2-Amino-3-selanylpropanoic acid
PubChem CID: 851
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 2-amino-3-selanylpropanoic acid, CID 851, 3-selanylalanine, DTXSID90863222, ZKZBPNGNEQAJSX-UHFFFAOYSA-N, Q28529717 |
|---|---|
| Topological Polar Surface Area | 63.3 |
| Hydrogen Bond Donor Count | 2.0 |
| Heavy Atom Count | 7.0 |
| Pathway Kegg Map Id | map00450 |
| Description | Formed by seleniferous plants, e.g. onion, cabbage Amino Acids, Sulfur, A naturally occurring amino acid in both eukaryotic and prokaryotic organisms. It is found in tRNAs and in the catalytic site of some enzymes. The genes for glutathione peroxidase and formate dehydrogenase contain the TGA codon, which codes for this amino acid. -- Pubchem, Selenocysteine is an amino acid that is present in several enzymes (for example glutathione peroxidases, tetraiodothyronine 5' deiodinases, thioredoxin reductases, formate dehydrogenases, glycine reductases and some hydrogenases)., Selenocysteine is an amino acid that is present in several enzymes (for example glutathione peroxidases, tetraiodothyronine 5' deiodinases, thioredoxin reductases, formate dehydrogenases, glycine reductases and some hydrogenases). Selenocysteine has a structure similar to cysteine, but with an atom of selenium taking the place of the usual sulfur. Proteins that include a selenocysteine residue are called selenoproteins. -- Wikipedia |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 75.3 |
| Database Name | fooddb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Enzyme Uniprot Id | P32929, Q99611, P07203, P36969, P22352, P18283, P49895, Q92813, Q96I15, Q9HD40, Q8NHP1, Q9NZV6 |
| Iupac Name | 2-amino-3-selanylpropanoic acid |
| Nih Violation | True |
| Class | Carboxylic acids and derivatives |
| Superclass | Organic acids and derivatives |
| Is Pains | False |
| Subclass | Amino acids, peptides, and analogues |
| Molecular Formula | C3H7NO2Se |
| Inchi Key | ZKZBPNGNEQAJSX-UHFFFAOYSA-N |
| Rotatable Bond Count | 2.0 |
| State | Solid |
| Synonyms | (2R)-2-amino-3-selanylpropanoate, (2R)-2-amino-3-selanylpropanoic acid, 2-Amino-3-selenylpropanoic acid, 3-seleno-alanine, 3-Selenoalanine, 3-Selenyl-DL-alanine, 3-selenyl-L-Alanine, 3-Selenylalanine, 9CI, 8CI, Alanine, 3-seleno-, DL-selenocysteine, L-Alanine, 3-selenyl-, L-selenocystein, L-selenocysteine, L-selenozystein, Seleno-(DL)-cysteine |
| Substituent Name | L-alpha-amino acid, Monocarboxylic acid or derivatives, Carboxylic acid, Hydrocarbon derivative, Selenol, Primary amine, Organoselenium compound, Organooxygen compound, Organonitrogen compound, Primary aliphatic amine, Carbonyl group, Amine, Aliphatic acyclic compound |
| Compound Name | 2-Amino-3-selanylpropanoic acid |
| Kingdom | Organic compounds |
| Exact Mass | 168.964 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 168.964 |
| Hydrogen Bond Acceptor Count | 3.0 |
| Molecular Weight | 168.06 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C3H7NO2Se/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6) |
| Smiles | C(C(C(=O)O)N)[SeH] |
| Defined Bond Stereocenter Count | 0.0 |
- 1. Outgoing r'ship
FOUND_INto/from Vigna Radiata (Plant) Rel Props:Source_db:fooddb_chem_all