alpha-Pinene oxide
PubChem CID: 91508
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | alpha-Pinene oxide, 1686-14-2, 2,3-Epoxypinane, 2-Pinene oxide, alpha-Pinene epoxide, Pinane, 2,3-epoxy-, Pinene oxide, a-Pinene Oxide, alpha-Pineneoxide, 3-Oxatricyclo[4.1.1.02,4]octane, 2,7,7-trimethyl-, .alpha.-Pinene oxide, Pinane, 2,3-epoxy-, (-)-, .alpha.-Pinene epoxide, 2,7,7-Trimethyl-3-oxatricyclo[4.1.1.02,4]octane, 2,3-Epoxy-pinane, CCRIS 3762, alpha-Pinene 2,3-oxide, NSC 5609, Alpha-pinane oxide, EINECS 216-869-6, NSC 12148, BRN 0080362, CHEBI:29060, 2,7,7-Trimethyl-3-oxatricyclo(4.1.1.0(sup 2,4))octane, DTXSID5051781, 3-Oxatricyclo(4.1.1.0(sup 2,4))octane, 2,7,7-trimethyl-, Pinane,3-epoxy-, 5-17-01-00426 (Beilstein Handbook Reference), NSC12148, 2,7,7-Trimethyl-3-oxatricyclo(4.1.1.02,4)octane, 2,7,7-trimethyl-3-oxatricyclo[4.1.1.0(2,4)]octane, 3-Oxatricyclo(4.1.1.02,4)octane, 2,7,7-trimethyl-, 3-Oxatricyclo[4.1.1.0(2,4)]octane, 2,7,7-trimethyl-, Pinane,3-epoxy-, (-)-, (+-)-alpha-Pinene oxide, 3-Oxatricyclo[4.1.1.02, 2,7,7-trimethyl-, 2,7,7-trimethyl-3-oxatricyclo(4.1.1.0(2,4))octane, DTXSID20331444, 2,7,7-Trimethyl-3-oxa-tricyclo(4.1.1.0(2,4))octane, 2,7,7-Trimethyl-3-oxa-tricyclo[4.1.1.0(2,4)]octane, EINECS 250-938-1, 2,3-Epoxypinane, 2,7,7-trimethyl-3-oxatricyclo[4.1.1.02,4]octane, I+/--Pinene oxide, EC 250-938-1, ?-PINENE OXIDE, bmse000491, .alpha.-Pinene 2,3-oxide, SCHEMBL93429, 218308_ALDRICH, CHEMBL274511, DTXCID4030336, DTXCID70282538, NSC5609, NSC-5609, NSC-12148, NSC407160, AKOS015916312, HY-W130074, NSC-407160, AS-68305, DA-70002, CS-0188178, NS00123845, P1362, D97335, 3-Oxatricyclo4.1.1.02,4octane, 2,7,7-trimethyl-, Q27104051, 2,7,7-Trimethyl-3-oxatricyclo[4.1.1.0~2,4~]octane, 3-Oxatricyclo[4.1.1.02,4]octane,2,7,7-trimethyl-, {3-Oxatricyclo[4.1.1.02,4]octane,} 2,7,7-trimethyl-, 2,7,7-TRIMETHYL-3-OXATRICYCLO[4.1.1.0(2),?]OCTANE, 3-Oxatricyclo(4.1.1.0(sup 2,4))octane, 2,7,7-trimethyl-(9CI), 216-869-6 |
|---|---|
| Topological Polar Surface Area | 12.5 |
| Hydrogen Bond Donor Count | 0.0 |
| Heavy Atom Count | 11.0 |
| Description | Alpha-pinene oxide is cheap monoterpene, which is important compound for the fragnance industry. Biocatalytic method is used to convert monoterpenes into terpenoids. The biotransformation of alpha-pinene oxide using resting cells of Pseudomonas fluorescens NCIMB 11671 produces isonovalal (cis-2-methyl-5-isopropylhexa-2,5-dienal), which is a fragrance. However, this biotransformation has technical problems including the following: alpha-pinene oxide undergoes autoxidation in water and light, it is hydrophobic and relatively toxic to the biocatalyst, and it suffers from product inhibition. the influence of other terpene byproducts on the flux of alpha-pinene oxide was investigated and found to decrease the flux into the organic phase by up to 10%. (PMID: 16321051) [HMDB] |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 221.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2,7,7-trimethyl-3-oxatricyclo[4.1.1.02,4]octane |
| Prediction Hob | 1.0 |
| Class | Prenol lipids |
| Xlogp | 2.1 |
| Superclass | Lipids and lipid-like molecules |
| Subclass | Monoterpenoids |
| Molecular Formula | C10H16O |
| Prediction Swissadme | 0.0 |
| Inchi Key | NQFUSWIGRKFAHK-UHFFFAOYSA-N |
| Fcsp3 | 1.0 |
| Logs | -3.002 |
| Rotatable Bond Count | 0.0 |
| State | Solid |
| Logd | 2.878 |
| Synonyms | 2-Pinene oxide, 2,3-Epoxy-pinane, 2,3-Epoxypinane, 2,7,7-Trimethyl-3-oxatricyclo[4.1.1.0(2,4)]octane, a-Pinene epoxide, a-Pinene-oxide, alpha-Pinene 2,3-oxide, alpha-Pinene epoxide, alpha-Pinene oxide, alpha-Pinene-oxide, Pinene oxide, α-pinene epoxide, α-pinene-oxide, Α-pinene epoxide, Α-pinene-oxide, alpha-Pinane oxide, a-Pinene oxide, Α-pinene oxide |
| Substituent Name | Pinane monoterpenoid, Oxepane, Oxacycle, Organoheterocyclic compound, Ether, Oxirane, Dialkyl ether, Hydrocarbon derivative, Organooxygen compound, Aliphatic heteropolycyclic compound |
| Compound Name | alpha-Pinene oxide |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 152.12 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 152.12 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 152.23 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 4.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic heteropolycyclic compounds |
| Esol | -2.1257694 |
| Inchi | InChI=1S/C10H16O/c1-9(2)6-4-7(9)10(3)8(5-6)11-10/h6-8H,4-5H2,1-3H3 |
| Smiles | CC1(C2CC1C3(C(C2)O3)C)C |
| Nring | 4.0 |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | Bicyclic monoterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Angelica Acutiloba (Plant) Rel Props:Source_db:cmaup_ingredients - 2. Outgoing r'ship
FOUND_INto/from Angelica Gigas (Plant) Rel Props:Source_db:cmaup_ingredients - 3. Outgoing r'ship
FOUND_INto/from Angelica Sinensis (Plant) Rel Props:Source_db:cmaup_ingredients - 4. Outgoing r'ship
FOUND_INto/from Daucus Carota (Plant) Rel Props:Source_db:cmaup_ingredients