Lycoclavanol
PubChem CID: 91895419
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Lycoclavanol, 13956-51-9, (3S,6R,7S,8R,11R,12S,15S,16R,19R,21R)-7-(hydroxymethyl)-3,7,11,16,20,20-hexamethylpentacyclo[13.8.0.03,12.06,11.016,21]tricos-1(23)-ene-8,19-diol, (4S)-C(14a)-Homo-27-norgammacer-14-ene-3alpha,21beta,24-triol, 1H-Cyclohepta[1,2-a:5,4-a']dinaphthalene-3,11-diol, 2,3,4,4a,5,6,6a,7,9,9a,10,11,12,13,13a,13b,14,15,15a,15b-eicosahydro-4-(hydroxymethyl)-4,6a,10,10,13a,15b-hexamethyl-, (3R,4S,4aR,6aS,9aR,11R,13aR,13bS,15aS,15bR)-, (3S,6R,7S,8R,11R,12S,15S,16R,19R,21R)-7-(hydroxymethyl)-3,7,11,16,20,20-hexamethylpentacyclo(13.8.0.03,12.06,11.016,21)tricos-1(23)-ene-8,19-diol, HY-N3350, AKOS032948683, DA-55118, FS-10330, CS-0023962, (1S,6R,8R,11R,12S,15S,16R,19R,20S,21R)-20-(HYDROXYMETHYL)-1,7,7,11,16,20-HEXAMETHYLPENTACYCLO[13.8.0.0(3),(1)(2).0?,(1)(1).0(1)?,(2)(1)]TRICOS-3-ENE-8,19-DIOL, C(14a)-Homo-27-norgammacer-14-ene-3,21,23-triol, (3,4,21)-, Serrat-14-en-3,21,24-triol |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 60.7 |
| Hydrogen Bond Donor Count | 3.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CCC2C(C1)CCC1CC3CCC4CCCCC4C3CCC12 |
| Np Classifier Class | Serratane triterpenoids |
| Deep Smiles | OC[C@@]C)[C@H]O)CC[C@][C@H]6CC[C@@][C@@H]6CC[C@H]C=CC[C@@H][C@]6C)CC[C@H]C6C)C))O))))))))C7))))))C)))))C |
| Heavy Atom Count | 33.0 |
| Classyfire Class | Prenol lipids |
| Scaffold Graph Node Level | C1CCC2C(C1)CCC1CC3CCC4CCCCC4C3CCC12 |
| Classyfire Subclass | Triterpenoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 817.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 10.0 |
| Iupac Name | (3S,6R,7S,8R,11R,12S,15S,16R,19R,21R)-7-(hydroxymethyl)-3,7,11,16,20,20-hexamethylpentacyclo[13.8.0.03,12.06,11.016,21]tricos-1(23)-ene-8,19-diol |
| Prediction Hob | 1.0 |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 6.9 |
| Gsk 4 400 Rule | False |
| Molecular Formula | C30H50O3 |
| Scaffold Graph Node Bond Level | C1=C2CC3CCC4CCCCC4C3CCC2C2CCCCC2C1 |
| Prediction Swissadme | 0.0 |
| Inchi Key | VYUNCIDAMBNEFU-HGUPHKDTSA-N |
| Silicos It Class | Moderately soluble |
| Fcsp3 | 0.9333333333333332 |
| Logs | -5.261 |
| Rotatable Bond Count | 1.0 |
| Logd | 4.555 |
| Synonyms | lycoclavanol, lycoclavinol |
| Esol Class | Poorly soluble |
| Functional Groups | CC=C(C)C, CO |
| Compound Name | Lycoclavanol |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 458.376 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 458.376 |
| Hydrogen Bond Acceptor Count | 3.0 |
| Molecular Weight | 458.7 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 10.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | -6.946207400000001 |
| Inchi | InChI=1S/C30H50O3/c1-26(2)21-9-7-19-17-27(3)14-11-23-29(5,16-13-25(33)30(23,6)18-31)22(27)10-8-20(19)28(21,4)15-12-24(26)32/h7,20-25,31-33H,8-18H2,1-6H3/t20-,21-,22-,23+,24+,25+,27-,28+,29+,30+/m0/s1 |
| Smiles | C[C@@]12CC[C@@H]3[C@@]([C@H]1CC[C@H]4C(=CC[C@@H]5[C@@]4(CC[C@H](C5(C)C)O)C)C2)(CC[C@H]([C@]3(C)CO)O)C |
| Nring | 5.0 |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Np Classifier Superclass | Triterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Aconitum Japonicum (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Cercidiphyllum Japonicum (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Chrysosplenium Japonicum (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Cinnamomum Japonicum (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Cirsium Japonicum (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Clerodendrum Japonicum (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Conocephalum Japonicum (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Crinum Asiaticum (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Eupatorium Japonicum (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Farfugium Japonicum (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Geum Japonicum (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Hypecoum Japonicum (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Hypericum Japonicum (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Ligustrum Japonicum (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Lycopodium Casuarinoides (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Lycopodium Cernuum (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Lycopodium Chinense (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Lycopodium Clavatum (Plant) Rel Props:Reference:https://doi.org/10.2174/0929867033456729 - 19. Outgoing r'ship
FOUND_INto/from Lycopodium Contiguum (Plant) Rel Props:Reference: - 20. Outgoing r'ship
FOUND_INto/from Lycopodium Japonicum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 21. Outgoing r'ship
FOUND_INto/from Lycopodium Obscurum (Plant) Rel Props:Reference: - 22. Outgoing r'ship
FOUND_INto/from Lycopodium Paniculatum (Plant) Rel Props:Reference: - 23. Outgoing r'ship
FOUND_INto/from Lycopodium Phlegmaria (Plant) Rel Props:Reference: - 24. Outgoing r'ship
FOUND_INto/from Lycopodium Selago (Plant) Rel Props:Reference: - 25. Outgoing r'ship
FOUND_INto/from Lygodium Japonicum (Plant) Rel Props:Reference: - 26. Outgoing r'ship
FOUND_INto/from Nuphar Japonicum (Plant) Rel Props:Reference: - 27. Outgoing r'ship
FOUND_INto/from Onychium Japonicum (Plant) Rel Props:Reference: - 28. Outgoing r'ship
FOUND_INto/from Peucedanum Japonicum (Plant) Rel Props:Reference: - 29. Outgoing r'ship
FOUND_INto/from Phellodendron Japonicum (Plant) Rel Props:Reference: - 30. Outgoing r'ship
FOUND_INto/from Phtheirospermum Japonicum (Plant) Rel Props:Reference: - 31. Outgoing r'ship
FOUND_INto/from Rhododendron Japonicum (Plant) Rel Props:Reference: - 32. Outgoing r'ship
FOUND_INto/from Styphnolobium Japonicum (Plant) Rel Props:Reference: - 33. Outgoing r'ship
FOUND_INto/from Tripterospermum Japonicum (Plant) Rel Props:Reference: