1,7-Octadien-3-ol, 2,6-dimethyl-
PubChem CID: 90789
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 1,7-Octadien-3-ol, 2,6-dimethyl-, 22460-59-9, 3,7-Dimethyl-1, 7-octadien-6-ol, 2,6-Dimethyl-1,7-octadien-3-ol, DTXSID90885207, SCHEMBL7937143, DTXCID001024601, NS00125550, 607-083-8 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 20.2 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Np Classifier Class | Acyclic monoterpenoids, Irregular monoterpenoids |
| Deep Smiles | C=CCCCCC=C)C))O))))C |
| Heavy Atom Count | 11.0 |
| Classyfire Class | Fatty acyls |
| Classyfire Subclass | Fatty alcohols |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 138.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2,6-dimethylocta-1,7-dien-3-ol |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 3.0 |
| Gsk 4 400 Rule | True |
| Molecular Formula | C10H18O |
| Inchi Key | TYASLDPXCAROPT-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 5.0 |
| Synonyms | 2,6-dimethyl-1,7-octadiene-3-ol |
| Esol Class | Soluble |
| Functional Groups | C=C(C)C, C=CC, CO |
| Compound Name | 1,7-Octadien-3-ol, 2,6-dimethyl- |
| Exact Mass | 154.136 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 154.136 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 154.25 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 2.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C10H18O/c1-5-9(4)6-7-10(11)8(2)3/h5,9-11H,1-2,6-7H2,3-4H3 |
| Smiles | CC(CCC(C(=C)C)O)C=C |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Monoterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Moringa Oleifera (Plant) Rel Props:Reference:ISBN:9770972795006