomer, 5-Hydroxy-2-aminovalerate, 5-OH-2-NH2-Valerate, 5-Hydroxy-2-aminovaleric acid, 5-Hydroxynorvaline, alpha-Amino-delta-hydroxyvaleric acid, 2-Amino-5-hydroxyvaleric acid, (DL)-isomer, HAVA-5 CPD |
| Compound Name | Pentahomoserine |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 133.074 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 133.074 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 133.15 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic acyclic compounds |
| Esol | 2.2129886 |
| Inchi | InChI=1S/C5H11NO3/c6-4(5(8)9)2-1-3-7/h4,7H,1-3,6H2,(H,8,9) |
| Smiles | C(CC(C(=O)O)N)CO |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | Alpha amino acids |
- 1. Outgoing r'ship
FOUND_INto/from Canavalia Africana (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Canavalia Cathartica (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Canavalia Ensiformis (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Canavalia Gladiata (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 5. Outgoing r'ship
FOUND_INto/from Canavalia Rosea (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Canavalia Virosa (Plant) Rel Props:Reference: