Dimyrcene II-a
PubChem CID: 91749731
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Dimyrcene II-a, AIPIFXVDYDBWHE-UHFFFAOYSA-N, Q67879944 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 0.0 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CCCCC1 |
| Np Classifier Class | Prenylbisabolane diterpenoids |
| Deep Smiles | CC=CCCCCCCCC6)C=C)CCC=CC)C))))))))))))))C |
| Heavy Atom Count | 20.0 |
| Classyfire Class | Prenol lipids |
| Scaffold Graph Node Level | C1CCCCC1 |
| Classyfire Subclass | Monoterpenoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 348.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 1-(6-methylhepta-1,5-dien-2-yl)-3-(4-methylpent-3-enyl)cyclohexane |
| Nih Violation | False |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 8.3 |
| Is Pains | False |
| Gsk 4 400 Rule | False |
| Molecular Formula | C20H34 |
| Scaffold Graph Node Bond Level | C1CCCCC1 |
| Inchi Key | AIPIFXVDYDBWHE-UHFFFAOYSA-N |
| Silicos It Class | Moderately soluble |
| Rotatable Bond Count | 7.0 |
| Synonyms | dimyrcene ii-a |
| Esol Class | Poorly soluble |
| Functional Groups | C=C(C)C, CC=C(C)C |
| Compound Name | Dimyrcene II-a |
| Exact Mass | 274.266 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 274.266 |
| Hydrogen Bond Acceptor Count | 0.0 |
| Molecular Weight | 274.5 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 2.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C20H34/c1-16(2)9-6-11-18(5)20-14-8-13-19(15-20)12-7-10-17(3)4/h9-10,19-20H,5-8,11-15H2,1-4H3 |
| Smiles | CC(=CCCC1CCCC(C1)C(=C)CCC=C(C)C)C |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Np Classifier Superclass | Diterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Pistacia Lentiscus (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.2730060406