Nuclease, ribo-
PubChem CID: 9369
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 9001-99-4, 9001-73-4, Nuclease, ribo-, Ribonuclease A, L-HISTIDINE, N-beta-ALANYL-, 2-(3-aminopropanoylamino)-3-(1H-imidazol-5-yl)propanoic acid, DL-(3-aminopropanoyl)histidine, 108333-82-0, 2-(3-aminopropanamido)-3-(1H-imidazol-5-yl)propanoic acid, B-Ala-his-oh, L-Histidine, .beta.-alanyl-, L-Histidine, N-.beta.-alanyl-, DTXSID50861860, Velardon, Vermizym, SCHEMBL33768, Carnosine, Karnozin, Karnozzn, CHEMBL18545, CQOVPNPJLQNMDC-UHFFFAOYSA-N, ss-Alanyl-L-Histidine [Carnosine], BCP13131, OAH-3085, NSC524045, AKOS015905612, AKOS030238597, FP72023, DA-56585, DA-57439, NCI60_004277, SY040645, NS00014799, EN300-717716, BRD-A96051074-001-02-2, 2-(3-amino-propanoylamino)-3-(1H-imidazol-4-yl)-propionic acid, L-Carnosin, L-Carnosine, Beta-Alanyl-L-histidine, Beta-Ala-His-OH |
|---|---|
| Topological Polar Surface Area | 121.0 |
| Hydrogen Bond Donor Count | 4.0 |
| Inchi Key | CQOVPNPJLQNMDC-UHFFFAOYSA-N |
| Rotatable Bond Count | 6.0 |
| Heavy Atom Count | 16.0 |
| Compound Name | Nuclease, ribo- |
| Description | Phosphoglucomutase, also known as rnase, pancreatic or pancreatic rnase, is a member of the class of compounds known as hybrid peptides. Hybrid peptides are compounds containing at least two different types of amino acids (alpha, beta, gamma, delta) linked to each other through a peptide bond. Phosphoglucomutase is soluble (in water) and a weakly acidic compound (based on its pKa). Phosphoglucomutase can be found in soy bean, which makes phosphoglucomutase a potential biomarker for the consumption of this food product. Phosphoglucomutase (EC 5.4.2.2) is an enzyme that transfers a phosphate group on an α-D-glucose monomer from the 1' to the 6' position in the forward direction or the 6' to the 1' position in the reverse direction . |
| Exact Mass | 226.107 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 226.107 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 259.0 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 226.23 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-(3-aminopropanoylamino)-3-(1H-imidazol-5-yl)propanoic acid |
| Total Atom Stereocenter Count | 1.0 |
| Nih Violation | False |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C9H14N4O3/c10-2-1-8(14)13-7(9(15)16)3-6-4-11-5-12-6/h4-5,7H,1-3,10H2,(H,11,12)(H,13,14)(H,15,16) |
| Smiles | C1=C(NC=N1)CC(C(=O)O)NC(=O)CCN |
| Xlogp | -4.0 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C9H14N4O3 |
- 1. Outgoing r'ship
FOUND_INto/from Allium Sativum (Plant) Rel Props:Source_db:fooddb_chem_all - 2. Outgoing r'ship
FOUND_INto/from Daucus Carota (Plant) Rel Props:Source_db:fooddb_chem_all - 3. Outgoing r'ship
FOUND_INto/from Glycine Max (Plant) Rel Props:Source_db:fooddb_chem_all - 4. Outgoing r'ship
FOUND_INto/from Triticum Aestivum (Plant) Rel Props:Source_db:fooddb_chem_all - 5. Outgoing r'ship
FOUND_INto/from Zea Mays (Plant) Rel Props:Source_db:fooddb_chem_all