4-Hydroxyproline
PubChem CID: 825
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 4-hydroxypyrrolidine-2-carboxylic acid, 4-hydroxyproline, 6912-67-0, MFCD00064319, 18610-59-8, trans-L-4-hydroxyproline, 25249-07-4, CHEBI:20392, MFCD00066718, 4-Hydroxy-L-proline, 30724-02-8, 49761-17-3, Proline, 4-hydroxy-, L-Proline, 4-hydroxy-, labeled with tritium, trans-, cis-Hydroxyproline, L-Allohydroxyproline, D-cis-Hydroxyproline, allo-L-Hydroxyproline, L-Proline, allo-hydroxy-, 147028-80-6, L-Hydroxyprolin, MFCD00064320, D-Proline, cis-, L-Proline, cis-, 4Hyp, 4-Hydroxyproline #, (2S)-4-hydroxy-2-pyrrolidinecarboxylic acid, 4-Hydroxy-DL-proline, Cis -4-hydroxy-L-proline, SCHEMBL22792, Trans- 4-hydroxy -D-proline, CIS-D-4-HYDROXYPROLINE, CHEMBL1213475, DTXSID60861573, Pyrrolidin-4-ol-2-carboxylic acid, ALBB-006175, BCP00339, 4-hydroxypyrrolidine-2-carboxylicacid, BBL001541, NSC122285, NSC206273, NSC206274, NSC206304, NSC524341, STK503752, AKOS000120765, AKOS016341054, AB00391, AB02585, MB00510, NSC-122285, NSC-206273, NSC-206304, NSC-524341, PB47459, PS-6137, 4-hydroxy-pyrrolidine-2-carboxylic acid, 2-Pyrrolidinecarboxylic acid, 4-hydroxy-, NCI60_001735, SY003829, SY003831, SY009610, SY009611, SY020782, DB-014737, A7577, CS-0454925, NS00013764, trans-L-4-Hydroxyproline, Non-animal origin, EN300-17169, E88341, Q411237, 4-Hydroxypyrrolidine-2-carboxylic acid, AldrichCPR, BRD-A12454076-001-01-9, F2191-0189, 45180CC6-3061-475A-BA9E-E0160C6D1450 |
|---|---|
| Topological Polar Surface Area | 69.6 |
| Hydrogen Bond Donor Count | 3.0 |
| Heavy Atom Count | 9.0 |
| Description | Constituent of proteins [DFC]. 4-hydroxyproline is a biomarker for the consumption of processed meat . 4-Hydroxyproline is found in many foods, some of which are parsnip, ginger, chinese cinnamon, and garlic. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 125.0 |
| Database Name | fooddb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Enzyme Uniprot Id | O15460, P13674, P27487, Q7Z4N8, Q9GZT9, Q96KS0, Q9H6Z9, Q9NXG6 |
| Iupac Name | 4-hydroxypyrrolidine-2-carboxylic acid |
| Nih Violation | False |
| Class | Carboxylic acids and derivatives |
| Xlogp | -3.3 |
| Superclass | Organic acids and derivatives |
| Is Pains | False |
| Subclass | Amino acids, peptides, and analogues |
| Molecular Formula | C5H9NO3 |
| Inchi Key | PMMYEEVYMWASQN-UHFFFAOYSA-N |
| Rotatable Bond Count | 1.0 |
| State | Solid |
| Synonyms | (2S,4R)-4-Hydroxy-2-pyrrolidinecarboxylate, (2S,4R)-4-Hydroxy-2-pyrrolidinecarboxylic acid, (2S,4R)-4-Hydroxypyrrolidine-2-carboxylic acid, (2S,4R)-trans-4-Hydroxyproline, (4R)-4-Hydroxy-L-proline, 4-Hydroxy-2-pyrrolidinecarboxylic acid, 4-Hydroxy-L-proline, 4-Hydroxyproline, 4-L-Hydroxyproline, delta-Hydroxyproline, Hydroxiproline, Hydroxy-L-proline, Hydroxy-proline, Hydroxyproline, Hypro, L-4-Hydroxyproline, L-Hydroxyproline, L-threo-4-Hydroxyproline, L-trans-4-Hydroxyproline, LS-hydroxyproline, Oxaceprol, trans-4-Hydroxy-L-proline, trans-4-Hydroxyproline, trans-Hydroxyproline, trans-L-Hydroxyproline, δ-hydroxyproline |
| Substituent Name | L-alpha-amino acid, Pyrrolidine carboxylic acid or derivatives, Pyrrolidine carboxylic acid, Pyrrolidine, Secondary alcohol, 1,2-aminoalcohol, Azacycle, Organoheterocyclic compound, Secondary amine, Monocarboxylic acid or derivatives, Secondary aliphatic amine, Carboxylic acid, Hydrocarbon derivative, Organooxygen compound, Organonitrogen compound, Carbonyl group, Amine, Alcohol, Aliphatic heteromonocyclic compound |
| Compound Name | 4-Hydroxyproline |
| Kingdom | Organic compounds |
| Exact Mass | 131.058 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 131.058 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 131.13 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 2.0 |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C5H9NO3/c7-3-1-4(5(8)9)6-2-3/h3-4,6-7H,1-2H2,(H,8,9) |
| Smiles | C1C(CNC1C(=O)O)O |
| Defined Bond Stereocenter Count | 0.0 |
- 1. Outgoing r'ship
FOUND_INto/from Allium Ampeloprasum (Plant) Rel Props:Source_db:fooddb_chem_all - 2. Outgoing r'ship
FOUND_INto/from Borago Officinalis (Plant) Rel Props:Source_db:fooddb_chem_all - 3. Outgoing r'ship
FOUND_INto/from Ceratonia Siliqua (Plant) Rel Props:Source_db:fooddb_chem_all - 4. Outgoing r'ship
FOUND_INto/from Citrullus Lanatus (Plant) Rel Props:Source_db:fooddb_chem_all - 5. Outgoing r'ship
FOUND_INto/from Citrus Sinensis (Plant) Rel Props:Source_db:fooddb_chem_all - 6. Outgoing r'ship
FOUND_INto/from Cocos Nucifera (Plant) Rel Props:Source_db:fooddb_chem_all - 7. Outgoing r'ship
FOUND_INto/from Daucus Carota (Plant) Rel Props:Source_db:fooddb_chem_all