Stearyl Palmitate
PubChem CID: 75778
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Stearyl palmitate, Octadecyl palmitate, Octadecyl hexadecanoate, 2598-99-4, Hexadecanoic acid, octadecyl ester, Palmitic acid stearyl ester, 100231-75-2, Palmitic acid, octadecyl ester, octadecanyl hexadecanoate, Lanolin anhydrous, EINECS 220-000-6, UNII-214W90O2XZ, AI3-30713, EINECS 309-376-3, DTXSID0026048, CHEBI:84066, 214W90O2XZ, WE(18:0/16:0), PALMITIC ACID, STEARYL ESTER, Stearylpalmitate, Hexadecanoic Acid Octadecyl Ester, Palmitic Acid Octadecyl Ester, Octadecyl Hexadecanoate, Octadecyl Palmitate, Purester 34, , Stearyl palmitate, >=99%, palmitic acid octadecyl ester, SCHEMBL33919, DTXCID006048, STEARYL PALMITATE [INCI], Hexadecanoic acid octadecyl ester, LMFA07010049, MFCD00056224, AKOS028115046, CCG-269767, HY-W127430, DA-74881, TS-08739, DB-046811, NS00020618, Q27157447, 309-376-3, 8044-50-6 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 26.3 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Np Classifier Class | Wax monoesters |
| Deep Smiles | CCCCCCCCCCCCCCCCCCOC=O)CCCCCCCCCCCCCCC |
| Heavy Atom Count | 36.0 |
| Classyfire Class | Fatty acyls |
| Classyfire Subclass | Fatty acid esters |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 406.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | octadecyl hexadecanoate |
| Veber Rule | False |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 16.3 |
| Gsk 4 400 Rule | False |
| Molecular Formula | C34H68O2 |
| Inchi Key | BILPUZXRUDPOOF-UHFFFAOYSA-N |
| Silicos It Class | Insoluble |
| Rotatable Bond Count | 32.0 |
| Synonyms | octadecyl palmitate |
| Esol Class | Insoluble |
| Functional Groups | COC(C)=O |
| Compound Name | Stearyl Palmitate |
| Exact Mass | 508.522 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 508.522 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 508.9 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | False |
| Inchi | InChI=1S/C34H68O2/c1-3-5-7-9-11-13-15-17-18-19-21-23-25-27-29-31-33-36-34(35)32-30-28-26-24-22-20-16-14-12-10-8-6-4-2/h3-33H2,1-2H3 |
| Smiles | CCCCCCCCCCCCCCCCCCOC(=O)CCCCCCCCCCCCCCC |
| Np Classifier Biosynthetic Pathway | Fatty acids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Np Classifier Superclass | Fatty esters |
- 1. Outgoing r'ship
FOUND_INto/from Bombax Ceiba (Plant) Rel Props:Reference:ISBN:9770972795006