2,10,11-trimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-1-ol
PubChem CID: 78172954
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 1-Hydroxy-2,10,11-trimethoxynoraporphine |
|---|---|
| Topological Polar Surface Area | 60.0 |
| Hydrogen Bond Donor Count | 2.0 |
| Inchi Key | HVMMFGYMZZVURQ-UHFFFAOYSA-N |
| Rotatable Bond Count | 3.0 |
| State | Solid |
| Substituent Name | Aporphine, Benzylisoquinoline, Phenanthrene, Benzoquinoline, 1-naphthol, Tetrahydroisoquinoline, Quinoline, Naphthalene, Methoxyphenol, Anisole, Aralkylamine, Alkyl aryl ether, Benzenoid, Azacycle, Organoheterocyclic compound, Secondary amine, Ether, Secondary aliphatic amine, Hydrocarbon derivative, Organooxygen compound, Organonitrogen compound, Amine, Aromatic heteropolycyclic compound |
| Synonyms | 1-Hydroxy-2,10,11-trimethoxynoraporphine, Norcorydine |
| Heavy Atom Count | 24.0 |
| Compound Name | 2,10,11-trimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-1-ol |
| Kingdom | Organic compounds |
| Description | Alkaloid from Annona squamosa (sugar apple). Norcorydine is found in custard apple and fruits. |
| Exact Mass | 327.147 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 327.147 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 447.0 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 327.4 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2,10,11-trimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-1-ol |
| Total Atom Stereocenter Count | 1.0 |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Total Bond Stereocenter Count | 0.0 |
| Class | Aporphines |
| Inchi | InChI=1S/C19H21NO4/c1-22-13-5-4-10-8-12-15-11(6-7-20-12)9-14(23-2)18(21)17(15)16(10)19(13)24-3/h4-5,9,12,20-21H,6-8H2,1-3H3 |
| Smiles | COC1=C(C2=C(CC3C4=C2C(=C(C=C4CCN3)OC)O)C=C1)OC |
| Xlogp | 2.6 |
| Superclass | Alkaloids and derivatives |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | Aporphines |
| Molecular Formula | C19H21NO4 |
- 1. Outgoing r'ship
FOUND_INto/from Annona Reticulata (Plant) Rel Props:Source_db:fooddb_chem_all