Ergotamine
PubChem CID: 8223
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | ERGOTAMINE, Ergotamin, Gynergen, Ergonsvine, Ergotamina, Ergostat, ergotamine tartrate, ergotaminum, Ergomar, 113-15-5, Ergotaminum [INN-Latin], Ergotamina [INN-Spanish], Rigetamin, HSDB 4076, 12'-Hydroxy-2'-methyl-5'alpha-(phenylmethyl)ergotaman-3',6',18-trione, Ergotamine bitartrate, EINECS 204-023-9, NSC 95090, Ergotamine (INN), UNII-PR834Q503T, BRN 0078890, CHEBI:64318, PR834Q503T, NSC-95090, DTXSID9043774, ergopeptine, ERGOTAMINE [INN], Ergotaminum (INN-Latin), Ergotamina (INN-Spanish), (5'alpha)-12'-Hydroxy-2'-methyl-5'-(phenylmethyl)ergotoman-3',6',18-trione, Ergotamine [INN:BAN], Ergotaman-3',6',18-trione, 12'-hydroxy-2'-methyl-5'-(phenylmethyl)-, (5'-alpha)-, Ergotaman-3',6',18-trione, 12'-hydroxy-2'-methyl-5'-(phenylmethyl)-, (5'alpha)-, (5'alpha)-5'-benzyl-12'-hydroxy-2'-methyl-3',6',18-trioxoergotaman, (4R,7R)-N-[(1S,2S,4R,7S)-7-benzyl-2-hydroxy-4-methyl-5,8-dioxo-3-oxa-6,9-diazatricyclo[7.3.0.0^{2,6}]dodecan-4-yl]-6-methyl-6,11-diazatetracyclo[7.6.1.0^{2,7}.0^{12,16}]hexadeca-1(16),2,9,12,14-pentaene-4-carboxamide, 379-79-3, Ergotaman-3',6',18-trione, 12'-hydroxy-2'-methyl-5'-(phenylmethyl)-, (5'alpha)-, (2R,3R)-2,3-dihydroxybutanedioate (2:1) (salt), ERM, Ergotaminum (Latin), Ergotamin, ergotaminum, NSC41869, ERGOTAMINE [MI], ERGOTAMINE [HSDB], ERGOTAMINE [VANDF], CHEMBL442, SCHEMBL1483, ERGOTAMINE [WHO-DD], GTPL149, DTXCID7023774, N02CA02, XCGSFFUVFURLIX-VFGNJEKYSA-N, Ergotamine tartrate, Avetol, Cornutamin, Ergam, Ergotartrate, HMS2089H22, BDBM50027065, Ergotamine dried down 100 microg/mL, AKOS015896505, DB00696, NCGC00356592-02, D07906, AB01275473-01, Q419186, CODERGOCRINE MESILATE IMPURITY C [EP IMPURITY], 5'alpha-benzyl-12'-hydroxy-2'-methyl-3',6',18-trioxoergotaman, (5''alpha)-12''-hydroxy-2''-methyl-5''-(phenylmethyl)ergotoman-3'',6'',18-trione, (5''alpha)-5''-benzyl-12''-hydroxy-2''-methyl-3'',6'',18-trioxoergotaman, (5'alpha)-12'-Hydroxy-2'-methyl-5'-(phenylmethyl)ergotaman-3',6',18-trione, (5alpha,5'beta)-5'-benzyl-12'-hydroxy-2'-methyl-3',6',18-trioxoergotaman, 12''-hydroxy-2''-methyl-5''alpha-(phenylmethyl)ergotaman-3'',6'',18-trione, 1080650-16-3, 204-023-9, N-[(2R,5S,10aS,10bS)-5-benzyl-10b-hydroxy-2-methyl-3,6-dioxo-8,9,10,10a-tetrahydro-5H-oxazolo[[?]]pyrrolo[[?]]pyrazin-2-yl]-methyl-[?]carboxamide |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 118.0 |
| Hydrogen Bond Donor Count | 3.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | CC(CC1CC2C3CCCC3C(C)C(CC3CCCCC3)C2C1C)C1CCC2CC3CCC4CCCC(C2C1)C43 |
| Np Classifier Class | Ergot alkaloids |
| Deep Smiles | O=C[C@H]CNC)[C@H]C=C6)cccccc6cC%10)c[nH]5))))))))))))))N[C@]C)O[C@@]NC5=O))[C@@H]Ccccccc6)))))))C=O)N[C@H]6CCC5))))))))O |
| Heavy Atom Count | 43.0 |
| Classyfire Class | Ergoline and derivatives |
| Scaffold Graph Node Level | OC(NC1OC2C3CCCN3C(O)C(CC3CCCCC3)N2C1O)C1CNC2CC3CNC4CCCC(C2C1)C34 |
| Classyfire Subclass | Lysergic acids and derivatives |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1220.0 |
| Database Name | hmdb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 6.0 |
