2-Methylene-6-methyl-5,7-octadien-1-ol
PubChem CID: 91750428
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | YJNYPBDCLZOIMT-RMKNXTFCSA-N, 2-Methylene-6-methyl-5,7-octadien-1-ol |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 20.2 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Np Classifier Class | Fatty alcohols |
| Deep Smiles | OCC=C)CC/C=C/C=C))C |
| Heavy Atom Count | 11.0 |
| Classyfire Class | Prenol lipids |
| Classyfire Subclass | Monoterpenoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 166.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | (5E)-6-methyl-2-methylideneocta-5,7-dien-1-ol |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 3.1 |
| Gsk 4 400 Rule | True |
| Molecular Formula | C10H16O |
| Inchi Key | YJNYPBDCLZOIMT-RMKNXTFCSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 5.0 |
| Synonyms | 2-methylene-6-methyl-5,7-octadien-1-ol |
| Esol Class | Soluble |
| Functional Groups | C=C(C)C, C=C/C(C)=C/C, CO |
| Compound Name | 2-Methylene-6-methyl-5,7-octadien-1-ol |
| Exact Mass | 152.12 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 152.12 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 152.23 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 1.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C10H16O/c1-4-9(2)6-5-7-10(3)8-11/h4,6,11H,1,3,5,7-8H2,2H3/b9-6+ |
| Smiles | C/C(=C\CCC(=C)CO)/C=C |
| Np Classifier Biosynthetic Pathway | Fatty acids |
| Defined Bond Stereocenter Count | 1.0 |
| Egan Rule | True |
| Np Classifier Superclass | Fatty acyls |
- 1. Outgoing r'ship
FOUND_INto/from Maclura Pomifera (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.1763