DL-norvaline
PubChem CID: 824
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | DL-NORVALINE, 760-78-1, 2-Aminopentanoic acid, H-DL-Nva-OH, 2-Aminovaleric acid, Norvaline, DL-, DL-2-Aminopentanoic acid, (+-)-Norvaline, norvalines, DL-2-Aminovaleric Acid, DL-alpha-Aminovaleric acid, NSC 7904, V639KTF2SZ, MFCD00064420, DL-.alpha.-Aminovaleric acid, (+/-)-2-Aminopentanoic acid, .alpha.-DL-Aminopentanoic acid, Valeric acid, 2-amino-, DL-, alpha-aminopentanoic acid, NSC-7904, alpha-DL-Aminopentanoic acid, EINECS 212-082-7, AI3-18299, CHEBI:19475, DTXSID00862403, 2-aminovalerate, 2-aminopentanoate, 2-aminovalerianic acid, alpha-amino-N-valerate, NVA, alpha-amino-N-valeric acid, alpha-Aminovaleric acid, (.+-.)-Norvaline, (.+/-.)-Norvaline, UNII-V639KTF2SZ, DL-2-Aminovaleric acid, a-DL-Aminopentanoic acid, Norvaline, d,l-norvaline, d,1-norvaline, aminopentanoic acid, 2-Aminopentanoicacid, Valeric acid, DL-, 2-azaniumylpentanoate, DL2Aminopentanoic acid, DL-Norvaline, 99%, DLalphaAminovaleric acid, DL-Norvaline (Standard), alphaDLAminopentanoic acid, .alpha.-Aminovaleric acid, Valeric acid, 2amino, DL, (+/-)-NORVALINE, n-C3H7CH(NH2)COOH, SCHEMBL38404, .alpha.-L-Aminopentanoic acid, NORVALINE DL-FORM [MI], dl-.alpha.-Amino-N-valenic acid, DTXCID20811175, NSC7904, DL-Norvaline, analytical standard, HY-W010510R, NSC203786, s6334, STL182827, AKOS000173771, AKOS016050510, AB00929, AB02603, CS-W011226, FN10009, HY-W010510, AC-24060, AS-56356, SY001938, SY019949, SY035722, DB-045105, DB-056021, L(+)-Norvaline, L(+)-2-Aminovaleric acid, N0304, NS00080182, EN300-43623, D70899, Q27109182, 2F45875A-22E8-42D3-AAC2-FDF2B9FF233D, Z317024724, 212-082-7 |
|---|---|
| Prediction Swissadme | 0.0 |
| Topological Polar Surface Area | 63.3 |
| Hydrogen Bond Donor Count | 2.0 |
| Inchi Key | SNDPXSYFESPGGJ-UHFFFAOYSA-N |
| Fcsp3 | 0.8 |
| Rotatable Bond Count | 3.0 |
| Synonyms | (2S)-2-aminopentanoic acid, (S)-(+)-2-Aminopentanoic acid, (S)-2-Aminopentanoic acid, (S)-2-Aminovaleric acid, &alpha, -aminovaleric acid, &alpha, -l-aminopentanoic acid, 2-AMINO-PENTANOIC ACID, 2-Aminopentanoic acid, 2-Aminovaleric acid, Alpha-l-aminopentanoic acid, L-2-Aminopentanoic acid, L-2-Aminovaleric acid, L-norvaline, L-Norvaline (9CI), Norvaline (van), Norvaline, l-, NVA, Pentanoic acid, 2-amino-, Pentanoic acid, 2-amino-, (S)-, RON, Valeric acid, 2-amino- |
| Heavy Atom Count | 8.0 |
| Compound Name | DL-norvaline |
| Description | Norvaline, also known as alpha-aminovaleric acid or A-aminovalerate, is a member of the class of compounds known as alpha amino acids. Alpha amino acids are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon). Norvaline is soluble (in water) and a moderately acidic compound (based on its pKa). Norvaline can be synthesized from valeric acid. Norvaline can also be synthesized into 3-hydroxynorvaline and 2-amino-5-phosphonopentanoic acid. Norvaline can be found in blackcurrant and common buckwheat, which makes norvaline a potential biomarker for the consumption of these food products. Norvaline (abbreviated as Nva) is an amino acid with the formula CH3(CH2)2CH(NH2)CO2H. The compound is an isomer of the more common amino acid valine. Like most other α-amino acids, norvaline is chiral. It is a white, water-soluble solid . |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 117.079 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 117.079 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 82.5 |
| Hydrogen Bond Acceptor Count | 3.0 |
| Molecular Weight | 117.15 |
| Database Name | cmaup_ingredients;fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-aminopentanoic acid |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Prediction Hob | 1.0 |
| Esol | 0.9609824 |
| Inchi | InChI=1S/C5H11NO2/c1-2-3-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8) |
| Smiles | CCCC(C(=O)O)N |
| Xlogp | -2.1 |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C5H11NO2 |
- 1. Outgoing r'ship
FOUND_INto/from Fagopyrum Esculentum (Plant) Rel Props:Source_db:fooddb_chem_all - 2. Outgoing r'ship
FOUND_INto/from Ribes Nigrum (Plant) Rel Props:Source_db:cmaup_ingredients;fooddb_chem_all