beta-D-Glucopyranosyl anthranilate
PubChem CID: 75595895
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | beta-D-Glucopyranosyl anthranilate, b-D-Glucopyranosyl anthranilate, CHEBI:177986, [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 2-aminobenzoate |
|---|---|
| Topological Polar Surface Area | 142.0 |
| Hydrogen Bond Donor Count | 5.0 |
| Inchi Key | GTQKOJVFDJDUGN-UHFFFAOYSA-N |
| Rotatable Bond Count | 4.0 |
| Synonyms | b-D-Glucopyranosyl anthranilate, Glucopyranosyl anthranilate |
| Heavy Atom Count | 21.0 |
| Compound Name | beta-D-Glucopyranosyl anthranilate |
| Description | Constituent of the fruit of pi~nuela Bromelia plumieri. Glucopyranosyl anthranilate is found in fruits and corn. |
| Exact Mass | 299.101 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 299.101 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 366.0 |
| Hydrogen Bond Acceptor Count | 8.0 |
| Molecular Weight | 299.28 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 2-aminobenzoate |
| Total Atom Stereocenter Count | 5.0 |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C13H17NO7/c14-7-4-2-1-3-6(7)12(19)21-13-11(18)10(17)9(16)8(5-15)20-13/h1-4,8-11,13,15-18H,5,14H2 |
| Smiles | C1=CC=C(C(=C1)C(=O)OC2C(C(C(C(O2)CO)O)O)O)N |
| Xlogp | -0.5 |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C13H17NO7 |
- 1. Outgoing r'ship
FOUND_INto/from Zea Mays (Plant) Rel Props:Source_db:fooddb_chem_all