N-(2-hydroxyethyl)dodecanamide
PubChem CID: 8899
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | N-(2-HYDROXYETHYL)DODECANAMIDE, 142-78-9, Lauric acid monoethanolamide, Lauramide MEA, N-Lauroylethanolamine, Laurylethanolamide, Lauric monoethanolamide, Amisol LDE, Copramyl, Dodecanamide, N-(2-hydroxyethyl)-, Vistalan, N-(2-Hydroxyethyl)lauramide, Ultrapole H, Comperlan LM, Cyclomide LM, Lauridit LM, Lauroyl-EA, Rolamid CM, Stabilor CMH, Crillon LME, Lauric ethylolamide, Lauroyl monoethanolamide, Steinamid L 203, 2-Dodecanamidoethanol, Rewomid L 203, Laurylamidoethanol, Amisol LME, Lauric acid ethanolamide, Lauryl ethanolamide, Lauric acid monoethanolamine, Lauric N-(2-hydroxyethyl)amide, Lauroyl-ethanolamine, Monoethanolamine lauric acid amide, CCRIS 4834, HSDB 5644, EINECS 205-560-1, N-(Dodecanoyl)-ethanolamine, Lauryl monoethanolamide, 098P2IGT76, MFCD00020561, N-(dodecanoyl)ethanolamine, DTXSID5025493, LAURAMIDE MONOETHANOLAMIDE, N-(2-Hydroxyethyl)dodecaneamide, CHEBI:85263, NAE 12:0, N-(2-HYDROXYETHYL)DODECANAMIDE [HSDB], Dodecylethanol amide, Coconut monoethanolamide, UNII-098P2IGT76, Incromide LCL, Mackamide LMM, Ablumide LME, Hartamide LMEA, Lauroylethanolamide, 2Dodecanamidoethanol, NAE, Stabilor C.M.H., Crillon L.M.E., Alkamide L-203, dodecanoyl ethanolamide, 1:1 Cocamide MEA, 1:1 Lauramide MEA, N-dodecanoylethanolamine, N-LEA, N(2Hydroxyethyl)lauramide, Empilan LME (Salt/Mix), Lauramide-MEA (1:1), ALKAMIDE L 203, N(2Hydroxyethyl)dodecanamide, Lauric N(2hydroxyethyl)amide, LAURAMIDE MEA [INCI], SCHEMBL679082, TOHOL N 120, CHEMBL246914, Dodecanamide, N(2hydroxyethyl), DTXCID205493, Cocomonoethanolamide (Salt/Mix), Dodecanamide, N-2-hydroxyethyl-, LMFA08040041, XH0834, AKOS010638882, CS-W022897, DS-2807, lauric acid monoethanolamide, AldrichCPR, N-(BETA-HYDROXYETHYL)DODECANAMIDE, SY110473, NS00005328, EN300-7367571, Q27158443, Z808715244, 205-560-1 |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 49.3 |
| Hydrogen Bond Donor Count | 2.0 |
| Pfizer 3 75 Rule | False |
| Np Classifier Class | N-acyl ethanolamines (endocannabinoids) |
| Deep Smiles | CCCCCCCCCCCC=O)NCCO |
| Heavy Atom Count | 17.0 |
| Classyfire Class | Carboximidic acids and derivatives |
| Classyfire Subclass | Carboximidic acids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 172.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | N-(2-hydroxyethyl)dodecanamide |
| Nih Violation | True |
| Veber Rule | False |
| Classyfire Superclass | Organic acids and derivatives |
| Xlogp | 4.0 |
| Is Pains | False |
| Gsk 4 400 Rule | True |
| Molecular Formula | C14H29NO2 |
| Inchi Key | QZXSMBBFBXPQHI-UHFFFAOYSA-N |
| Silicos It Class | Moderately soluble |
| Rotatable Bond Count | 12.0 |
| Synonyms | amisol lde |
| Esol Class | Soluble |
| Functional Groups | CNC(C)=O, CO |
| Compound Name | N-(2-hydroxyethyl)dodecanamide |
| Exact Mass | 243.22 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 243.22 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 243.39 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C14H29NO2/c1-2-3-4-5-6-7-8-9-10-11-14(17)15-12-13-16/h16H,2-13H2,1H3,(H,15,17) |
| Smiles | CCCCCCCCCCCC(=O)NCCO |
| Np Classifier Biosynthetic Pathway | Fatty acids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Fatty amides |
- 1. Outgoing r'ship
FOUND_INto/from Coriandrum Sativum (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2018.1470943