Isoamyl butyrate
PubChem CID: 7795
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Isoamyl butyrate, Isopentyl butyrate, 106-27-4, 3-Methylbutyl butanoate, Isoamyl butanoate, ISOPENTYL BUTANOATE, 3-Methylbutyl butyrate, Butanoic acid, 3-methylbutyl ester, Butyric acid, isopentyl ester, Isoamyl-n-butyrate, Isopentyl alcohol, butyrate, Isoamyl butylate, Butyric acid isoamylester, FEMA No. 2060, Isoamyl butyrate (natural), Isopentyl-n-butyrate, 3-Methyl-1-butyl butanoate, CCRIS 6556, butanoic acid 3-methylbutyl ester, NSC 6548, EINECS 203-380-8, UNII-505AFM77VU, iso-Amyl n-butyrate, BRN 1702557, 505AFM77VU, DTXSID3042059, CHEBI:87422, AI3-06126, NSC-6548, 3-Methylbutyl n-butyrate, butyric acid isopentyl ester, WE(4:0(3Me)/4:0), ISOAMYL BUTYRATE [MI], ISOAMYL BUTYRATE [FCC], ISOAMYL BUTYRATE [FHFI], DTXCID1022059, Isoamyl n-Butyrate, Butyric Acid Isoamyl Ester, isoamylbutyrate, Isoamyl butyric acid, MFCD00044888, SCHEMBL112594, CHEMBL3187370, NSC6548, Tox21_300384, Isoamyl butyrate, analytical standard, LMFA07010574, AKOS015907968, CS-W016198, HY-W015482, Isoamyl butyrate, >=98%, FCC, FG, NCGC00248015-01, NCGC00254545-01, CAS-106-27-4, LS-13707, DB-254948, B0760, NS00012653, E75851, Isoamyl butyrate, natural, >=98%, FCC, FG, A801410, Q49081089 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 26.3 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Np Classifier Class | Wax monoesters |
| Deep Smiles | CCCC=O)OCCCC)C |
| Heavy Atom Count | 11.0 |
| Classyfire Class | Fatty acyls |
| Description | Present in fruit aromas, e.g. apricot, melon, mango etcand is) also present in wines, eucalyptus oil and coconut oil. It is used in fruit flavours. Isoamyl butyrate is found in many foods, some of which are fats and oils, fruits, apple, and roman camomile. |
| Classyfire Subclass | Fatty acid esters |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 108.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 3-methylbutyl butanoate |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Class | Fatty Acyls |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 2.6 |
| Superclass | Lipids and lipid-like molecules |
| Is Pains | False |
| Subclass | Fatty acid esters |
| Gsk 4 400 Rule | True |
| Molecular Formula | C9H18O2 |
| Prediction Swissadme | 1.0 |
| Inchi Key | PQLMXFQTAMDXIZ-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.8888888888888888 |
| Logs | -3.055 |
| Rotatable Bond Count | 6.0 |
| State | Liquid |
| Logd | 3.335 |
| Synonyms | 3-Methyl-1-butyl butanoate, 3-methylbutyl butanoate, 3-Methylbutyl butyrate, Butanoic acid, 3-methylbutyl ester, Butyric acid isoamylester, Butyric acid, isopentyl ester, Isoamyl butanoate, Isoamyl butylate, Isoamyl butyrate, Isoamyl-n-butyrate, Isopentyl alcohol, butyrate, Isopentyl butanoate, Isopentyl butyrate, Isopentyl-n-butyrate, Butyric acid isopentyl ester, Butyrate isopentyl ester, Isoamyl butanoic acid, Isopentyl butanoic acid, Isopentyl butyric acid, Isoamyl butyric acid, 3-Methylbutyl butanoate, Isoamyl-N-butyrate, Isopentyl-N-butyrate, 3-Methylbutyl butyric acid, 3-methylbutyl butanoate, isoamyl butyrate, lsoamyl butyrate |
| Substituent Name | Fatty acid ester, Carboxylic acid ester, Monocarboxylic acid or derivatives, Ether, Carboxylic acid derivative, Hydrocarbon derivative, Organooxygen compound, Carbonyl group, Aliphatic acyclic compound |
| Esol Class | Soluble |
| Functional Groups | COC(C)=O |
| Compound Name | Isoamyl butyrate |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 1.0 |
| Exact Mass | 158.131 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 158.131 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 158.24 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic acyclic compounds |
| Lipinski Rule Of 5 | True |
| Esol | -2.0819942 |
| Inchi | InChI=1S/C9H18O2/c1-4-5-9(10)11-7-6-8(2)3/h8H,4-7H2,1-3H3 |
| Smiles | CCCC(=O)OCCC(C)C |
| Nring | 0.0 |
| Np Classifier Biosynthetic Pathway | Fatty acids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | Fatty acid esters |
| Np Classifier Superclass | Fatty esters |
- 1. Outgoing r'ship
FOUND_INto/from Ammi Visnaga (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2008.10643593 - 2. Outgoing r'ship
FOUND_INto/from Annona Cherimola (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.3292 - 3. Outgoing r'ship
FOUND_INto/from Capsicum Annuum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 4. Outgoing r'ship
FOUND_INto/from Carissa Carandas (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2004.9698764 - 5. Outgoing r'ship
FOUND_INto/from Chamaemelum Nobile (Plant) Rel Props:Source_db:fooddb_chem_all - 6. Outgoing r'ship
FOUND_INto/from Corymbia Maculata (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.1026 - 7. Outgoing r'ship
FOUND_INto/from Eucalyptus Resinifera (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.1026 - 8. Outgoing r'ship
FOUND_INto/from Eucalyptus Tereticornis (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.1026 - 9. Outgoing r'ship
FOUND_INto/from Hippophae Rhamnoides (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 10. Outgoing r'ship
FOUND_INto/from Juniperus Communis (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2006.9699150 - 11. Outgoing r'ship
FOUND_INto/from Malus Domestica (Plant) Rel Props:Source_db:fooddb_chem_all - 12. Outgoing r'ship
FOUND_INto/from Murraya Koenigii (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2009.10643781 - 13. Outgoing r'ship
FOUND_INto/from Musa Acuminata (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.997 - 14. Outgoing r'ship
FOUND_INto/from Musa Paradisiaca (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2003.9712071 - 15. Outgoing r'ship
FOUND_INto/from Pistacia Lentiscus (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.2730060406 - 16. Outgoing r'ship
FOUND_INto/from Ribes Nigrum (Plant) Rel Props:Source_db:fooddb_chem_all - 17. Outgoing r'ship
FOUND_INto/from Salvia Spinosa (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.1419 - 18. Outgoing r'ship
FOUND_INto/from Spondias Mombin (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2005.9698933 - 19. Outgoing r'ship
FOUND_INto/from Teucrium Chamaedrys (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2009.9700133 - 20. Outgoing r'ship
FOUND_INto/from Vitis Vinifera (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all