N,N-Dimethylaniline
PubChem CID: 949
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | N,N-dimethylaniline, 121-69-7, Dimethylaniline, Dimethylphenylamine, N,N-Dimethylbenzenamine, Benzenamine, N,N-dimethyl-, (Dimethylamino)benzene, N,N-Dimethylphenylamine, N,N-Dimethylbenzeneamine, Dwumetyloanilina, Aniline, N,N-dimethyl-, N,N-(Dimethylamino)benzene, Dimethylaminobenzene, Versneller NL 63/10, Dimethyl-phenyl-amine, Dimethylaniline, N,N-, NCI-C56428, NSC 7195, NL 63-10P, CCRIS 2381, N,N-dimethylaminobenzene, HSDB 1179, N,N-Dimethyl-N-phenylamine, EINECS 204-493-5, DTXSID2020507, CHEBI:16269, AI3-17284, NSC-7195, N,N-DIMETHYL-ANILINE, UNII-7426719369, DTXCID60507, EC 204-493-5, 86362-18-7, N,N-DIMETHYLANILINE (IARC), N,N-DIMETHYLANILINE [IARC], dimethyl aniline, Dwumetyloanilina [Polish], CAS-121-69-7, N,N-DIMETHYLANILINE (EP IMPURITY), N,N-DIMETHYLANILINE [EP IMPURITY], N-N-Dimethylaniline, N, N-Dimethylaniline, 88889-00-3, UN2253, N,N-Dimethylaniline sulfate, dimethyl-aniline, n-dimethylaniline, N,N-dimethyaniline, N,N-dimethylamline, N,N dimethylaniline, N,N-dimethylaniiine, PhNMe2, MFCD00008304, n,n,-dimethylaniline, N,N-dirnethylaniline, N,N-dimethyl aniline, N,N-dimethyl-Benzenamine, PhN(CH3)2, SCHEMBL8277, (DIMETYLAMINO)BENZENE, N,N-Dimethylaniline, 99%, MLS002222341, BIDD:ER0332, N,N-Dimethyl-N-phenylamine #, CHEMBL371654, N,N-DIMETHYLANILINE [MI], N,N-Dimethylaniline [UN2253], N,N-dimethylaniline,sulfuric acid, NSC7195, WLN: 1N1 & R, N,N-DIMETHYLANILINE [HSDB], N,N-Dimethylaniline, LR, >=99%, Tox21_201813, Tox21_300036, STL268843, AKOS000119088, FD00090, UN 2253, NCGC00090724-01, NCGC00090724-02, NCGC00090724-03, NCGC00254056-01, NCGC00259362-01, LS-13434, SMR001252235, N,N-Dimethylaniline [UN2253] [Poison], N,N-Dimethylaniline, ReagentPlus(R), 99%, D0665, D3866, N,N-Dimethylaniline, for synthesis, 99.5%, NS00010833, EN300-18960, C02846, D95371, N,N-Dimethylaniline, SAJ first grade, >=99.0%, Q310473, F0001-0348, N,N-Dimethylaniline, purified by redistillation, >=99.5%, Benzenamine,N,N-dimethyl-,oxidized,molybdatetungstatephosphates, InChI=1/C8H11N/c1-9(2)8-6-4-3-5-7-8/h3-7H,1-2H, 101357-19-1, 204-493-5 |
|---|---|
| Topological Polar Surface Area | 3.2 |
| Hydrogen Bond Donor Count | 0.0 |
| Heavy Atom Count | 9.0 |
| Description | the structural formula shown is also known as N,N-dimethylaniline -- Wikipedia, Dimethylaniline (C8H11N) is an organic chemical compound which is a substituted derivative of aniline. It consists of a benzene ring and a substituted amino group, making it a tertiary aromatic amine. -- Wikipedia, N,N-Dimethylaniline (DMA) is an organic chemical compound, a substituted derivative of aniline. It consists of a tertiary amine, featuring dimethylamino group attached to a phenyl group. This oily liquid is colourless when pure, but commercial samples are often yellow. N,N-Dimethylaniline is found in many foods, some of which are fennel, rose hip, black elderberry, and maitake. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 72.6 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | P49326, Q99518, P31512, P31513, Q01740, O60774 |
| Iupac Name | N,N-dimethylaniline |
| Nih Violation | False |
| Class | Amines |
| Xlogp | 2.3 |
| Superclass | Organonitrogen compounds |
| Is Pains | False |
| Subclass | Tertiary amines |
| Molecular Formula | C8H11N |
| Inchi Key | JLTDJTHDQAWBAV-UHFFFAOYSA-N |
| Rotatable Bond Count | 1.0 |
| State | Liquid |
| Synonyms | (dimethylamino)benzene, Aniline, n,n-dimethyl-, Benzenamine, n,n-dimethyl-, Dimethylaminobenzene, Dimethylaniline, Dimethylaniline, n-n-, Dimethylaniline, n,n-, Dimethylphenylamine, Dimethylphylamine, Dwumetyloanilina, N-n-dimethylaniline, N, n-dimethylaniline, N, n-dimethylphenylamine, N,n-(dimethylamino)benzene, N,n-dimethyl-aniline, N,n-dimethyl-benzenamine, N,n-dimethyl-n-phenylamine, N,n-dimethylanilin, N,n-dimethylaniline, N,N-Dimethylaniline [UN2253], N,N-Dimethylaniline [UN2253] [Poison], N,n-dimethylbenzenamine, N,n-dimethylbenzeneamine, N,n-dimethylphenylamine, NN-dimethylaniline, Versneller NL 63/10, N,N-Dimethyl-N-phenylamine, N,N-Dimethylbenzenamine, N,N-Dimethylbenzeneamine, N,N-Dimethylphenylamine, N,N-(Dimethylamino)benzene, N,N-Dimethyl-benzenamine, N,N-Dimethylaniline sulfate (1:1), N,N-Dimethylaniline hydrochloride, N,N-Dimethylaniline hydroiodide |
| Substituent Name | Dialkylarylamine, Aniline, Benzenoid, Monocyclic benzene moiety, Hydrocarbon derivative, Aromatic homomonocyclic compound |
| Compound Name | N,N-Dimethylaniline |
| Kingdom | Organic compounds |
| Exact Mass | 121.089 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 121.089 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 121.18 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Inchi | InChI=1S/C8H11N/c1-9(2)8-6-4-3-5-7-8/h3-7H,1-2H3 |
| Smiles | CN(C)C1=CC=CC=C1 |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | Dialkylarylamines |
- 1. Outgoing r'ship
FOUND_INto/from Citrus Sinensis (Plant) Rel Props:Source_db:fooddb_chem_all