Isovaltrate
PubChem CID: 92275
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Isovaltrate, 31078-10-1, Isovaltrate/valtrate, CHEBI:80745, (1S-(1alpha,6alpha,7beta,7aalpha))-6-Acetoxy-6,7a-dihydro-4-((isovaleryloxy)methyl)spiro(cyclopenta(c)pyran-7(1H),2'-oxiran)-1-yl isovalerate, [(1S,6S,7R,7aS)-6-acetyloxy-1-(3-methylbutanoyloxy)spiro[6,7a-dihydro-1H-cyclopenta[c]pyran-7,2'-oxirane]-4-yl]methyl 3-methylbutanoate, ((1S,2'R,6S,7aS)-6-Acetoxy-1-((3-methylbutanoyl)oxy)-6,7a-dihydro-1H-spiro[cyclopenta[c]pyran-7,2'-oxiran]-4-yl)methyl 3-methylbutanoate, [1S-(1alpha,6alpha,7beta,7aalpha)]-6-acetoxy-6,7a-dihydro-4-[(isovaleryloxy)methyl]spiro[cyclopenta[c]pyran-7(1H),2'-oxiran]-1-yl isovalerate, EINECS 250-454-0, CHEMBL249657, DTXSID80185026, FI137857, NS00029018, Q27149798 |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 101.0 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | C1CCC2C(C1)CCC21CC1 |
| Np Classifier Class | Iridoids monoterpenoids |
| Deep Smiles | CCCC=O)OCC=CO[C@H][C@H]C6=C[C@@H][C@]5CO3)))OC=O)C)))))))OC=O)CCC)C)))))))))))))C |
| Heavy Atom Count | 30.0 |
| Classyfire Class | Prenol lipids |
| Scaffold Graph Node Level | C1CC2CCC3(CO3)C2CO1 |
| Classyfire Subclass | Monoterpenoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 765.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 4.0 |
| Uniprot Id | n.a. |
| Iupac Name | [(1S,6S,7R,7aS)-6-acetyloxy-1-(3-methylbutanoyloxy)spiro[6,7a-dihydro-1H-cyclopenta[c]pyran-7,2'-oxirane]-4-yl]methyl 3-methylbutanoate |
| Nih Violation | True |
| Prediction Hob | 0.0 |
| Veber Rule | False |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 1.8 |
| Is Pains | False |
| Gsk 4 400 Rule | False |
| Molecular Formula | C22H30O8 |
| Scaffold Graph Node Bond Level | C1=CC2=CCC3(CO3)C2CO1 |
| Prediction Swissadme | 0.0 |
| Inchi Key | XLACUABANMZLCJ-KVJIRVJXSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.6818181818181818 |
| Logs | -4.154 |
| Rotatable Bond Count | 11.0 |
| Logd | 2.366 |
| Synonyms | isovaltrate |
| Esol Class | Soluble |
| Functional Groups | CC(=O)OC, CC(=O)O[C@H]1CC(=CC)C(C)=CO1, COC(C)=O, C[C@]1(C)CO1 |
| Compound Name | Isovaltrate |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 422.194 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 422.194 |
| Hydrogen Bond Acceptor Count | 8.0 |
| Molecular Weight | 422.5 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 4.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | -2.8421388000000016 |
| Inchi | InChI=1S/C22H30O8/c1-12(2)6-18(24)26-9-15-10-27-21(30-19(25)7-13(3)4)20-16(15)8-17(29-14(5)23)22(20)11-28-22/h8,10,12-13,17,20-21H,6-7,9,11H2,1-5H3/t17-,20+,21-,22+/m0/s1 |
| Smiles | CC(C)CC(=O)OCC1=CO[C@H]([C@H]2C1=C[C@@H]([C@]23CO3)OC(=O)C)OC(=O)CC(C)C |
| Nring | 3.0 |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Monoterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Nardostachys Jatamansi (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Sorbaria Sorbifolia (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Valeriana Amurensis (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Valeriana Cardamines (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Valeriana Dubia (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Valeriana Fedtschenkoi (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Valeriana Hardwickii (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Valeriana Jatamansi (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 9. Outgoing r'ship
FOUND_INto/from Valeriana Jatamansii (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 10. Outgoing r'ship
FOUND_INto/from Valeriana Laxiflora (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Valeriana Leschenaultia (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Valeriana Microphylla (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Valeriana Officinalis (Plant) Rel Props:Reference:ISBN:9788172361792 - 14. Outgoing r'ship
FOUND_INto/from Valeriana Wallichii (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Valeriana Wolgensis (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Xanthoceras Sorbifolia (Plant) Rel Props:Reference: