2-Aminothiophenol
PubChem CID: 8713
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 2-Aminothiophenol, 2-AMINOBENZENETHIOL, 137-07-5, o-Aminothiophenol, 2-Mercaptoaniline, o-Mercaptoaniline, o-Aminobenzenethiol, Benzenethiol, 2-amino-, 2-Mercaptaniline, 1-Amino-2-mercaptobenzene, Benzenethiol, o-amino-, 2-aminobenzene-1-thiol, o-Aminophenyl mercaptan, 2-Aminophenyl mercaptan, USAF EK-4376, 2-Amino-1-mercaptobenzene, ortho-aminothiophenol, 2-Amino-benzenethiol, aminothiophenol, CCRIS 9096, 2-thioaniline, KIT82KOK2Z, NSC 4738, EINECS 205-277-3, MFCD00007702, BRN 0606076, AI3-52263, 2-AMINITHIOPHENOL, NSC-4738, AMINOBENZENETHIOL, 2-, .ALPHA.-AMINOTHIOPHENOL, 2-Amino thiophenol, DTXSID6051693, CHEBI:91019, 4-13-00-00910 (Beilstein Handbook Reference), NSC-106635, aniline, 2-mercapto-, 2-Aminothiophenol 90%, 40451-21-6, oAminothiophenol, oMercaptoaniline, 2mercaptoaniline, aminobenzenethiol, oAminobenzenethiol, 0-mercaptoaniline, 2Aminobenzenethiol, 2-aminobenzenthiol, orthoaminothiophenol, o-amino benzenthiol, 2-Amino-thiophenol, o-amino thio-phenol, Benzenethiol, oamino, 2-amino benzenethiol, 2-(amino)thiophenol, Benzenethiol, 2amino, 1Amino2mercaptobenzene, UNII-KIT82KOK2Z, WLN: ZR BSH, 2-Aminothiophenol, 99%, UNII-D4F3JSV4X6, ALPHA-AMINOTHIOPHENOL, SCHEMBL7807, D4F3JSV4X6, 2-Aminothiophenol 90per cent, CHEMBL116835, DTXCID5030248, NSC4738, Indole-3-butanoyl ?-D-Glucopyranose, STL281873, AKOS000119325, AT19637, FA07685, GS-6722, 2-Aminothiophenol, technical grade, 90%, AC-10751, BP-20299, DB-042373, A0267, NS00021632, EN300-17914, Q471781, 2-Aminothiophenol 2-Mercaptoaniline 2-Aminobenzenethiol, F2190-0442, 2-Aminobenzenethiol, 2-Mercaptoaniline, 2-Mercaptoaniline, 2-Aminobenzenethiol, 205-277-3, QuadraPure(R) MPA, 100-400 mum particle size, extent of labeling: 1.5 mmol/g loading, 1 % cross-linked with divinylbenzene |
|---|---|
| Prediction Swissadme | 0.0 |
| Topological Polar Surface Area | 27.0 |
| Hydrogen Bond Donor Count | 2.0 |
| Inchi Key | VRVRGVPWCUEOGV-UHFFFAOYSA-N |
| Fcsp3 | 0.0 |
| Rotatable Bond Count | 0.0 |
| Heavy Atom Count | 8.0 |
| Compound Name | 2-Aminothiophenol |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 125.03 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 125.03 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 74.9 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 125.19 |
| Database Name | cmaup_ingredients;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-aminobenzenethiol |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Prediction Hob | 1.0 |
| Esol | -2.0721152 |
| Inchi | InChI=1S/C6H7NS/c7-5-3-1-2-4-6(5)8/h1-4,8H,7H2 |
| Smiles | C1=CC=C(C(=C1)N)S |
| Xlogp | 1.4 |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C6H7NS |
- 1. Outgoing r'ship
FOUND_INto/from Mimosa Pudica (Plant) Rel Props:Source_db:cmaup_ingredients