6,10-Dimethylundecan-2-one
PubChem CID: 95495
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 6,10-Dimethylundecan-2-one, 2-Undecanone, 6,10-dimethyl-, Hexahydropseudoionone, 1604-34-8, 6,10-Dimethyl-2-undecanone, Tetrahydrogeranylacetone, Pseudoionone, hexahydro-, UNII-91TGG00357, EINECS 216-509-8, EINECS 262-082-6, NSC 15338, NSC-15338, 91TGG00357, 6,10-dimethylundecane-2-one, AI3-15989, DTXSID80862709, (1)-6,10-Dimethylundecan-2-one, 2,6-DIMETHYLUNDECANE-10-ONE, NSC15338, Pseudoionone, hexahydro, 6,10Dimethyl2undecanone, 6,10Dimethylundecan2one, 2-Undecanone,10-dimethyl-, SCHEMBL117939, DTXCID80811439, STL562193, AKOS006281602, 60148-93-8, DB-282712, CS-0263271, NS00046467, E85200, EN300-8588865, Q27271425, 216-509-8, 262-082-6 |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 17.1 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Np Classifier Class | Oxygenated hydrocarbons |
| Deep Smiles | CCCCCC=O)C)))))CCCCC)C |
| Heavy Atom Count | 14.0 |
| Classyfire Class | Organooxygen compounds |
| Description | 6,10-dimethylundecan-2-one is a member of the class of compounds known as ketones. Ketones are organic compounds in which a carbonyl group is bonded to two carbon atoms R2C=O (neither R may be a hydrogen atom). Ketones that have one or more alpha-hydrogen atoms undergo keto-enol tautomerization, the tautomer being an enol. 6,10-dimethylundecan-2-one is practically insoluble (in water) and an extremely weak acidic compound (based on its pKa). 6,10-dimethylundecan-2-one can be found in tea, which makes 6,10-dimethylundecan-2-one a potential biomarker for the consumption of this food product. |
| Classyfire Subclass | Carbonyl compounds |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 149.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 6,10-dimethylundecan-2-one |
| Nih Violation | True |
| Prediction Hob | 1.0 |
| Veber Rule | True |
| Classyfire Superclass | Organic oxygen compounds |
| Xlogp | 4.5 |
| Is Pains | False |
| Gsk 4 400 Rule | False |
| Molecular Formula | C13H26O |
| Prediction Swissadme | 0.0 |
| Inchi Key | RBGLEUBCAJNCTR-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.9230769230769232 |
| Logs | -4.629 |
| Rotatable Bond Count | 8.0 |
| Logd | 4.597 |
| Synonyms | (1)-6,10-Dimethylundecan-2-one, 2-Undecanone, 6,10-dimethyl-, 6,10-Dimethyl-2-undecanone, 6,10-Dimethylundecan-2-one, Hexahydropseudoionone, Pseudoionone, hexahydro-, Tetrahydrogeranylacetone, 2-undecanone, 6,10-dimethyl-, 6,10-dimethyl-2-undecanone, 6,10-dimethylundecan-2-one, hexahydropseudoionone |
| Esol Class | Soluble |
| Functional Groups | CC(C)=O |
| Compound Name | 6,10-Dimethylundecan-2-one |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 198.198 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 198.198 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 198.34 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | -3.39567 |
| Inchi | InChI=1S/C13H26O/c1-11(2)7-5-8-12(3)9-6-10-13(4)14/h11-12H,5-10H2,1-4H3 |
| Smiles | CC(C)CCCC(C)CCCC(=O)C |
| Nring | 0.0 |
| Np Classifier Biosynthetic Pathway | Fatty acids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Fatty acyls |
- 1. Outgoing r'ship
FOUND_INto/from Bryophyllum Pinnatum (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2016.1178182 - 2. Outgoing r'ship
FOUND_INto/from Camellia Sinensis (Plant) Rel Props:Source_db:fooddb_chem_all - 3. Outgoing r'ship
FOUND_INto/from Ceratophyllum Demersum (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.1588 - 4. Outgoing r'ship
FOUND_INto/from Cocos Nucifera (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Humulus Lupulus (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.2730040407 - 6. Outgoing r'ship
FOUND_INto/from Nelumbo Lutea (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Nelumbo Nucifera (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 8. Outgoing r'ship
FOUND_INto/from Osteospermum Muricatum (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Prunus Mahaleb (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.1596 - 10. Outgoing r'ship
FOUND_INto/from Rhizophora Apiculata (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2014.909748 - 11. Outgoing r'ship
FOUND_INto/from Rhizophora Mucronata (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2014.909748 - 12. Outgoing r'ship
FOUND_INto/from Terminalia Alata (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Terminalia Arjuna (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Terminalia Bellirica (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Terminalia Bialata (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Terminalia Brachystemma (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Terminalia Calamansanay (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Terminalia Catappa (Plant) Rel Props:Reference: - 19. Outgoing r'ship
FOUND_INto/from Terminalia Chebula (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 20. Outgoing r'ship
FOUND_INto/from Terminalia Citrina (Plant) Rel Props:Reference: - 21. Outgoing r'ship
FOUND_INto/from Terminalia Coriacea (Plant) Rel Props:Reference: - 22. Outgoing r'ship
FOUND_INto/from Terminalia Crenulata (Plant) Rel Props:Reference: - 23. Outgoing r'ship
FOUND_INto/from Terminalia Elliptica (Plant) Rel Props:Reference: - 24. Outgoing r'ship
FOUND_INto/from Terminalia Macroptera (Plant) Rel Props:Reference: - 25. Outgoing r'ship
FOUND_INto/from Terminalia Myriocarpa (Plant) Rel Props:Reference: - 26. Outgoing r'ship
FOUND_INto/from Terminalia Pallida (Plant) Rel Props:Reference: - 27. Outgoing r'ship
FOUND_INto/from Terminalia Paniculata (Plant) Rel Props:Reference: - 28. Outgoing r'ship
FOUND_INto/from Terminalia Procera (Plant) Rel Props:Reference: - 29. Outgoing r'ship
FOUND_INto/from Terminalia Tomentosa (Plant) Rel Props:Reference: - 30. Outgoing r'ship
FOUND_INto/from Terminalia Travancorensis (Plant) Rel Props:Reference: - 31. Outgoing r'ship
FOUND_INto/from Torreya Nucifera (Plant) Rel Props:Reference: - 32. Outgoing r'ship
FOUND_INto/from Vallisneria Spiralis (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.1588