Lauryl methacrylate
PubChem CID: 8906
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Dodecyl methacrylate, 142-90-5, LAURYL METHACRYLATE, Dodecyl 2-methylacrylate, 2-Propenoic acid, 2-methyl-, dodecyl ester, Metazene, N-Dodecyl methacrylate, Dodecyl 2-methyl-2-propenoate, dodecyl 2-methylprop-2-enoate, Sipomer LMA, LAMA, Ageflex FM 246, Methacrylic acid, lauryl ester, GE 410 (methacrylate), Methacrylic acid, dodecyl ester, Caswell No. 521, Dodecyl-2-methylacrylate, Laurylester kyseliny methakrylove, NSC 5188, SR 313, Acrylic acid, 2-methyl-, dodecyl ester, HSDB 5417, EINECS 205-570-6, EPA Pesticide Chemical Code 053101, UNII-B6L83074BZ, BRN 1708160, n-Lauryl methacrylate, AI3-08765, B6L83074BZ, NSC-5188, 2-Methyl-2-propenoic acid, dodecyl ester, Methacrylic Acid Dodecyl Ester, DTXSID4027103, EC 205-570-6, Dodecyl methacrylate (stabilized with MEHQ), DTXCID107103, Laurylmethacrylate, CAS-142-90-5, LMA, C16H30O2, Laurylester kyseliny methakrylove [Czech], MFCD00008972, Ageflex FM-12, 1-Dodecyl methacrylate, 1-Dodecanol methacrylate, Lauryl methacrylate(LMA), Dodecyl 2-methylacrylate #, SCHEMBL14995, WLN: 12OVYU1, Methacrylic Acid Lauryl Ester, EPA pesticide code 053101, CHEMBL1903701, NSC5188, Tox21_201903, Tox21_303316, N-DODECYL METHACRYLATE [HSDB], AKOS015903634, CS-W012588, Methyl-2-propenoic acid, dodecyl ester, USEPA/OPP Pesticide Code: 053101, 2-methyl-2-propenoic acid dodecyl ester, Lauryl methacrylate(5cp(25 degrees c)), NCGC00164408-01, NCGC00164408-02, NCGC00257059-01, NCGC00259452-01, 170292-57-6, AS-76599, Propenoic acid, 2-methyl-, dodecyl ester, DB-042652, Dodecyl ester of 2-methyl-2-propenoic acid, M0083, NS00004091, Dodecyl Methacrylate, (stabilized with MEHQ), Lauryl methacrylate, purum, >=95.0% (GC), E75856, LAURYL METHACRYLATE(STABILIZED WITH MEHQ), Q3395664, Lauryl methacrylate, contains 500 ppm MEHQ as inhibitor, 96% |
|---|---|
| Topological Polar Surface Area | 26.3 |
| Hydrogen Bond Donor Count | 0.0 |
| Heavy Atom Count | 18.0 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 221.0 |
| Database Name | cmaup_ingredients;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | P03372, Q96RI1, P11473, n.a. |
| Iupac Name | dodecyl 2-methylprop-2-enoate |
| Prediction Hob | 1.0 |
| Xlogp | 7.2 |
| Molecular Formula | C16H30O2 |
| Prediction Swissadme | 0.0 |
| Inchi Key | GMSCBRSQMRDRCD-UHFFFAOYSA-N |
| Fcsp3 | 0.8125 |
| Logs | -4.226 |
| Rotatable Bond Count | 13.0 |
| Logd | 3.895 |
| Compound Name | Lauryl methacrylate |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 254.225 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 254.225 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 254.41 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Esol | -5.1016667999999985 |
| Inchi | InChI=1S/C16H30O2/c1-4-5-6-7-8-9-10-11-12-13-14-18-16(17)15(2)3/h2,4-14H2,1,3H3 |
| Smiles | CCCCCCCCCCCCOC(=O)C(=C)C |
| Nring | 0.0 |
| Defined Bond Stereocenter Count | 0.0 |
- 1. Outgoing r'ship
FOUND_INto/from Syzygium Aromaticum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all