Trigoneoside IIA
PubChem CID: 91864539
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Trigoneoside IIA, Trigoneoside iia, (-)-, UNII-35KP0AVB63, 35KP0AVB63, Trigoneoside iia (constituent of fenugreek seed) [DSC], 187141-37-3, beta-D-Glucopyranoside, (3beta,5beta,25S)-26-(beta-D-glucopyranosyloxy)-22-hydroxyfurostan-3-yl 6-o-beta-D-xylopyranosyl-, Trigoneoside iia (constituent of fenugreek seed), Q27256470, .BETA.-D-GLUCOPYRANOSIDE, (3.BETA.,5.BETA.,25S)-26-(.BETA.-D-GLUCOPYRANOSYLOXY)-22-HYDROXYFUROSTAN-3-YL 6-O-.BETA.-D-XYLOPYRANOSYL- |
|---|---|
| Topological Polar Surface Area | 287.0 |
| Hydrogen Bond Donor Count | 11.0 |
| Heavy Atom Count | 62.0 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1510.0 |
| Database Name | cmaup_ingredients;pubchem |
| Defined Atom Stereocenter Count | 26.0 |
| Iupac Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(2S)-4-[(1R,2S,4S,6R,7S,8R,9S,12S,13S,16S,18R)-6-hydroxy-7,9,13-trimethyl-16-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxy-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-6-yl]-2-methylbutoxy]oxane-3,4,5-triol |
| Prediction Hob | 0.0 |
| Xlogp | 0.2 |
| Molecular Formula | C44H74O18 |
| Prediction Swissadme | 0.0 |
| Inchi Key | ISFAETRPBLFKQD-KTNFGKJSSA-N |
| Fcsp3 | 1.0 |
| Logs | -3.181 |
| Rotatable Bond Count | 12.0 |
| Logd | 2.513 |
| Compound Name | Trigoneoside IIA |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 890.488 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 890.488 |
| Hydrogen Bond Acceptor Count | 18.0 |
| Molecular Weight | 891.0 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 26.0 |
| Total Bond Stereocenter Count | 0.0 |
| Esol | -4.717459600000005 |
| Inchi | InChI=1S/C44H74O18/c1-19(16-56-40-37(53)34(50)32(48)28(15-45)60-40)7-12-44(55)20(2)30-27(62-44)14-25-23-6-5-21-13-22(8-10-42(21,3)24(23)9-11-43(25,30)4)59-41-38(54)35(51)33(49)29(61-41)18-58-39-36(52)31(47)26(46)17-57-39/h19-41,45-55H,5-18H2,1-4H3/t19-,20-,21+,22-,23+,24-,25-,26+,27-,28+,29+,30-,31-,32+,33+,34-,35-,36+,37+,38+,39-,40+,41+,42-,43-,44+/m0/s1 |
| Smiles | C[C@H]1[C@H]2[C@H](C[C@@H]3[C@@]2(CC[C@H]4[C@H]3CC[C@H]5[C@@]4(CC[C@@H](C5)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO[C@H]7[C@@H]([C@H]([C@@H](CO7)O)O)O)O)O)O)C)C)O[C@@]1(CC[C@H](C)CO[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O)O |
| Nring | 8.0 |
| Defined Bond Stereocenter Count | 0.0 |
- 1. Outgoing r'ship
FOUND_INto/from Trigonella Foenum-Graecum (Plant) Rel Props:Source_db:cmaup_ingredients