7H-Furo3,2-g1benzopyran-7-one, 3-methoxy-2-(1-methylethyl)-
PubChem CID: 8616
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Peucedanin, 133-26-6, Oreoselone methyl ether, Peutsedin, 4-Methoxy-5-isopropylfuro(2,3:6,7)coumarin, BRN 0234473, 3-methoxy-2-propan-2-ylfuro[3,2-g]chromen-7-one, 3-Methoxy-2-(1-methylethyl)-7H-furo(3,2-g)(1)benzopyran-7-one, CHEBI:8034, 7H-Furo[3,2-g][1]benzopyran-7-one, 3-methoxy-2-(1-methylethyl)-, N021633LOB, 6-Hydroxy-2-isopropyl-3-methoxy-5-benzofuranacrylic acid delta-lactone, 2-isopropyl-3-methoxy-7H-furo[3,2-g]chromen-7-one, 3-methoxy-2-(propan-2-yl)-7H-furo[3,2-g]chromen-7-one, 7H-Furo3,2-g1benzopyran-7-one, 3-methoxy-2-(1-methylethyl)-, UNII-N021633LOB, 7H-Furo(3,2-g)(1)benzopyran-7-one, 3-methoxy-2-(1-methylethyl)-, Spectrum_001546, PEUCEDANIN [MI], SpecPlus_000952, Spectrum2_000729, Spectrum3_001647, Spectrum4_001666, Spectrum5_000571, 5-Benzofuranacrylic acid, 6-hydroxy-2-isopropyl-3-methoxy-, delta-lactone, Oprea1_190644, Oprea1_837278, BSPBio_003373, KBioGR_002191, KBioSS_002026, 5-19-06-00042 (Beilstein Handbook Reference), MLS001049116, DivK1c_007048, SPECTRUM1504168, SPBio_000658, MEGxp0_001552, SCHEMBL2249089, CHEMBL1410943, KBio1_001992, KBio2_002026, KBio2_004594, KBio2_007162, KBio3_002593, YQBNJPACAUPNLV-UHFFFAOYSA-, DTXSID10157897, YQBNJPACAUPNLV-UHFFFAOYSA-N, HMS2675C08, 7H-FURO(3,2-g)(1)BENZOPYRAN-7-ONE, 2-ISOPROPYL-3-METHOXY-, CCG-40070, STK396320, AKOS000278122, SDCCGMLS-0066802.P001, NCGC00095695-01, NCGC00095695-02, SMR000102964, CL-381982, NS00094618, C09283, AB00053108-02, 2-isopropyl-3-methoxy-furo[3,2-g]chromen-7-one, AG-690/12763027, BRD-K72034655-001-02-1, Q27107645, 6-HYDROXY-2-ISOPROPYL-3-METHOXY-5-BENZOFURANACRYLIC ACID .GAMMA.-LACTONE, InChI=1/C15H14O4/c1-8(2)14-15(17-3)10-6-9-4-5-13(16)18-11(9)7-12(10)19-14/h4-8H,1-3H3 |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 48.7 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1CCC2CC3CCCC3CC2C1 |
| Np Classifier Class | Furocoumarins, Simple coumarins |
| Deep Smiles | COccocc5ccccc=O)oc6c%10)))))))))))CC)C |
| Heavy Atom Count | 19.0 |
| Classyfire Class | Coumarins and derivatives |
| Description | Peucedanin, also known as 2-isopropyl-3-methoxy-7h-furo[3,2-g]chromen-7-one or 4-methoxy-5-isopropylfuro(2,3:6,7)coumarin, is a member of the class of compounds known as psoralens. Psoralens are organic compounds containing a psoralen moiety, which consists of a furan fused to a chromenone to for 7H-furo[3,2-g]chromen-7-one. Peucedanin is practically insoluble (in water) and an extremely weak basic (essentially neutral) compound (based on its pKa). Peucedanin can be found in carrot, chervil, and wild carrot, which makes peucedanin a potential biomarker for the consumption of these food products. |
| Scaffold Graph Node Level | OC1CCC2CC3CCOC3CC2O1 |
| Classyfire Subclass | Furanocoumarins |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 390.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | Q99714, B2RXH2, P00352, P00811, O15118, Q96KQ7, Q9UIF8, Q96QE3, O95149, P84022, O94782, P17405, Q9NPD5, Q9Y6L6, n.a. |
