(+)-Xylose
PubChem CID: 854
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | DL-Arabinose, 2,3,4,5-Tetrahydroxypentanal, 147-81-9, 9000-69-5, 20235-19-2, dl-Lyxose, Pectin (Technical Grade), 1949-78-6, 41247-05-6, 58-86-6, 53106-52-8, 25990-60-7, 1114-34-7, (+)-Xylose, NSC1941, Lyxose, D-, D-arabinose-5-13C, D-(-)-Lyxose, Citrus pectin, Pectinose, methoxy pectin, Amidated pectin, d(-)-ribose, calcium pectinate, Ribose, D-, Xylose, D-, (+/-)-Arabinose, DL-Arabinose, dl-Arabinose, Aldopentoses, (+/-)-Xylos, Methoxyl Pectin, MFCD00135866, MFCD00151475, NSC-224430, Pectin from apple, Pentose #, D-(+)-Xylose, (+)-Xylose, Wood sugar, Pectin from citrus, 139657-60-6, D-(?)-Arabinose, ARABINOSE (L), SCHEMBL10944, CHEBI:143528, D(-)-Ribose, from Plant Origin, HMS3651O12, CDA58392, FAA32837, NLA84687, NLA84688, NSC26213, PFA65760, NSC122762, NSC224430, STL509322, 2,3,4,5-tetrakis(oxidanyl)pentanal, WLN: T6OTJ BQ CQ DQ EQ -L, AKOS006227855, AKOS016370670, AS-56403, DA-76681, SY037132, SY038268, SY052562, SY056700, SY073917, YA158357, DB-040974, DB-044879, DB-051824, DB-053735, EN300-81509, A825486, D10C5F52-39AD-444C-B154-00E9820D8754, 243-619-3 |
|---|---|
| Topological Polar Surface Area | 98.0 |
| Hydrogen Bond Donor Count | 4.0 |
| Heavy Atom Count | 10.0 |
| Description | A pentose is a monosaccharide with five carbon atoms. Pentoses are organized into two groups. Aldopentoses have an aldehyde functional group at position 1. Ketopentoses have a ketone functional group in position 2 or 3. Pentoses is found in flaxseed and cocoa bean. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 104.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2,3,4,5-tetrahydroxypentanal |
| Prediction Hob | 1.0 |
| Class | Organooxygen compounds |
| Xlogp | -2.3 |
| Superclass | Organic oxygen compounds |
| Subclass | Carbohydrates and carbohydrate conjugates |
| Molecular Formula | C5H10O5 |
| Prediction Swissadme | 0.0 |
| Inchi Key | PYMYPHUHKUWMLA-UHFFFAOYSA-N |
| Fcsp3 | 0.8 |
| Logs | -4.897 |
| Rotatable Bond Count | 4.0 |
| Logd | 4.455 |
| Synonyms | Pentose, Methoxypectin, Pectinic acid, Calcium pectinate, Pectin, Methoxy pectin, Methoxylpectin, Zinc pectinate, Pectin, methoxy, Pectinate, calcium, Pectinate, zinc, Pectins, Citrus pectin |
| Compound Name | (+)-Xylose |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 150.053 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 150.053 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 150.13 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 3.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic acyclic compounds |
| Esol | 0.954794 |
| Inchi | InChI=1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h1,3-5,7-10H,2H2 |
| Smiles | C(C(C(C(C=O)O)O)O)O |
| Nring | 3.0 |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | Pentoses |
- 1. Outgoing r'ship
FOUND_INto/from Allium Chinense (Plant) Rel Props:Source_db:cmaup_ingredients - 2. Outgoing r'ship
FOUND_INto/from Allium Macrostemon (Plant) Rel Props:Source_db:cmaup_ingredients - 3. Outgoing r'ship
FOUND_INto/from Bupleurum Chinense (Plant) Rel Props:Source_db:cmaup_ingredients - 4. Outgoing r'ship
FOUND_INto/from Bupleurum Falcatum (Plant) Rel Props:Source_db:cmaup_ingredients - 5. Outgoing r'ship
FOUND_INto/from Bupleurum Scorzonerifolium (Plant) Rel Props:Source_db:cmaup_ingredients - 6. Outgoing r'ship
FOUND_INto/from Linum Usitatissimum (Plant) Rel Props:Source_db:cmaup_ingredients;fooddb_chem_all - 7. Outgoing r'ship
FOUND_INto/from Neopicrorhiza Scrophulariiflora (Plant) Rel Props:Source_db:cmaup_ingredients - 8. Outgoing r'ship
FOUND_INto/from Picrorhiza Kurrooa (Plant) Rel Props:Source_db:cmaup_ingredients - 9. Outgoing r'ship
FOUND_INto/from Rubia Akane (Plant) Rel Props:Source_db:cmaup_ingredients - 10. Outgoing r'ship
FOUND_INto/from Theobroma Cacao (Plant) Rel Props:Source_db:fooddb_chem_all