2-Amino-5-[(1-carboxy-2-sulfanylethyl)amino]-5-oxopentanoic acid
PubChem CID: 842
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 686-58-8, 2-amino-5-[(1-carboxy-2-sulfanylethyl)amino]-5-oxopentanoic acid, N5-(1-Carboxy-2-mercaptoethyl)glutamine, GAMMA-GLU-CYS TRIFLUOROACETATE SALT, 857793-65-8, N-gamma-Glutamylcysteine, SCHEMBL121500, (Des-Gly)-Glutathione (reduced) ammonium salt, CERAPP_28431, DTXSID70862334, CHEBI:181725, GAMMA-GLU-CYSTRIFLUOROACETATESALT, 2-amino-5-[(1-carboxy-2-sulanylethyl)amino]-5-oxopentanoic acid |
|---|---|
| Topological Polar Surface Area | 131.0 |
| Hydrogen Bond Donor Count | 5.0 |
| Inchi Key | RITKHVBHSGLULN-UHFFFAOYSA-N |
| Rotatable Bond Count | 7.0 |
| Synonyms | N-g-Glutamylcysteine, N-g-Glutamylcysteine, L-L-form, N-gamma-Glutamylcysteine |
| Heavy Atom Count | 16.0 |
| Compound Name | 2-Amino-5-[(1-carboxy-2-sulfanylethyl)amino]-5-oxopentanoic acid |
| Description | γ-L-Glutamyl-L-cysteine (also known as γ-glutamylcysteine) is a precursor of glutathione. It is formed by glutamate—cysteine ligase and used by glutathione synthetase to form glutathione . N-gamma-glutamylcysteine is a member of the class of compounds known as dipeptides. Dipeptides are organic compounds containing a sequence of exactly two alpha-amino acids joined by a peptide bond. N-gamma-glutamylcysteine is slightly soluble (in water) and a moderately acidic compound (based on its pKa). N-gamma-glutamylcysteine can be found in garden onion, which makes N-gamma-glutamylcysteine a potential biomarker for the consumption of this food product. |
| Exact Mass | 250.062 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 250.062 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 284.0 |
| Hydrogen Bond Acceptor Count | 7.0 |
| Molecular Weight | 250.27 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-amino-5-[(1-carboxy-2-sulfanylethyl)amino]-5-oxopentanoic acid |
| Total Atom Stereocenter Count | 2.0 |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C8H14N2O5S/c9-4(7(12)13)1-2-6(11)10-5(3-16)8(14)15/h4-5,16H,1-3,9H2,(H,10,11)(H,12,13)(H,14,15) |
| Smiles | C(CC(=O)NC(CS)C(=O)O)C(C(=O)O)N |
| Xlogp | -3.8 |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C8H14N2O5S |
- 1. Outgoing r'ship
FOUND_INto/from Allium Cepa (Plant) Rel Props:Source_db:fooddb_chem_all