Amyl Nitrite
PubChem CID: 8053
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | ISOAMYL NITRITE, Isopentyl nitrite, 110-46-3, 3-Methylbutyl nitrite, Vaporole, Amilnitrite, Aspiral, 3-Methylbutanol nitrite, Nitrous acid, 3-methylbutyl ester, Pentanoli nitris, Nitrous acid, isopentyl ester, Amyl nitrite I, Isopentyl alcohol, nitrite, Nitramyl (VAN), Amyl nitrite (VAN), Amyl nitrit, Amyl nitrite [USAN], iso-amyl nitrite, NSC 7903, Isoamylnitrite, CCRIS 1098, HSDB 606, iso-amylnitrite, UNII-5N0U5TUC9Z, EINECS 203-770-8, 5N0U5TUC9Z, Vaporole (TN), Aspiral (TN), BRN 0969510, CHEBI:2691, DTXSID9025455, AI3-25183, NSC-7903, MFCD00002057, DTXCID402605, NCI-C50179, NCGC00091066-01, Amilnitrit, CAS-110-46-3, isopentylnitrit, Amylnitrit, isoamyInitrite, isopentylnitrite, Nitrite, Amyl, Nitrous acid 3-methylbutyl ester, Isoamyl nitrite 97%, stabilized, Vaporole amyl nitrite, Isopentyl alcohol nitrite, Nitrite Isopentyl alcohol, Isopentyl nitrite, 96%, WLN: ONO2Y, AMYL NITRITE [JAN], 3-methyl-1-nitrosooxybutane, isopentyl ester Nitrous acid, AMYL NITRITE [HSDB], SCHEMBL23785, Amyl nitrite (JP15/USP), Amyl nitrite (JP18/USP), ISOAMYL NITRITE [MI], 3-methyl-1-nitrosooxy-butane, AMYL NITRITE (MART.), CHEMBL1535371, NSC7903, Tox21_111074, Tox21_200983, AMYL NITRITE (USP MONOGRAPH), STL264239, AKOS009157290, Isopentyl nitrite, >=97.0% (GC), NCGC00091066-02, NCGC00258536-01, FI106434, LS-13086, DB-002757, I0089, NS00005900, EN300-35960, C07457, D00517, SR-01000944365, SR-01000944365-1, Q27888090, F0001-0219, Isoamyl nitrite, stab. with 0.2% anhyd. sodium carbonate, InChI=1/C5H11NO2/c1-5(2)3-4-8-6-7/h5H,3-4H2,1-2H, 203-770-8 |
|---|---|
| Topological Polar Surface Area | 38.7 |
| Hydrogen Bond Donor Count | 0.0 |
| Heavy Atom Count | 8.0 |
| Description | Isoamyl nitrite (IAN) has been used as antianginal agents for more than 100 years. It is now established that IAN cause direct vasorelaxation through vascular generation of NO and relaxation via a cyclic guanosine monophosphate-dependent process. (PMID: 8996213) IAN is a member of the family of volatile organic nitrites that exert vasodilatory effects and have recently exhibited a considerable potential for inhalation abuse. (PMID: 9829558) All nitrovasodilators act intracellularly by a common molecular mechanism. This is characterized by the release of nitric oxide (NO). This process basically depends on the presence of oxygen as electron acceptor from the sydnonimine molecule. Organic nitrites (such as IAN) require the interaction with a mercapto group to form a S-nitrosothiol intermediate, from which finally NO radicals are liberated. In the presence of thiol compounds organic nitrites (e.g., IAN) and nitrosothiols may act as intermediary products of NO generation. (PMID: 1683227) [HMDB] |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 63.4 |
| Database Name | cmaup_ingredients;fooddb_chem_all;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | P00352, P19793, Q16236 |
| Iupac Name | 3-methylbutyl nitrite |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Class | Organic oxoanionic compounds |
| Target Id | NPT94 |
| Xlogp | 1.7 |
| Superclass | Organooxygen compounds |
| Is Pains | False |
| Subclass | Organic nitrites |
| Molecular Formula | C5H11NO2 |
| Prediction Swissadme | 0.0 |
| Inchi Key | OWFXIOWLTKNBAP-UHFFFAOYSA-N |
| Fcsp3 | 1.0 |
| Logs | -2.122 |
| Rotatable Bond Count | 3.0 |
| State | Solid |
| Logd | 1.581 |
| Synonyms | 3-Methylbutanol nitrite, 3-Methylbutyl nitrite, Amilnitrite, Amyl nitrit, Amyl nitrite, Amyl nitrite (JP15/USP), Amyl nitrite (van), Amyl nitrite [usan], Amyl nitrite I, amyl nitrite(mixed isomers), Amyl nitrosum, Aspiral, Aspiral (TN), IPN, Isoamyl nitrite, isopentyl ester Nitrous acid, Isopentyl nitrite, Nitramyl, Nitramyl (van), Nitrite Isopentyl alcohol, Nitrous acid 3-methylbutyl ester, Nitrous acid, 3-methylbutyl ester, Nitrous acid, isopentyl ester, Pentanoli nitris, Pentyl nitrite, Vaporole, Vaporole (TN), Vaporole amyl nitrite |
| Substituent Name | Alkyl nitrite, O-nitroso compound, Hydrocarbon derivative, Aliphatic acyclic compound |
| Compound Name | Amyl Nitrite |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 117.079 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 117.079 |
| Hydrogen Bond Acceptor Count | 3.0 |
| Molecular Weight | 117.15 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Esol | -1.3922176 |
| Inchi | InChI=1S/C5H11NO2/c1-5(2)3-4-8-6-7/h5H,3-4H2,1-2H3 |
| Smiles | CC(C)CCON=O |
| Nring | 0.0 |
| Defined Bond Stereocenter Count | 0.0 |
- 1. Outgoing r'ship
FOUND_INto/from Leibnitzia Anandria (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all