Cyclohexyl methacrylate
PubChem CID: 7561
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | CYCLOHEXYL METHACRYLATE, 101-43-9, 2-Propenoic acid, 2-methyl-, cyclohexyl ester, cyclohexyl 2-methylprop-2-enoate, Methacrylic acid, cyclohexyl ester, 2-Methyl-2-propenoic acid cyclohexyl ester, cyclohexylmethacrylate, UNII-5L9UUV9T6Q, Ageflex CHMA, 5L9UUV9T6Q, ACRYESTER CH, HSDB 5340, EINECS 202-943-5, NSC 20968, NSC-20968, AI3-33324, Cyclohexyl methacrylate, monomer, DTXSID7051507, CYCLOHEXANOL, METHACRYLATE, OIWOHHBRDFKZNC-UHFFFAOYSA-, EC 202-943-5, CYCLOHEXYL METHACRYLATE [HSDB], 2-Methyl-2-propenoic acid, cyclohexyl ester, Cyclohexyl Methacrylate (stabilized with MEHQ), Methacrylic acid cyclohexyl ester, MFCD00014292, SCHEMBL22480, Cyclohexyl 2-methylacrylate #, DTXCID8030055, NSC20968, CYCLOHEXYL METHACRYLATE [INCI], AKOS015915456, AS-66818, Methacrylic acid, cyclohexyl ester (8CI), Cyclohexyl methacrylate(stabilizedwithMEHQ), 2Propenoic acid, 2methyl, cyclohexyl ester, CS-0167875, M0594, NS00002297, E82081, Cyclohexyl Methacrylate, (stabilized with MEHQ), Q27262518, Cyclohexyl methacrylate, contains 60 - 100 ppm MEHQ as stabilizer, 98%, Cyclohexyl methacrylate, >=97%, contains ~60 ppm monomethyl ether hydroquinone as inhibitor, 202-943-5 |
|---|---|
| Topological Polar Surface Area | 26.3 |
| Hydrogen Bond Donor Count | 0.0 |
| Heavy Atom Count | 12.0 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 178.0 |
| Database Name | cmaup_ingredients;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | cyclohexyl 2-methylprop-2-enoate |
| Nih Violation | True |
| Prediction Hob | 1.0 |
| Xlogp | 2.9 |
| Is Pains | False |
| Molecular Formula | C10H16O2 |
| Prediction Swissadme | 1.0 |
| Inchi Key | OIWOHHBRDFKZNC-UHFFFAOYSA-N |
| Fcsp3 | 0.7 |
| Logs | -2.662 |
| Rotatable Bond Count | 3.0 |
| Logd | 2.945 |
| Compound Name | Cyclohexyl methacrylate |
| Prediction Hob Swissadme | 1.0 |
| Exact Mass | 168.115 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 168.115 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 168.23 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Esol | -2.5057631999999996 |
| Inchi | InChI=1S/C10H16O2/c1-8(2)10(11)12-9-6-4-3-5-7-9/h9H,1,3-7H2,2H3 |
| Smiles | CC(=C)C(=O)OC1CCCCC1 |
| Nring | 1.0 |
| Defined Bond Stereocenter Count | 0.0 |
- 1. Outgoing r'ship
FOUND_INto/from Pterocarpus Indicus (Plant) Rel Props:Source_db:cmaup_ingredients