(E)-Arachidin II
PubChem CID: 92012758
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | (E)-Arachidin II, Arachidin II, CHEBI:174824, 4-Isopentenyl-3,4',5-trihydroxystilbene, 5-[(Z)-2-(4-hydroxyphenyl)ethenyl]-2-(3-methylbut-2-enyl)benzene-1,3-diol |
|---|---|
| Topological Polar Surface Area | 60.7 |
| Hydrogen Bond Donor Count | 3.0 |
| Inchi Key | WWFOQQIWOKJBSJ-PLNGDYQASA-N |
| Rotatable Bond Count | 4.0 |
| Synonyms | 4-Isopentenyl-3,4',5-trihydroxystilbene, 4-Prenylresveratrol, Arachidin II |
| Heavy Atom Count | 22.0 |
| Compound Name | (E)-Arachidin II |
| Description | Constituent of peanuts (Arachis hypogaea). (E)-Arachidin II is found in peanut and nuts. |
| Exact Mass | 296.141 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 296.141 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 377.0 |
| Hydrogen Bond Acceptor Count | 3.0 |
| Molecular Weight | 296.4 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 5-[(Z)-2-(4-hydroxyphenyl)ethenyl]-2-(3-methylbut-2-enyl)benzene-1,3-diol |
| Total Atom Stereocenter Count | 0.0 |
| Nih Violation | False |
| Total Bond Stereocenter Count | 1.0 |
| Inchi | InChI=1S/C19H20O3/c1-13(2)3-10-17-18(21)11-15(12-19(17)22)5-4-14-6-8-16(20)9-7-14/h3-9,11-12,20-22H,10H2,1-2H3/b5-4- |
| Smiles | CC(=CCC1=C(C=C(C=C1O)/C=C\C2=CC=C(C=C2)O)O)C |
| Xlogp | 5.1 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 1.0 |
| Molecular Formula | C19H20O3 |
- 1. Outgoing r'ship
FOUND_INto/from Arachis Hypogaea (Plant) Rel Props:Source_db:fooddb_chem_all