Matricin
PubChem CID: 92265
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Matricin, Proazulene, 29041-35-8, (-)-Matricin, UNII-O034C3549S, EINECS 249-384-3, O034C3549S, CHEBI:6699, [3S-(3alpha,3aalpha,4alpha,9alpha,9aalpha,9bbeta)]-3a,4,5,9,9a,9b-hexahydro-9-hydroxy-3,6,9-trimethyl-2-oxoazuleno[4,5-b]-3H-furan-4-yl acetate, AZULENO(4,5-B)FURAN-2(3H)-ONE, 4-(ACETYLOXY)-3A,4,5,9,9A,9B-HEXAHYDRO-9-HYDROXY-3,6,9-TRIMETHYL-, (3S,3AR,4S,9R,9AS,9BS)-, matricine, (3S-(3alpha,3aalpha,4alpha,9alpha,9aalpha,9bbeta))-3a,4,5,9,9a,9b-Hexahydro-9-hydroxy-3,6,9-trimethyl-2-oxoazuleno(4,5-b)-3H-furan-4-yl acetate, Matricin, analytical standard, [(3S,3aR,4S,9R,9aS,9bS)-9-hydroxy-3,6,9-trimethyl-2-oxo-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl] acetate, SCHEMBL457856, CHEMBL497441, DTXSID50951639, GLXC-19156, LMPR0103410003, MATRICIN (CONSTITUENT OF CHAMOMILE), C09499, MATRICIN (CONSTITUENT OF CHAMOMILE) [DSC], Q1908961, [(3s,3Ar,4s,9r,9as,9bs)-9-hydroxy-3,6,9-trimethyl-2-oxo-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl]acetate, 249-384-3 |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 72.8 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1CC2CCCC3CCCC3C2C1 |
| Np Classifier Class | Guaiane sesquiterpenoids |
| Deep Smiles | CC=O)O[C@H]CC=C[C@@H][C@@H][C@@H]7[C@H]C)C=O)O5)))))[C@]C=C5))C)O))))C |
| Heavy Atom Count | 22.0 |
| Classyfire Class | Lactones |
| Description | Proazulene, also known as matricine, is a member of the class of compounds known as gamma butyrolactones. Gamma butyrolactones are compounds containing a gamma butyrolactone moiety, which consists of an aliphatic five-member ring with four carbon atoms, one oxygen atom, and bears a ketone group on the carbon adjacent to the oxygen atom. Thus, proazulene is considered to be an isoprenoid lipid molecule. Proazulene is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). Proazulene can be found in anise, which makes proazulene a potential biomarker for the consumption of this food product. Chamazulene, a blue-violet derivative of azulene, found in a variety of plants including in chamomile (Matricaria chamomilla), wormwood (Artemisia absinthium) and yarrow (Achillea millefolium) is biosynthesized from matricin . |
| Scaffold Graph Node Level | OC1CC2CCCC3CCCC3C2O1 |
| Classyfire Subclass | Gamma butyrolactones |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 590.0 |
| Database Name | fooddb_chem_all;hmdb_chem_all;imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 6.0 |
| Iupac Name | [(3S,3aR,4S,9R,9aS,9bS)-9-hydroxy-3,6,9-trimethyl-2-oxo-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl] acetate |
| Nih Violation | False |
| Class | Lactones |
| Veber Rule | True |
| Classyfire Superclass | Organoheterocyclic compounds |
| Xlogp | 1.0 |
| Superclass | Organoheterocyclic compounds |
| Is Pains | False |
| Subclass | Gamma butyrolactones |
| Gsk 4 400 Rule | True |
| Molecular Formula | C17H22O5 |
| Scaffold Graph Node Bond Level | O=C1CC2CCC=C3C=CCC3C2O1 |
| Inchi Key | SYTRJRUSWMMZLV-VQGWEXQJSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 2.0 |
| Synonyms | Matricine, 1-hydroxy-6-acetoxyguaia-2,4(10)-dien-8,12-olide (matricine), matricin |
| Esol Class | Soluble |
| Functional Groups | CC(=O)OC, CC(C)=C1C=CCC1, CO, COC(C)=O |
| Compound Name | Matricin |
| Kingdom | Organic compounds |
| Exact Mass | 306.147 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 306.147 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 306.4 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 6.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic heteropolycyclic compounds |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C17H22O5/c1-8-7-12(21-10(3)18)13-9(2)16(19)22-15(13)14-11(8)5-6-17(14,4)20/h5-6,9,12-15,20H,7H2,1-4H3/t9-,12-,13+,14-,15-,17+/m0/s1 |
| Smiles | C[C@H]1[C@@H]2[C@H](CC(=C3C=C[C@@]([C@@H]3[C@H]2OC1=O)(C)O)C)OC(=O)C |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | Gamma butyrolactones |
| Np Classifier Superclass | Sesquiterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Artemisia Absinthium (Plant) Rel Props:Reference:ISBN:9788172360481 - 2. Outgoing r'ship
FOUND_INto/from Matricaria Chamomilla (Plant) Rel Props:Reference:https://doi.org/10.2174/0929867033456729 - 3. Outgoing r'ship
FOUND_INto/from Pimpinella Anisum (Plant) Rel Props:Source_db:fooddb_chem_all