2-Methylheptan-3-ol
PubChem CID: 86781
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 2-Methyl-3-heptanol, 2-Methylheptan-3-ol, 18720-62-2, 3-Heptanol, 2-methyl-, 2-Methylheptanol-(3), EINECS 242-530-7, AI3-38064, NSC 244886, NSC244886, n-Butyl isopropyl carbinol, SCHEMBL109083, DTXSID701031073, MFCD00021938, AKOS009157728, NSC-244886, SB84301, NS00047398, 242-530-7 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 20.2 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Np Classifier Class | Fatty alcohols |
| Deep Smiles | CCCCCCC)C))O |
| Heavy Atom Count | 9.0 |
| Classyfire Class | Organooxygen compounds |
| Classyfire Subclass | Alcohols and polyols |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 59.6 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-methylheptan-3-ol |
| Nih Violation | False |
| Veber Rule | True |
| Classyfire Superclass | Organic oxygen compounds |
| Xlogp | 2.7 |
| Is Pains | False |
| Gsk 4 400 Rule | True |
| Molecular Formula | C8H18O |
| Inchi Key | QGVFLDUEHSIZIG-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 4.0 |
| Synonyms | 2-methylheptan-3-ol |
| Esol Class | Soluble |
| Functional Groups | CO |
| Compound Name | 2-Methylheptan-3-ol |
| Exact Mass | 130.136 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 130.136 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 130.229 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C8H18O/c1-4-5-6-8(9)7(2)3/h7-9H,4-6H2,1-3H3 |
| Smiles | CCCCC(C(C)C)O |
| Np Classifier Biosynthetic Pathway | Fatty acids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Fatty acyls |
- 1. Outgoing r'ship
FOUND_INto/from Curcuma Amada (Plant) Rel Props:Reference:ISBN:9770972795006