Glyceryl Dimyristate
PubChem CID: 89298
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 1,2-Dimyristoyl-rac-glycerol, 20255-94-1, 1,2-Dimyristin, 3-hydroxypropane-1,2-diyl ditetradecanoate, 56270-93-0, Glyceryl dimyristate, Dimyristoyl diglyceride, DL-alpha,beta-Dimyristin, (3-hydroxy-2-tetradecanoyloxypropyl) tetradecanoate, Glycerol dimyristate, Tetradecanoic acid, 1,1'-[1-(hydroxymethyl)-1,2-ethanediyl] ester, D-alpha,beta-Dimyristin, 1,2-dimyristoylglycerol, G0ZI9U6LC3, NU6PA830XU, EINECS 258-629-3, 1-(Hydroxymethyl)ethylene dimyristate, 1,2-Dimyristoyl-rac-glycerol (C14:0), AI3-03492, Tetradecanoic acid, diester with 1,2,3-propanetriol, TETRADECANOIC ACID, 1,1'-(1-(HYDROXYMETHYL)-1,2-ETHANEDIYL) ESTER, DL-,-Dimyristin, DL-?,?-Dimyristin, 1,2 dimyristoylglycerol, 2,3 Dimyristoylglycerol, 1,2-dimyristoyl glycerol, UNII-G0ZI9U6LC3, UNII-NU6PA830XU, 1,2 ditetradecanoylglycerol, SCHEMBL571620, 1,2-DIMYRISTOYLGLYCERIN, DTXSID5052179, CHEBI:83320, DTXSID00942375, GLYCERYL 1,2-DIMYRISTATE, DTXCID901079546, GLYCERYL DIMYRISTATE [INCI], EINECS 243-643-4, GLYCEROL 1,2-DITETRADECANOATE, AKOS027378572, HY-W127409, BP-27882, FD111135, PD047013, 1,2-GLYCERIN DIMYRISTIC ACID ESTER, DB-053651, CS-0185643, NS00013695, DG 14:0_14:0, G61964, 1 2-DIMYRISTOYL-RAC-GLYCEROL (C14:0), Q27156751, 1-hydroxy-3-(tetradecanoyloxy)propan-2-yl tetradecanoate, 258-629-3 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 72.8 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Np Classifier Class | Diacylglycerols |
| Deep Smiles | CCCCCCCCCCCCCC=O)OCCOC=O)CCCCCCCCCCCCC)))))))))))))))CO |
| Heavy Atom Count | 36.0 |
| Classyfire Class | Glycerolipids |
| Classyfire Subclass | Diradylglycerols |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 480.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | (3-hydroxy-2-tetradecanoyloxypropyl) tetradecanoate |
| Veber Rule | False |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 11.9 |
| Gsk 4 400 Rule | False |
| Molecular Formula | C31H60O5 |
| Inchi Key | JFBCSFJKETUREV-UHFFFAOYSA-N |
| Silicos It Class | Poorly soluble |
| Rotatable Bond Count | 30.0 |
| Synonyms | dimyristin |
| Esol Class | Poorly soluble |
| Functional Groups | CO, COC(C)=O |
| Compound Name | Glyceryl Dimyristate |
| Exact Mass | 512.444 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 512.444 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 512.799 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | False |
| Inchi | InChI=1S/C31H60O5/c1-3-5-7-9-11-13-15-17-19-21-23-25-30(33)35-28-29(27-32)36-31(34)26-24-22-20-18-16-14-12-10-8-6-4-2/h29,32H,3-28H2,1-2H3 |
| Smiles | CCCCCCCCCCCCCC(=O)OCC(CO)OC(=O)CCCCCCCCCCCCC |
| Np Classifier Biosynthetic Pathway | Fatty acids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Np Classifier Superclass | Glycerolipids |
- 1. Outgoing r'ship
FOUND_INto/from Areca Catechu (Plant) Rel Props:Reference:ISBN:9788172362140