Gamma-Glutamyltyrosine
PubChem CID: 94340
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | gamma-Glutamyltyrosine, 7432-23-7, H-Glu(Tyr-OH)-OH, H-gamma-Glu-Tyr-OH, gamma-GLU-TYR, N-L-gamma-Glutamyl-L-tyrosine, Glutyrosine, (2S)-2-amino-5-[[(1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]-5-oxopentanoic acid, EINECS 231-076-5, Gamma-glutamyl-L-tyrosine, CHEBI:82969, (2S)-2-AMINO-4-{[(1S)-1-CARBOXY-2-(4-HYDROXYPHENYL)ETHYL]CARBAMOYL}BUTANOIC ACID, H-?-Glu-Tyr-OH, H-, A-Glu-Tyr-OH, g-Glutamyltyrosine, (2S)-2-amino-4-(((1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl)carbamoyl)butanoic acid, (2S)-2-amino-5-(((1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl)amino)-5-oxopentanoic acid, g-Glu-tyr, gamma-L-Glu-L-tyr, MFCD00037212, H--Glu-Tyr-OH, N-gamma-Glutamyltyrosine, N-L-gamma-Glutamyltyrosine, L-gamma-glutamyl-L-tyrosine, gamma-L-Glutamyl-L-tyrosine, SCHEMBL159887, N-gamma-L-Glutamyl-L-tyrosine, DTXSID00995841, (S)-2-Amino-5-(((S)-1-carboxy-2-(4-hydroxyphenyl)ethyl)amino)-5-oxopentanoic acid, HY-P4633, DA-64143, FG108042, CS-0655431, NS00046054, N-(4-Amino-4-carboxy-1-hydroxybutylidene)tyrosine, Q27156509, 231-076-5 |
|---|---|
| Topological Polar Surface Area | 150.0 |
| Hydrogen Bond Donor Count | 5.0 |
| Heavy Atom Count | 22.0 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 406.0 |
| Database Name | cmaup_ingredients;hmdb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 2.0 |
| Iupac Name | (2S)-2-amino-5-[[(1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]-5-oxopentanoic acid |
| Nih Violation | False |
| Prediction Hob | 0.0 |
| Class | Carboxylic acids and derivatives |
| Xlogp | -3.8 |
| Superclass | Organic acids and derivatives |
| Is Pains | False |
| Subclass | Amino acids, peptides, and analogues |
| Molecular Formula | C14H18N2O6 |
| Prediction Swissadme | 0.0 |
| Inchi Key | VVLXCWVSSLFQDS-QWRGUYRKSA-N |
| Fcsp3 | 0.3571428571428571 |
| Logs | -2.085 |
| Rotatable Bond Count | 8.0 |
| State | Solid |
| Logd | -0.522 |
| Synonyms | g-Glutamyltyrosine, Γ-glutamyltyrosine, Γ-glu-tyr, Γ-L-glu-L-tyr, Γ-L-glutamyl-L-tyrosine, L-Γ-glutamyl-L-tyrosine, N-Γ-glutamyltyrosine, N-L-Γ-glutamyltyrosine, N-L-Γ-glutamyl-L-tyrosine, gamma-Glu-tyr, gamma-L-Glu-L-tyr, gamma-L-Glutamyl-L-tyrosine, L-gamma-Glutamyl-L-tyrosine, N-gamma-Glutamyltyrosine, N-L-gamma-Glutamyltyrosine, N-L-gamma-Glutamyl-L-tyrosine, gamma-Glutamyl-L-tyrosine, N-Γ-L-glutamyl-L-tyrosine, N-gamma-L-Glutamyl-L-tyrosine, g-Glu-tyr, gamma-Glutamyltyrosine |
| Compound Name | Gamma-Glutamyltyrosine |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 310.116 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 310.116 |
| Hydrogen Bond Acceptor Count | 7.0 |
| Molecular Weight | 310.3 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 2.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Esol | -0.17771538181818172 |
| Inchi | InChI=1S/C14H18N2O6/c15-10(13(19)20)5-6-12(18)16-11(14(21)22)7-8-1-3-9(17)4-2-8/h1-4,10-11,17H,5-7,15H2,(H,16,18)(H,19,20)(H,21,22)/t10-,11-/m0/s1 |
| Smiles | C1=CC(=CC=C1C[C@@H](C(=O)O)NC(=O)CC[C@@H](C(=O)O)N)O |
| Nring | 1.0 |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | Tyrosine and derivatives |
- 1. Outgoing r'ship
FOUND_INto/from Lotus Corniculatus (Plant) Rel Props:Source_db:cmaup_ingredients