2-Hexyldodecyl isobutyrate
PubChem CID: 91691599
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 2-Hexyldodecyl isobutyrate, FYQJPAMRHFILFU-UHFFFAOYSA-N |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 26.3 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Np Classifier Class | Wax monoesters |
| Deep Smiles | CCCCCCCCCCCCOC=O)CC)C)))))CCCCCC |
| Heavy Atom Count | 24.0 |
| Classyfire Class | Fatty acyls |
| Classyfire Subclass | Fatty alcohol esters |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 273.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-hexyldodecyl 2-methylpropanoate |
| Nih Violation | True |
| Veber Rule | False |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 9.7 |
| Is Pains | False |
| Gsk 4 400 Rule | False |
| Molecular Formula | C22H44O2 |
| Inchi Key | FYQJPAMRHFILFU-UHFFFAOYSA-N |
| Silicos It Class | Poorly soluble |
| Rotatable Bond Count | 18.0 |
| Synonyms | 2-hexyldodecyl isobutyrate |
| Esol Class | Poorly soluble |
| Functional Groups | COC(C)=O |
| Compound Name | 2-Hexyldodecyl isobutyrate |
| Exact Mass | 340.334 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 340.334 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 340.6 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C22H44O2/c1-5-7-9-11-12-13-14-16-18-21(17-15-10-8-6-2)19-24-22(23)20(3)4/h20-21H,5-19H2,1-4H3 |
| Smiles | CCCCCCCCCCC(CCCCCC)COC(=O)C(C)C |
| Np Classifier Biosynthetic Pathway | Fatty acids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Np Classifier Superclass | Fatty esters |
- 1. Outgoing r'ship
FOUND_INto/from Adansonia Digitata (Plant) Rel Props:Reference:https://doi.org/10.1016/j.lwt.2018.03.014