1-Methoxy-2-propanol
PubChem CID: 7900
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 1-Methoxy-2-propanol, 107-98-2, 1-Methoxypropan-2-ol, Methoxyisopropanol, PGME, 2-Propanol, 1-methoxy-, Propylene glycol monomethyl ether, Closol, 1-Methoxy-2-hydroxypropane, Dowtherm 209, PROPYLENE GLYCOL METHYL ETHER, Propasol solvent M, Dowanol 33B, 2-Methoxy-1-methylethanol, Propylene glycol 1-methyl ether, HSDB 1016, Ucar solvent lm, Solvent PM, Icinol PM, NSC 2409, methoxy isopropanol, EINECS 203-539-1, UNII-74Z7JO8V3U, UN3092, Dowanol-33B, BRN 1731270, DTXSID8024284, AI3-15573, 1-methoxy-propan-2-ol, NSC-2409, Propan-1-methoxy-2-ol, Propan-2-ol, 1-methoxy-, .alpha.-Propylene glycol monomethyl ether, Propylenglykol-monomethylaether, 74Z7JO8V3U, DTXCID804284, Propyleneglycol monomethyl ether, Methoxypropanol, .alpha. isomer, EC 203-539-1, 3-01-00-02146 (Beilstein Handbook Reference), Methyl proxitol, 1-METHOXY-2-HYDROXYPROPANE [HSDB], 2-Propanol, methoxy-, Ucar Solvent LM (Obs.), CAS-107-98-2, MFCD00004537, propyleneglycol monomethylether, Glycol ether pm, 1-methoxypropanol, PolySolve MPM, 1Methoxy2propanol, Dowtherm209, Methoxy-2-propanol, 2Propanol, 1methoxy, 2Methoxy1methylethanol, 3-methoxy-2-propanol, 1Methoxy2hydroxypropane, Dowanol pm glycol ether, 3-methoxy-propan-2-ol, 1-methoxy-propane-2-ol, rac-1-methoxy-2-propanol, 1,2-PROPYLENE GLYCOL 1-MONOMETHYL ETHER, 2-methoxy-1-methyl ethanol, UCAR SOLVENT (Obs.), Methoxypropanol, alpha isomer, propylene glycol monomethylether, 1-Methoxy-2-propanol, 98%, (+/-)-1-methoxy-2-propanol, CHEMBL3186306, METHOXYISOPROPANOL [INCI], DTXSID10872972, NSC2409, WLN: QY1 & 1O1, propylene glycol mono methyl ether, (+/-)2-methoxy-1-methylethanol, Propylene Glycol 1-Monomethyl Ether, Tox21_201803, Tox21_303269, 1-Methoxy-2-propanol, >=99.5%, AKOS009158246, FM75064, SB44649, SB44662, NCGC00249123-01, NCGC00256978-01, NCGC00259352-01, SY012761, 1-Methoxy-2-propanol, analytical standard, Propylene glycol monomethyl ether (ACGIH), DB-016688, M0126, NS00003122, EN300-73396, E72455, Q1884806, 1-Methoxy-2-propanol [UN3092] [Flammable liquid], Z825742124 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 29.5 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Deep Smiles | COCCO)C |
| Heavy Atom Count | 6.0 |
| Classyfire Class | Organooxygen compounds |
| Classyfire Subclass | Alcohols and polyols |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 28.7 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 1-methoxypropan-2-ol |
| Veber Rule | True |
| Classyfire Superclass | Organic oxygen compounds |
| Xlogp | -0.2 |
| Gsk 4 400 Rule | True |
| Molecular Formula | C4H10O2 |
| Inchi Key | ARXJGSRGQADJSQ-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 2.0 |
| Synonyms | 1-methoxypropan-2-ol |
| Esol Class | Very soluble |
| Functional Groups | CO, COC |
| Compound Name | 1-Methoxy-2-propanol |
| Exact Mass | 90.0681 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 90.0681 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 90.12 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C4H10O2/c1-4(5)3-6-2/h4-5H,3H2,1-2H3 |
| Smiles | CC(COC)O |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
- 1. Outgoing r'ship
FOUND_INto/from Actinidia Arguta (Plant) Rel Props:Reference:https://doi.org/10.1016/s0031-9422(03)00142-0