| Uniprot Id | P08684, P05177, P08913, P18089, P14416, P08183, P23975, P28222, P28223, P28221, P35348, P35368, P25100, P47898, O08786, P56481, O15245, O32393, n.a., P43140, P15823, P18825, P08588, P07550, P21728, P35462, P06241, P06239, P19327, P28564, P41595, P28335, O70528, P50406, P24557, P21447, P06795 |
| Iupac Name | (6aR,9R)-N-[(1S,2S,4R,7S)-7-benzyl-2-hydroxy-4-methyl-5,8-dioxo-3-oxa-6,9-diazatricyclo[7.3.0.02,6]dodecan-4-yl]-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
| Nih Violation | False |
| Class | Ergoline and derivatives |
| Veber Rule | True |
| Classyfire Superclass | Alkaloids and derivatives |
| Xlogp | 2.0 |
| Superclass | Alkaloids and derivatives |
| Is Pains | False |
| Subclass | Lysergic acids and derivatives |
| Gsk 4 400 Rule | False |
| Molecular Formula | C33H35N5O5 |
| Scaffold Graph Node Bond Level | O=C(NC1OC2C3CCCN3C(=O)C(Cc3ccccc3)N2C1=O)C1C=C2c3cccc4[nH]cc(c34)CC2NC1 |
| Inchi Key | XCGSFFUVFURLIX-VFGNJEKYSA-N |
| Silicos It Class | Poorly soluble |
| Rotatable Bond Count | 4.0 |
| State | Solid |
| Synonyms | (5'alpha)-12'-Hydroxy-2'-methyl-5'-(phenylmethyl)ergotoman-3',6',18-trione, 12'-Hydroxy-2'-methyl-5'alpha-(phenylmethyl)ergotaman-3',6',18-trione, Ergotamin, Ergotamina, Ergotaminum, Gynergen, (5'a)-12'-Hydroxy-2'-methyl-5'-(phenylmethyl)ergotoman-3',6',18-trione, (5'Α)-12'-hydroxy-2'-methyl-5'-(phenylmethyl)ergotoman-3',6',18-trione, 12'-Hydroxy-2'-methyl-5'a-(phenylmethyl)ergotaman-3',6',18-trione, 12'-Hydroxy-2'-methyl-5'α-(phenylmethyl)ergotaman-3',6',18-trione, Cornutamine, Ergotaminine, Lingraine, Tartrate, ergotamine, ErgoKranit, Ergo-kranit, Ergotamine tartrate (2:1), mono, Ergodryl, Pfizer brand OF ergotamine tartrate, Ergo sanol, Ergo kranit, Ergodryl mono, Ergomar, Ergostat, Ergotamine tartrate, Krewel brand OF ergotamine tartrate, Lotus brand OF ergotamine tartrate, Sanofi winthrop brand OF ergotamine tartrate, ergotamine |
| Esol Class | Moderately soluble |
| Functional Groups | CN(C)C, CN(C)C(C)=O, C[C@@]1(NC(C)=O)O[C@](C)(O)N(C)C1=O, cC(C)=CC, c[nH]c |
| Compound Name | Ergotamine |
| Kingdom | Organic compounds |
| Exact Mass | 581.264 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 581.264 |
| Hydrogen Bond Acceptor Count | 6.0 |
| Molecular Weight | 581.7 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 6.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C33H35N5O5/c1-32(35-29(39)21-15-23-22-10-6-11-24-28(22)20(17-34-24)16-25(23)36(2)18-21)31(41)38-26(14-19-8-4-3-5-9-19)30(40)37-13-7-12-27(37)33(38,42)43-32/h3-6,8-11,15,17,21,25-27,34,42H,7,12-14,16,18H2,1-2H3,(H,35,39)/t21-,25-,26+,27+,32-,33+/m1/s1 |
| Smiles | C[C@@]1(C(=O)N2[C@H](C(=O)N3CCC[C@H]3[C@@]2(O1)O)CC4=CC=CC=C4)NC(=O)[C@H]5CN([C@@H]6CC7=CNC8=CC=CC(=C78)C6=C5)C |
| Np Classifier Biosynthetic Pathway | Alkaloids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | Ergotamines, dihydroergotamines, and derivatives |
| Np Classifier Superclass | Tryptophan alkaloids |
- 1. Outgoing r'ship
FOUND_INto/from Bromus Inermis (Plant) Rel Props:Reference:ISBN:9788172360481 - 2. Outgoing r'ship
FOUND_INto/from Elymus Repens (Plant) Rel Props:Reference:ISBN:9788172360481