Methyl 3-Hydroxybenzoate
PubChem CID: 88068
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Methyl 3-hydroxybenzoate, 19438-10-9, Methyl m-hydroxybenzoate, m-Carbomethoxyphenol, 3-Hydroxybenzoic acid methyl ester, m-Hydroxybenzoic acid methyl ester, Benzoic acid, 3-hydroxy-, methyl ester, Methyl m-oxybenzoate, 3-(Methoxycarbonyl)phenol, 3-hydroxy-benzoic acid methyl ester, 3-carbomethoxyphenol, Benzoic acid, m-hydroxy-, methyl ester, MFCD00002295, NSC 40536, 569M9G3STJ, EINECS 243-071-5, NSC-40536, AI3-31869, DTXSID50173071, BENZOIC ACID,3-HYDROXY,METHYL ESTER, UNII-569M9G3STJ, methyl 3hydroxybenzoate, methyl-3-hydroxybenzoate, methyl metahydroxybenzoate, methyl 3- hydroxybenzoate, methyl 3-hydroxy-benzoate, Methyl-3-hydroxy-benzoate, SCHEMBL67203, METHYL3-HYDROXYBENZOATE, 3-HO-C6H4-COOCH3, CHEMBL2272613, DTXCID8095562, Methyl 3-hydroxybenzoate, 99%, CHEBI:165218, 3-hydroxy benzoic acid methyl ester, CS-B0668, METHYL META HYDROXY BENZOATE, NSC40536, AB7533, STK019404, AKOS000120513, CCG-357318, FM25415, PS-5398, HY-90004, SY001617, DB-044861, H0215, NS00008226, EN300-15490, Benzoic acid, 3-hydroxy-, methyl ester (9CI), Benzoic acid, m-hydroxy-, methyl ester (8CI), AE-562/40228867, Q27261392, F3146-0101, 243-071-5 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 46.5 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CCCCC1 |
| Np Classifier Class | Simple phenolic acids |
| Deep Smiles | COC=O)cccccc6)O |
| Heavy Atom Count | 11.0 |
| Classyfire Class | Benzene and substituted derivatives |
| Scaffold Graph Node Level | C1CCCCC1 |
| Classyfire Subclass | Benzoic acids and derivatives |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 144.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | methyl 3-hydroxybenzoate |
| Prediction Hob | 1.0 |
| Veber Rule | True |
| Classyfire Superclass | Benzenoids |
| Xlogp | 1.9 |
| Gsk 4 400 Rule | True |
| Molecular Formula | C8H8O3 |
| Scaffold Graph Node Bond Level | c1ccccc1 |
| Prediction Swissadme | 0.0 |
| Inchi Key | YKUCHDXIBAQWSF-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.125 |
| Logs | -1.579 |
| Rotatable Bond Count | 2.0 |
| Logd | 1.879 |
| Synonyms | methyl 3-hydroxybenzoate |
| Esol Class | Soluble |
| Functional Groups | cC(=O)OC, cO |
| Compound Name | Methyl 3-Hydroxybenzoate |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 152.047 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 152.047 |
| Hydrogen Bond Acceptor Count | 3.0 |
| Molecular Weight | 152.15 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | -2.2456601636363636 |
| Inchi | InChI=1S/C8H8O3/c1-11-8(10)6-3-2-4-7(9)5-6/h2-5,9H,1H3 |
| Smiles | COC(=O)C1=CC(=CC=C1)O |
| Nring | 1.0 |
| Np Classifier Biosynthetic Pathway | Shikimates and Phenylpropanoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Phenolic acids (C6-C1) |
- 1. Outgoing r'ship
FOUND_INto/from Aglaia Cordata (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Aleurites Cordata (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Alnus Cordata (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Aralia Cordata (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Buddleja Cordata (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Carpinus Cordata (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Circaea Cordata (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Drymaria Cordata (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Eucalyptus Cordata (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Ficus Cordata (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Houttuynia Cordata (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 12. Outgoing r'ship
FOUND_INto/from Macleaya Cordata (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Mikania Cordata (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Osmanthus Fragrans (Plant) Rel Props:Reference:ISBN:9788185042114 - 15. Outgoing r'ship
FOUND_INto/from Salacia Cordata (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Sida Cordata (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Swertia Cordata (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Telosma Cordata (Plant) Rel Props:Reference: - 19. Outgoing r'ship
FOUND_INto/from Tilia Cordata (Plant) Rel Props:Reference: - 20. Outgoing r'ship
FOUND_INto/from Trichosanthes Cordata (Plant) Rel Props:Reference: - 21. Outgoing r'ship
FOUND_INto/from Uncaria Cordata (Plant) Rel Props:Reference: