Uridine Diphosphate Glucose
PubChem CID: 8629
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | UDP-glucose, URIDINE DIPHOSPHATE GLUCOSE, 133-89-1, UDPG, UDP-alpha-D-Glucose, UDP-a-D-Glucose, co-waldenase, UDPglucose, URIDINE-5'-DIPHOSPHATE-GLUCOSE, co-galactoisomerase, Uridine diphosphoglucose, Cogalactoisomerase, UDP glucose, 5'-Diphosphoglucose, Uridine 5'-(trihydrogen diphosphate), mono-alpha-d-glucopyranosyl ester, URIDINE-5'-DIPHOSPHOGLUCOSE, Uridine diphospho-D-glucose, UDP-Glc, UNII-V50K1D7P4Y, Uridine pyrophosphate-glucose, Diphosphate Glucose, Uridine, Uridine 5'-diphosphoglucose, Uridine 5'-diphosphate glucose, V50K1D7P4Y, [[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] hydrogen phosphate, CHEBI:46229, EINECS 205-121-4, UDP-glucose Disodium Salt, Uridine 5'-diphospho-alpha-D-glucose, Uridine diphosphate-glucose, Uridine 5'-pyrophosphate glucose ester, DTXSID00157902, COGALACTOISOMERASE [WHO-DD], URIDINE DIPHOSPHATE GLUCOSE [MI], URIDINE DIPHOSPHATE GLUCOSE [WHO-DD], Uridine 5'-(alpha-D-glucopyranosyl pyrophosphate), GLUCOSE-URIDINE-C1,5'-DIPHOSPHATE, uridine 5'-[3-alpha-D-glucopyranosyl dihydrogen diphosphate], Uridine 5'-(trihydrogen diphosphate), P'-alpha-D-glucopyranosyl ester, URIDINE 5'-(TRIHYDROGEN DIPHOSPHATE), P'-.ALPHA.-D-GLUCOPYRANOSYL ESTER, Glucose, UDP, Diphosphoglucose, Uridine, Glucose, Uridine Diphosphate, uridine 5'-(3-alpha-D-glucopyranosyl dihydrogen diphosphate), (UDP)glucose, UDP-delta-glucose, (UPD)-glucose, (((2r,3s,4r,5r)-3,4-dihydroxy-5-(4-hydroxy-2-oxopyrimidin-1-yl)oxolan-2-yl)methoxy(hydroxy)phosphoryl)oxy(((3r,4s,5s,6r)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl)oxy)phosphinic acid, {[(2r,3s,4r,5r)-3,4-dihydroxy-5-(4-hydroxy-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy(hydroxy)phosphoryl}oxy([(3r,4s,5s,6r)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy)phosphinic acid, Uridindiphosphoglucose, Mono-D-glucosyl ester, UDP-alpha-delta-Glucose, 5''''-Diphosphoglucose, SCHEMBL454078, Uridine diphospho-delta-glucose, CHEMBL375951, GTPL1783, DTXCID8080393, Uridine-5''''-Diphosphoglucose, Uridine 5'-diphospho-a-D-glucose, URIDINE-5'-MONOPHOSPHATE GLUCOPYRANOSYL-MONOPHOSPHATE ESTER, Uridine 5-(trihydrogen diphosphate), BDBM50209659, BDBM50423218, Uridine 5'-diphospho-I+--D-glucose, AKOS040744389, URIDINE-5'-diphosphoric acid-glucose, DB01861, Uridine 5'-diphospho-alpha-delta-glucose, GLUCOSE-uridine-C1,5'-diphosphoric acid, C00029, G64794, Q424649, Uridine 5'-(I+--D-glucopyranosyl pyrophosphate), Uridine 5'-pyrophosphate a-D-glucopyranosyl ester, Uridine 5'-pyrophosphate a-delta-glucopyranosyl ester, uridine 5''-[3-alpha-D-glucopyranosyl dihydrogen diphosphate], Uridine 5'-(trihydrogen pyrophosphate), mono-D-glucosyl ester, Uridine 5'-(trihydrogen diphosphate) alpha-D-gucopyranosyl ester, Uridine 5'-(trihydrogen diphosphate), mono-a-d-glucopyranosyl ester, Uridine 5'-(trihydrogen diphosphate), p'-a-D-glucopyranosyl ester, Uridine 5'-(trihydrogen diphosphate), p'-I+--D-glucopyranosyl ester, Uridine 5'-pyrophosphate, alpha-D-glucopyranosyl ester (6CI,7CI), Uridine 5'-(trihydrogen diphosphate), mono-I+--D-glucopyranosyl ester, Uridine 5'-(trihydrogen diphosphate), P'-a-D-glucopyranosyl ester (9CI), Uridine 5'-(trihydrogen diphosphoric acid), mono-a-D-glucopyranosyl ester, Uridine 5'-(trihydrogen diphosphoric acid), mono-I+--D-glucopyranosyl ester, Uridine 5'-(trihydrogen diphosphoric acid), p'-a-D-glucopyranosyl ester, Uridine 5'-(trihydrogen diphosphoric acid), p'-alpha-D-glucopyranosyl ester, Uridine 5'-(trihydrogen diphosphoric acid), p'-I+--D-glucopyranosyl ester, Uridine 5/'-(trihydrogen diphosphate), mono-alpha-d-glucopyranosyl ester, URIDINE 5'-(TRIHYDROGEN DIPHOSPHATE), P'-.ALPHA.-D- GLUCOPYRANOSYL ESTER, Uridine 5'-(trihydrogen diphosphoric acid), mono-alpha-D-glucopyranosyl ester, Uridine 5'-(trihydrogen pyrophosphate), mono-alpha-D-glucopyranosyl ester (8CI), [(2R,3S,4R,5R)-5-(2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)-3,4-dihydroxytetrahydrofuran-2-yl]methyl (2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl dihydrogen diphosphate (non-preferred name) |
|---|---|
| Topological Polar Surface Area | 292.0 |
| Hydrogen Bond Donor Count | 9.0 |
| Heavy Atom Count | 36.0 |
| Description | A key intermediate in carbohydrate metabolism. Serves as a precursor of glycogen, can be metabolized into UDPgalactose and UDPglucuronic acid which can then be incorporated into polysaccharides as galactose and glucuronic acidand is also serves as a precursor of sucrose lipopolysaccharides, and glycosphingolipids., It is a precursor of glycogen and can be converted into UDP-galactose and UDP-glucuronic acid, which can then be used as substrates by the enzymes that make polysaccharides containing galactose and glucuronic acid., Uridine diphosphate glucose (uracil-diphosphate glucose, UDP-glucose) is a nucleotide sugar. It is involved in glycosyltransferase reactions in metabolism. Udp-glucose is found in many foods, some of which are skunk currant, black salsify, winter squash, and red algae. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 964.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 9.0 |
| Uniprot Id | P22413, O14638, P14410, O43280, O60568, Q16739, Q14376, O60701, Q9Y673, Q16851, P54840, P07902, P46976, P13807, O15488, O95848, Q15391, Q15077, P41231 |
| Iupac Name | [[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] hydrogen phosphate |
| Prediction Hob | 0.0 |
| Class | Pyrimidine nucleotides |
| Target Id | NPT4712, NPT1391, NPT3826 |
| Xlogp | -6.3 |
| Superclass | Nucleosides, nucleotides, and analogues |
| Subclass | Pyrimidine nucleotide sugars |
| Molecular Formula | C15H24N2O17P2 |
| Prediction Swissadme | 0.0 |
| Inchi Key | HSCJRCZFDFQWRP-JZMIEXBBSA-N |
| Fcsp3 | 0.7333333333333333 |
| Logs | 0.206 |
| Rotatable Bond Count | 9.0 |
| State | Solid |
| Logd | -2.527 |
| Synonyms | Udp glucose, Udp-d-glucose, Udp-delta-glucose, Udp-GLC, UDPG, UPG, Uridine 5'-(alpha-D-glucopyranosyl pyrophosphate), Uridine 5'-diphosphate glucose, Uridine 5'-diphospho-a-D-glucose, Uridine 5'-diphospho-alpha-D-glucose, Uridine 5'-diphospho-alpha-delta-glucose, Uridine 5'-diphosphoglucose, Uridine 5'-pyrophosphate a-D-glucopyranosyl ester, Uridine 5'-pyrophosphate a-delta-glucopyranosyl ester, Uridine diphosphate glucose, Uridine diphospho-d-glucose, Uridine diphospho-delta-glucose, Uridine diphosphoglucose, Uridine pyrophosphate-glucose, GLUCOSE-uridine-C1,5'-diphosphATE, UDP-D-Glucose, UDPglucose, URIDINE-5'-diphosphATE-glucose, UDP-alpha-D-Glucose, GLUCOSE-uridine-C1,5'-diphosphoric acid, URIDINE-5'-diphosphoric acid-glucose, UDP-a-D-Glucose, UDP-Α-D-glucose, Uridine diphosphoric acid glucose, Diphosphate glucose, uridine, Diphosphoglucose, uridine, Glucose, UDP, Glucose, uridine diphosphate, UDP Glucose, UDP-GLC, UDP-Glucose, Uridine 5'-(α-D-glucopyranosyl pyrophosphate), Uridine 5'-diphospho-α-D-glucose, Uridine 5’-(α-D-glucopyranosyl pyrophosphate), Uridine 5’-diphosphate glucose, Uridine 5’-diphospho-α-D-glucose, Uridine 5’-diphosphoglucose, Uridine diphospho-D-glucose |
| Compound Name | Uridine Diphosphate Glucose |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 566.055 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 566.055 |
| Hydrogen Bond Acceptor Count | 17.0 |
| Molecular Weight | 566.3 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 9.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Esol | 0.338894266666665 |
| Inchi | InChI=1S/C15H24N2O17P2/c18-3-5-8(20)10(22)12(24)14(32-5)33-36(28,29)34-35(26,27)30-4-6-9(21)11(23)13(31-6)17-2-1-7(19)16-15(17)25/h1-2,5-6,8-14,18,20-24H,3-4H2,(H,26,27)(H,28,29)(H,16,19,25)/t5-,6-,8-,9-,10+,11-,12-,13-,14-/m1/s1 |
| Smiles | C1=CN(C(=O)NC1=O)[C@H]2[C@@H]([C@@H]([C@H](O2)COP(=O)(O)OP(=O)(O)O[C@@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O)O |
| Nring | 3.0 |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | Pyrimidine nucleotide sugars |
- 1. Outgoing r'ship
FOUND_INto/from Arabidopsis Thaliana (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 2. Outgoing r'ship
FOUND_INto/from Glycine Max (Plant) Rel Props:Source_db:fooddb_chem_all