1-Naphthylamine
PubChem CID: 8640
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 1-NAPHTHYLAMINE, 1-Aminonaphthalene, 134-32-7, naphthalen-1-amine, 1-Naphthalenamine, alpha-Naphthylamine, Naphthalen-1-ylamine, Naphthalidine, Naphthalidam, 1-Naphthalamine, Fast Garnet Base B, 1-Naphthylamin, 1-Naftilamina, alpha-Aminonaphthalene, Alfanaftilamina, Fast Garnet B Base, 1-Aminonaftalen, 1-Naftylamine, 1-Naftylamin, Alfa-naftyloamina, RCRA waste number U167, .alpha.-Naphthylamine, alpha-Naftalamin, alpha-Naftylamin, C.I. Azoic Diazo Component 114, 1-Naftylamin [Czech], 1-Naftylamine [Dutch], 1-Aminonaftalen [Czech], 1-Naftilamina [Spanish], 1-Naphthylamin [German], Alfanaftilamina [Italian], alpha-Naftalamin [Czech], alpha-Naftylamin [Czech], alfa-Naftyloamina [Polish], CCRIS 423, .alpha.-Aminonaphthalene, CI Azoic Diazo Component 114, CHEBI:50450, 1-Naphthylamine, technical grade, 1-naphtylamine, HSDB 1080, EINECS 205-138-7, UN2077, BRN 0386133, CI 37265, DTXSID7020920, AI3-00085, C.I. 37265, 1-NAPHTHYLAMINE [MI], CHEMBL57394, DTXCID30920, 1-NAPHTHYLAMINE [HSDB], 1-NAPHTHYLAMINE [IARC], 9753I242R5, EC 205-138-7, 4-12-00-03009 (Beilstein Handbook Reference), MFCD00004016, 1-Naphthylamine-d7, 1-Naftylamin (Czech), Naphthalene, 1-amino-, alpha-Naftalamin (Czech), alpha Naphthylamine, 25168-10-9, 1-NAFTYLAMINE (DUTCH), 1-NAPHTHYLAMINE (IARC), 1-AMINONAFTALEN (CZECH), 1-NAFTILAMINA (SPANISH), 1-NAPHTHYLAMIN (GERMAN), ALPHA-NAFTYLAMIN (CZECH), ALFANAFTILAMINA (ITALIAN), ALFA-NAFTYLOAMINA (POLISH), Naphthaleneamine, 1-Naphthylamine, analytical standard, 1 Naphthylamine, 1 Aminonaphthalene, 8 Aminonaphthalene, 8-Aminonaphthalene, CAS-134-32-7, 1-NAPHYLAMINE, RCRA waste no. U167, alphaNaftalamin, alphaNaftylamin, 1naphthylamine, aminonaphthalene, naphthyl-amine, alfaNaftyloamina, 1Aminonaftalen, 1Naphthalamine, 1Naphthylamin, 1Naftilamina, 1Naftylamin, 1Naftylamine, 1-napthylamine, 1Naphthalenamine, 1aminonaphthalene, alphanaphthylamine, 1-aminonaphthalen, 1-naphthyl amine, 1-naphthaleneamine, UNII-9753I242R5, 1-amino napthalene, 1-naphthalenylamine, .alpha.-Naftalamin, .alpha.-Naftylamin, alphaAminonaphthalene, naphthalen-1-yl-amine, SCHEMBL9029, NAPHTHYLAMINE (ALPHA), 1Naphthylamine, technical grade, SCHEMBL7738276, SCHEMBL8059977, 1-Naphthylamine, >=99.0%, alpha-Naphthylamine (DOT:OSHA), 1-Naphthylamine, p.a., 99.0%, DDA83253, DDA83256, Nitrate Reagent A, for microbiology, Tox21_201233, Tox21_302805, BBL013044, BDBM50282489, STK301604, AKOS000119159, FN26153, UN 2077, NCGC00091092-01, NCGC00091092-02, NCGC00091092-03, NCGC00091092-04, NCGC00256472-01, NCGC00258785-01, AC-10635, AS-13623, alpha-Naphthylamine [UN2077] [Poison], DB-063020, N0052, N0165, NS00010844, EN300-18066, AB00443633-03, A806762, Q161655, Z57127984, F2190-0453, 1-Aminonaphthalene, Fast garnet base B, Naphthalen-1-ylamine, 205-138-7, 5I2 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 26.0 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CCC2CCCCC2C1 |
| Deep Smiles | Ncccccc6cccc6 |
| Heavy Atom Count | 11.0 |
| Classyfire Class | Naphthalenes |
| Scaffold Graph Node Level | C1CCC2CCCCC2C1 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 133.0 |
| Database Name | cmaup_ingredients;hmdb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | n.a., P02769, Q99714, P16473, P00352, P15428, P08684, P22309, Q9HAW8, P35503, P22310, P19224, Q9HAW7, O60656, Q9Y4X1, P54855, P35869, Q16236, P27695, Q9H7Z6, P10275, P19838, P05412 |
| Iupac Name | naphthalen-1-amine |
| Prediction Hob | 1.0 |
| Class | Naphthalenes |
| Veber Rule | True |
| Classyfire Superclass | Benzenoids |
| Target Id | NPT149, NPT210, NPT94, NPT151, NPT109, NPT2653 |
| Xlogp | 2.2 |
| Superclass | Benzenoids |
| Gsk 4 400 Rule | True |
| Molecular Formula | C10H9N |
| Scaffold Graph Node Bond Level | c1ccc2ccccc2c1 |
| Prediction Swissadme | 0.0 |
| Inchi Key | RUFPHBVGCFYCNW-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.0 |
| Logs | -2.733 |
| Rotatable Bond Count | 0.0 |
| Logd | 2.479 |
| Synonyms | 1-Aminonaphthalene, 1-Naftilamina, 1-Naphthalamine, 1-Naphthalenamine, 1-Naphthylamin, alpha-Aminonaphthalene, alpha-Naphthylamine, Naphthalen-1-ylamine, a-Aminonaphthalene, Α-aminonaphthalene, a-Naphthylamine, Α-naphthylamine, 1 Aminonaphthalene, 1 Naphthylamine, 8 Aminonaphthalene, 8-Aminonaphthalene, Naphthalidine, alpha Naphthylamine, α-naphthylamine |
| Esol Class | Soluble |
| Functional Groups | cN |
| Compound Name | 1-Naphthylamine |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 143.073 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 143.073 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 143.18 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Lipinski Rule Of 5 | True |
| Esol | -2.8179990727272726 |
| Inchi | InChI=1S/C10H9N/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H,11H2 |
| Smiles | C1=CC=C2C(=C1)C=CC=C2N |
| Nring | 2.0 |
| Np Classifier Biosynthetic Pathway | Shikimates and Phenylpropanoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | Naphthalenes |
- 1. Outgoing r'ship
FOUND_INto/from Capsicum Annuum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 2. Outgoing r'ship
FOUND_INto/from Plumbago Indica (Plant) Rel Props:Reference:ISBN:9788172361150