| Iupac Name | 3-methoxy-2-propan-2-ylfuro[3,2-g]chromen-7-one |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Veber Rule | True |
| Classyfire Superclass | Phenylpropanoids and polyketides |
| Target Id | NPT149, NPT48, NPT94, NPT538 |
| Xlogp | 3.4 |
| Is Pains | False |
| Gsk 4 400 Rule | True |
| Molecular Formula | C15H14O4 |
| Scaffold Graph Node Bond Level | O=c1ccc2cc3ccoc3cc2o1 |
| Prediction Swissadme | 1.0 |
| Inchi Key | YQBNJPACAUPNLV-UHFFFAOYSA-N |
| Silicos It Class | Moderately soluble |
| Fcsp3 | 0.2666666666666666 |
| Logs | -5.046 |
| Rotatable Bond Count | 2.0 |
| Logd | 3.307 |
| Synonyms | 3-Methoxy-2-(propan-2-yl)-7H-furo[3,2-g]chromen-7-one, 4-Methoxy-5-isopropylfuro(2,3:6,7)coumarin, 7H-Furo(3,2-g)(1)benzopyran-7-one, 2-isopropyl-3-methoxy-, Oreoselone methyl ether, Peutsedin, peucedanin |
| Esol Class | Soluble |
| Functional Groups | c=O, cOC, coc |
| Compound Name | 7H-Furo3,2-g1benzopyran-7-one, 3-methoxy-2-(1-methylethyl)- |
| Prediction Hob Swissadme | 1.0 |
| Exact Mass | 258.089 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 258.089 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 258.269 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | -2.924408389473683 |
| Inchi | InChI=1S/C15H14O4/c1-8(2)14-15(17-3)10-6-9-4-5-13(16)18-11(9)7-12(10)19-14/h4-8H,1-3H3 |
| Smiles | CC(C)C1=C(C2=C(O1)C=C3C(=C2)C=CC(=O)O3)OC |
| Nring | 3.0 |
| Np Classifier Biosynthetic Pathway | Shikimates and Phenylpropanoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Coumarins |
- 1. Outgoing r'ship
FOUND_INto/from Angelica Decursiva (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 2. Outgoing r'ship
FOUND_INto/from Anthriscus Cerefolium (Plant) Rel Props:Source_db:cmaup_ingredients;fooddb_chem_all;npass_chem_all - 3. Outgoing r'ship
FOUND_INto/from Cotinus Coggygria (Plant) Rel Props:Source_db:npass_chem_all - 4. Outgoing r'ship
FOUND_INto/from Daucus Carota (Plant) Rel Props:Source_db:cmaup_ingredients;fooddb_chem_all;npass_chem_all - 5. Outgoing r'ship
FOUND_INto/from Lythrum Salicaria (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 6. Outgoing r'ship
FOUND_INto/from Myrrhis Odorata (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 7. Outgoing r'ship
FOUND_INto/from Peucedanum Morisonii (Plant) Rel Props:Source_db:npass_chem_all - 8. Outgoing r'ship
FOUND_INto/from Peucedanum Officinale (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 9. Outgoing r'ship
FOUND_INto/from Peucedanum Ruthenicum (Plant) Rel Props:Source_db:npass_chem_all - 10. Outgoing r'ship
FOUND_INto/from Peucedanum Stenocarpum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 11. Outgoing r'ship
FOUND_INto/from Phaseolus Vulgaris (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 12. Outgoing r'ship
FOUND_INto/from Prangos Pabularia (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all